1.0 2011-09-21 00:21:02 UTC 2015-07-21 06:57:24 UTC FDB022881 S-(2-Carboxypropyl)-Cysteamine S-(2-carboxypropyl)-Cysteamine enhances the procoagulant activity of factor VIII-East Hartford, a dysfunctional protein due to a light chain thrombin cleavage site mutation (PMID 1569180) S-(2-carboxypropyl)-Cysteamine is known to modify mutant proteins with an arg-to-cys substitution (PMID 1569181) [HMDB] 3-((2-aminoethyl)thio)-2-methyl-Propanoate 3-((2-aminoethyl)thio)-2-methyl-Propanoic acid S-(2-Carboxypropyl)cysteamine C6H13NO2S 163.238 163.066699355 3-[(2-aminoethyl)sulfanyl]-2-methylpropanoic acid S-(2-carboxypropyl)cysteamine 80186-81-8 CC(CSCCN)C(O)=O InChI=1S/C6H13NO2S/c1-5(6(8)9)4-10-3-2-7/h5H,2-4,7H2,1H3,(H,8,9) UFRVABODKAYFCB-UHFFFAOYSA-N belongs to the class of organic compounds known as amino acids. These are organic compounds that contain at least one carboxyl group and one amino group. Amino acids Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Dialkylthioethers Hydrocarbon derivatives Monoalkylamines Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Sulfenyl compounds Aliphatic acyclic compound Amine Amino acid Carbonyl group Carboxylic acid Dialkylthioether Hydrocarbon derivative Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Organosulfur compound Primary aliphatic amine Primary amine Sulfenyl compound Thioether Solid logp -1.86 ALOGPS logs -1.00 ALOGPS solubility 1.64e+01 g/l ALOGPS logp -1.9 ChemAxon pka_strongest_acidic 4.48 ChemAxon pka_strongest_basic 9.71 ChemAxon iupac 3-[(2-aminoethyl)sulfanyl]-2-methylpropanoic acid ChemAxon average_mass 163.238 ChemAxon mono_mass 163.066699355 ChemAxon smiles CC(CSCCN)C(O)=O ChemAxon formula C6H13NO2S ChemAxon inchi InChI=1S/C6H13NO2S/c1-5(6(8)9)4-10-3-2-7/h5H,2-4,7H2,1H3,(H,8,9) ChemAxon inchikey UFRVABODKAYFCB-UHFFFAOYSA-N ChemAxon polar_surface_area 63.32 ChemAxon refractivity 42.45 ChemAxon polarizability 17.56 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 14314 Specdb::CMs 38295 Specdb::CMs 151702 Specdb::MsIr 1658 Specdb::MsIr 1659 Specdb::MsIr 1660 Specdb::NmrOneD 149080 Specdb::NmrOneD 149081 Specdb::NmrOneD 149082 Specdb::NmrOneD 149083 Specdb::NmrOneD 149084 Specdb::NmrOneD 149085 Specdb::NmrOneD 149086 Specdb::NmrOneD 149087 Specdb::NmrOneD 149088 Specdb::NmrOneD 149089 Specdb::NmrOneD 149090 Specdb::NmrOneD 149091 Specdb::NmrOneD 149092 Specdb::NmrOneD 149093 Specdb::NmrOneD 149094 Specdb::NmrOneD 149095 Specdb::NmrOneD 149096 Specdb::NmrOneD 149097 Specdb::NmrOneD 149098 Specdb::NmrOneD 149099 Specdb::MsMs 297583 Specdb::MsMs 297584 Specdb::MsMs 297585 Specdb::MsMs 339151 Specdb::MsMs 339152 Specdb::MsMs 339153 Specdb::MsMs 3053471 Specdb::MsMs 3053472 Specdb::MsMs 3053473 Specdb::MsMs 3116436 Specdb::MsMs 3116437 Specdb::MsMs 3116438 HMDB02169 #<Reference:0x000055ce32ce3c08> #<Reference:0x000055ce32ce3988> #<Reference:0x000055ce32ce3758> #<Reference:0x000055ce32ce3438> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823