1.0 2011-09-21 00:22:49 UTC 2015-07-21 06:57:27 UTC FDB022983 N-Phenylacetylphenylalanine N-Phenylacetylphenylalanine (PAP) is a peptide analogue used as a potential antisickling agent. This biaromatic agent has properties that make it a suitable candidate for the development of a useful therapeutic agent for the treatment of sickle cell disease. (PMID: 3663644, 6587344) [HMDB] 3-phenyl-N-(phenylacetyl)-Alanine L-3-phenyl-N-(phenylacetyl)-Alanine N-(phenylacetyl)-L-Phenylalanine N-Phenylacetyl-L-phenylalanine N-phenylacetylphenylalanine C17H17NO3 283.3218 283.120843415 (2S)-3-phenyl-2-(2-phenylacetamido)propanoic acid N-phenylacetyl-L-phenylalanine 738-75-0 OC(=O)[C@H](CC1=CC=CC=C1)NC(=O)CC1=CC=CC=C1 InChI=1S/C17H17NO3/c19-16(12-14-9-5-2-6-10-14)18-15(17(20)21)11-13-7-3-1-4-8-13/h1-10,15H,11-12H2,(H,18,19)(H,20,21)/t15-/m0/s1 LIIPHJDKZNTNII-HNNXBMFYSA-N belongs to the class of organic compounds known as phenylalanine and derivatives. Phenylalanine and derivatives are compounds containing phenylalanine or a derivative thereof resulting from reaction of phenylalanine at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. Phenylalanine and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aromatic homomonocyclic compounds Amphetamines and derivatives Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives N-acyl-L-alpha-amino acids Organic oxides Organonitrogen compounds Organopnictogen compounds Phenylacetamides Phenylpropanoic acids Secondary carboxylic acid amides 3-phenylpropanoic-acid Amphetamine or derivatives Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxamide group Carboxylic acid Hydrocarbon derivative Monocarboxylic acid or derivatives Monocyclic benzene moiety N-acyl-alpha amino acid or derivatives N-acyl-alpha-amino acid N-acyl-l-alpha-amino acid Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Phenylacetamide Phenylalanine or derivatives Secondary carboxylic acid amide Solid logp 2.39 ALOGPS logs -4.02 ALOGPS solubility 2.68e-02 g/l ALOGPS logp 2.73 ChemAxon pka_strongest_acidic 4.08 ChemAxon pka_strongest_basic -2.6 ChemAxon iupac (2S)-3-phenyl-2-(2-phenylacetamido)propanoic acid ChemAxon average_mass 283.3218 ChemAxon mono_mass 283.120843415 ChemAxon smiles OC(=O)[C@H](CC1=CC=CC=C1)NC(=O)CC1=CC=CC=C1 ChemAxon formula C17H17NO3 ChemAxon inchi InChI=1S/C17H17NO3/c19-16(12-14-9-5-2-6-10-14)18-15(17(20)21)11-13-7-3-1-4-8-13/h1-10,15H,11-12H2,(H,18,19)(H,20,21)/t15-/m0/s1 ChemAxon inchikey LIIPHJDKZNTNII-HNNXBMFYSA-N ChemAxon polar_surface_area 66.4 ChemAxon refractivity 79.28 ChemAxon polarizability 29.97 ChemAxon rotatable_bond_count 6 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 16902 Specdb::CMs 38396 Specdb::CMs 147936 Specdb::MsMs 75357 Specdb::MsMs 75358 Specdb::MsMs 75359 Specdb::MsMs 134985 Specdb::MsMs 134986 Specdb::MsMs 134987 Specdb::MsMs 2330964 Specdb::MsMs 2330965 Specdb::MsMs 2330966 Specdb::MsMs 2631185 Specdb::MsMs 2631186 Specdb::MsMs 2631187 HMDB02372 #<Reference:0x000055ce326f8fc8> #<Reference:0x000055ce326f8d20> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823