1.0 2011-09-21 00:21:04 UTC 2015-07-21 06:57:24 UTC FDB022883 Glycylprolylhydroxyproline Glycylprolylhydroxyproline is a tripeptide that has been found in urine and blood serum (PMID 5134921). In growing children, higher level excretion of urinary hydroxyproline peptides (including glycylprolylhydroxyproline) has been observed (PMID 14105582). [HMDB] g-P-Hyp Gly-L-pro-L-hyp GP-hyp C12H19N3O5 285.2964 285.132470733 (2S)-1-[(2S)-1-(2-aminoacetyl)pyrrolidine-2-carbonyl]-3-hydroxypyrrolidine-2-carboxylic acid glycylprolylhydroxyproline 2239-67-0 NCC(=O)N1CCC[C@H]1C(=O)N1CCC(O)[C@H]1C(O)=O InChI=1S/C12H19N3O5/c13-6-9(17)14-4-1-2-7(14)11(18)15-5-3-8(16)10(15)12(19)20/h7-8,10,16H,1-6,13H2,(H,19,20)/t7-,8?,10-/m0/s1 HVIBGVJOBJJPFB-OFQRNFBNSA-N belongs to the class of organic compounds known as methyl-branched fatty acids. These are fatty acids with an acyl chain that has a methyl branch. Usually, they are saturated and contain only one or more methyl group. However, branches other than methyl may be present. Methyl-branched fatty acids Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acids and conjugates Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Aliphatic acyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Methyl-branched fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Branched fatty acids methylbutyric acid Solid logp -2.48 ALOGPS logs -0.50 ALOGPS solubility 8.94e+01 g/l ALOGPS logp -5.1 ChemAxon pka_strongest_acidic 3.43 ChemAxon pka_strongest_basic 7.83 ChemAxon iupac (2S)-1-[(2S)-1-(2-aminoacetyl)pyrrolidine-2-carbonyl]-3-hydroxypyrrolidine-2-carboxylic acid ChemAxon average_mass 285.2964 ChemAxon mono_mass 285.132470733 ChemAxon smiles NCC(=O)N1CCC[C@H]1C(=O)N1CCC(O)[C@H]1C(O)=O ChemAxon formula C12H19N3O5 ChemAxon inchi InChI=1S/C12H19N3O5/c13-6-9(17)14-4-1-2-7(14)11(18)15-5-3-8(16)10(15)12(19)20/h7-8,10,16H,1-6,13H2,(H,19,20)/t7-,8?,10-/m0/s1 ChemAxon inchikey HVIBGVJOBJJPFB-OFQRNFBNSA-N ChemAxon polar_surface_area 124.17 ChemAxon refractivity 67.29 ChemAxon polarizability 27.38 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 6 ChemAxon donor_count 3 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 14534 Specdb::CMs 38296 Specdb::MsMs 298090 Specdb::MsMs 298091 Specdb::MsMs 298092 Specdb::MsMs 339784 Specdb::MsMs 339785 Specdb::MsMs 339786 HMDB02171 #<Reference:0x000055ce32ca1038> #<Reference:0x000055ce32ca0e80> #<Reference:0x000055ce32ca0cc8> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823