1.0 2011-09-21 00:22:26 UTC 2015-07-21 06:57:26 UTC FDB022962 Imidazolelactic acid Imidazolelactic acid is the component of normal human urine. (PMID: 5856262) histidine loading causes an increase in the excretion of imidazolelactic acid. (PMID: 6021220) During pregnancy the values for imidazolelactic acid in urine is increased 3-fold. An interaction of allergic reactions and anomalies in the metabolism of the sex hormones are considered to form the basis of the pregnancy-specific illnesses that were studied. (PMID: 5789877) Urinary excretion of imidazolelactic acid is also an indication for folic acid and vitamin B12 deficiency. (PMID: 4645251) [HMDB] 1-Imidazolelactate 1-Imidazolelactic acid 2-Hydroxy-3-(1H-imidazol-1-yl)propanoate 2-Hydroxy-3-(1H-imidazol-1-yl)propanoic acid 2-Hydroxy-3-[4-imidazolyl]-propanoate 2-Hydroxy-3-[4-imidazolyl]-propanoic acid C6H8N2O3 156.1393 156.053492132 2-hydroxy-3-(1H-imidazol-1-yl)propanoic acid 2-hydroxy-3-(imidazol-1-yl)propanoic acid 876-19-7 OC(CN1C=CN=C1)C(O)=O InChI=1S/C6H8N2O3/c9-5(6(10)11)3-8-2-1-7-4-8/h1-2,4-5,9H,3H2,(H,10,11) JTYMXXCJQKGGFG-UHFFFAOYSA-N belongs to the class of organic compounds known as imidazolyl carboxylic acids and derivatives. These are organic compounds containing a carboxylic acid chain (of at least 2 carbon atoms) linked to an imidazole ring. Imidazolyl carboxylic acids and derivatives Organic compounds Organoheterocyclic compounds Azoles Imidazoles Aromatic heteromonocyclic compounds Alpha hydroxy acids and derivatives Azacyclic compounds Carbonyl compounds Carboxylic acids Heteroaromatic compounds Hydrocarbon derivatives Monocarboxylic acids and derivatives N-substituted imidazoles Organic oxides Organonitrogen compounds Organopnictogen compounds Secondary alcohols Alcohol Alpha-hydroxy acid Aromatic heteromonocyclic compound Azacycle Carbonyl group Carboxylic acid Carboxylic acid derivative Heteroaromatic compound Hydrocarbon derivative Hydroxy acid Imidazolyl carboxylic acid derivative Monocarboxylic acid or derivatives N-substituted imidazole Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Secondary alcohol 2-hydroxy monocarboxylic acid imidazolyl carboxylic acid Solid logp -1.18 ALOGPS logs -1.15 ALOGPS solubility 1.10e+01 g/l ALOGPS logp -1.7 ChemAxon pka_strongest_acidic 3.39 ChemAxon pka_strongest_basic 6.77 ChemAxon iupac 2-hydroxy-3-(1H-imidazol-1-yl)propanoic acid ChemAxon average_mass 156.1393 ChemAxon mono_mass 156.053492132 ChemAxon smiles OC(CN1C=CN=C1)C(O)=O ChemAxon formula C6H8N2O3 ChemAxon inchi InChI=1S/C6H8N2O3/c9-5(6(10)11)3-8-2-1-7-4-8/h1-2,4-5,9H,3H2,(H,10,11) ChemAxon inchikey JTYMXXCJQKGGFG-UHFFFAOYSA-N ChemAxon polar_surface_area 75.35 ChemAxon refractivity 36.03 ChemAxon polarizability 14.1 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 4 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsIr 1733 Specdb::MsIr 1734 Specdb::MsIr 1735 Specdb::CMs 9309 Specdb::CMs 38364 Specdb::CMs 149283 Specdb::MsMs 27854 Specdb::MsMs 27855 Specdb::MsMs 27856 Specdb::MsMs 34412 Specdb::MsMs 34413 Specdb::MsMs 34414 Specdb::MsMs 2319230 Specdb::MsMs 2319231 Specdb::MsMs 2319232 Specdb::MsMs 2619380 Specdb::MsMs 2619381 Specdb::MsMs 2619382 Specdb::NmrOneD 116198 Specdb::NmrOneD 116199 Specdb::NmrOneD 116200 Specdb::NmrOneD 116201 Specdb::NmrOneD 116202 Specdb::NmrOneD 116203 Specdb::NmrOneD 116204 Specdb::NmrOneD 116205 Specdb::NmrOneD 116206 Specdb::NmrOneD 116207 Specdb::NmrOneD 116208 Specdb::NmrOneD 116209 Specdb::NmrOneD 116210 Specdb::NmrOneD 116211 Specdb::NmrOneD 116212 Specdb::NmrOneD 116213 Specdb::NmrOneD 116214 Specdb::NmrOneD 116215 Specdb::NmrOneD 116216 Specdb::NmrOneD 116217 HMDB02320 27487 #<Reference:0x000055ce32342578> #<Reference:0x000055ce323423c0> #<Reference:0x000055ce32342208> #<Reference:0x000055ce32342050> #<Reference:0x000055ce32341e98> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823