1.0 2011-09-21 00:21:18 UTC 2015-07-21 06:57:25 UTC FDB022897 Varanic acid Varanic acid is a bile acid that will accumulate in patients with deficiencies in the peroxisomal d-bifunctional protein. The final steps in bile acid biosynthesis take place in peroxisomes and involve oxidative cleavage of the side chain of C27-5beta-cholestanoic acids leading to the formation of the primary bile acids cholic acid and chenodeoxycholic acid. The enoyl-CoA hydratase and beta-hydroxy acyl-CoA dehydrogenase reactions involved in the chain shortening of C27-5beta-cholestanoic acids are catalyzed by peroxisomal d-bifunctional protein. (PMID: 9831634) [HMDB] 3a,7a,12a,24-Tetrahydroxy-5b-cholestan-26-oate 3a,7a,12a,24-Tetrahydroxy-5b-cholestan-26-oic acid 3a,7a,12a,24-Tetrahydroxy-5b-cholestanoate 3a,7a,12a,24-Tetrahydroxy-5b-cholestanoic acid 3alpha,7alpha,12alpha, 24-tetrahydroxy-5beta-cholest-26-oate 3alpha,7alpha,12alpha, 24-tetrahydroxy-5beta-cholest-26-oic acid Baranate Baranic acid Varanate Varanic acid C26H44O5 436.6246 436.318874518 (2R,3R,6R)-2,3-dihydroxy-6-[(1S,2S,5R,7R,10R,11S,14R,15R)-5-hydroxy-2,15-dimethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-14-yl]heptanoic acid varanic acid 1061-64-9 [H][C@@]12CC[C@H]([C@H](C)CC[C@@H](O)[C@@H](O)C(O)=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC[C@]2([H])C[C@H](O)CC[C@]12C InChI=1S/C26H44O5/c1-15(4-9-22(28)23(29)24(30)31)19-7-8-20-18-6-5-16-14-17(27)10-12-25(16,2)21(18)11-13-26(19,20)3/h15-23,27-29H,4-14H2,1-3H3,(H,30,31)/t15-,16-,17-,18+,19-,20+,21+,22-,23-,25+,26-/m1/s1 NRDKNLGDNLHWHG-IYELHLJQSA-N belongs to the class of organic compounds known as trihydroxy bile acids, alcohols and derivatives. These are prenol lipids structurally characterized by a bile acid or alcohol which bears three hydroxyl groups. Trihydroxy bile acids, alcohols and derivatives Organic compounds Lipids and lipid-like molecules Steroids and steroid derivatives Bile acids, alcohols and derivatives Aliphatic homopolycyclic compounds 3-alpha-hydroxysteroids Alpha hydroxy acids and derivatives Beta hydroxy acids and derivatives Carbonyl compounds Carboxylic acids Cholesterols and derivatives Cyclic alcohols and derivatives Hydrocarbon derivatives Hydroxy fatty acids Medium-chain fatty acids Medium-chain hydroxy acids and derivatives Monocarboxylic acids and derivatives Monosaccharides Organic oxides Secondary alcohols Steroid acids 24-hydroxysteroid 25-hydroxysteroid 3-alpha-hydroxysteroid 3-hydroxysteroid Alcohol Aliphatic homopolycyclic compound Alpha-hydroxy acid Beta-hydroxy acid Carbonyl group Carboxylic acid Carboxylic acid derivative Cholestane-skeleton Cholesterol-skeleton Cyclic alcohol Fatty acid Fatty acyl Hydrocarbon derivative Hydroxy acid Hydroxy fatty acid Hydroxysteroid Medium-chain fatty acid Medium-chain hydroxy acid Monocarboxylic acid or derivatives Monosaccharide Organic oxide Organic oxygen compound Organooxygen compound Secondary alcohol Steroid acid Trihydroxy bile acid, alcohol, or derivatives Solid logp 3.41 ALOGPS logs -4.73 ALOGPS solubility 8.10e-03 g/l ALOGPS logp 3.97 ChemAxon pka_strongest_acidic 4.05 ChemAxon pka_strongest_basic -1.4 ChemAxon iupac (2R,3R,6R)-2,3-dihydroxy-6-[(1S,2S,5R,7R,10R,11S,14R,15R)-5-hydroxy-2,15-dimethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-14-yl]heptanoic acid ChemAxon average_mass 436.6246 ChemAxon mono_mass 436.318874518 ChemAxon smiles [H][C@@]12CC[C@H]([C@H](C)CC[C@@H](O)[C@@H](O)C(O)=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC[C@]2([H])C[C@H](O)CC[C@]12C ChemAxon formula C26H44O5 ChemAxon inchi InChI=1S/C26H44O5/c1-15(4-9-22(28)23(29)24(30)31)19-7-8-20-18-6-5-16-14-17(27)10-12-25(16,2)21(18)11-13-26(19,20)3/h15-23,27-29H,4-14H2,1-3H3,(H,30,31)/t15-,16-,17-,18+,19-,20+,21+,22-,23-,25+,26-/m1/s1 ChemAxon inchikey NRDKNLGDNLHWHG-IYELHLJQSA-N ChemAxon polar_surface_area 97.99 ChemAxon refractivity 119.74 ChemAxon polarizability 51.21 ChemAxon rotatable_bond_count 6 ChemAxon acceptor_count 5 ChemAxon donor_count 4 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 18298 Specdb::CMs 38307 Specdb::CMs 135177 Specdb::CMs 142911 Specdb::MsMs 306574 Specdb::MsMs 306575 Specdb::MsMs 306576 Specdb::MsMs 350263 Specdb::MsMs 350264 Specdb::MsMs 350265 Specdb::MsMs 2335945 Specdb::MsMs 2335946 Specdb::MsMs 2335947 Specdb::MsMs 2629373 Specdb::MsMs 2629374 Specdb::MsMs 2629375 HMDB02195 #<Reference:0x00007f093c13bc70> #<Reference:0x00007f093c13bab8> #<Reference:0x00007f093c13b900> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823