1.0 2011-09-21 00:23:12 UTC 2015-07-21 06:57:28 UTC FDB023008 Pyruvatoxime Synthetic dimer was found to react rapidly with pyruvate to form the expected oxime. 1H NMR spectrum of the purified oxime is superimposable with that arising when the dimer and pyruvate are mixed and the spectrum taken immediately thereafter. Then the mass spectrum of the reaction product of cycloserine dimer and methylpyruvate is totally consistent with the formation of a stable oxime derivative. Furthermore, when cycloserine is incubated with pyruvate the oxime derived from the dimer is found.(PMID: 2495795) [HMDB] 2-(hydroxyimino)propanoate 2-(hydroxyimino)propanoic acid 2-Oximinopropanoate 2-Oximinopropanoic acid Pyruvate oxime Pyruvic oxime C3H5NO3 103.0767 103.026943031 (2E)-2-(hydroxyimino)propanoic acid pyruvic oxime 2211-14-5 C\C(=N/O)C(O)=O InChI=1S/C3H5NO3/c1-2(4-7)3(5)6/h7H,1H3,(H,5,6)/b4-2+ MVGBKLTYYAYYGY-DUXPYHPUSA-N belongs to the class of organic compounds known as ketoximes. These are organic compounds with the general formula RC(R')=NOH (R,R' = organyl). Ketoximes Organic compounds Organic nitrogen compounds Organonitrogen compounds Oximes Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Aliphatic acyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Ketoxime Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Organopnictogen compound Solid logp -0.45 ALOGPS logs -0.80 ALOGPS solubility 1.64e+01 g/l ALOGPS logp 0.075 ChemAxon pka_strongest_acidic 3.42 ChemAxon pka_strongest_basic -2.6 ChemAxon iupac (2E)-2-(hydroxyimino)propanoic acid ChemAxon average_mass 103.0767 ChemAxon mono_mass 103.026943031 ChemAxon smiles C\C(=N/O)C(O)=O ChemAxon formula C3H5NO3 ChemAxon inchi InChI=1S/C3H5NO3/c1-2(4-7)3(5)6/h7H,1H3,(H,5,6)/b4-2+ ChemAxon inchikey MVGBKLTYYAYYGY-DUXPYHPUSA-N ChemAxon polar_surface_area 69.89 ChemAxon refractivity 21.81 ChemAxon polarizability 8.71 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 4 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::NmrTwoD 1828 Specdb::CMs 24892 Specdb::CMs 38424 Specdb::CMs 168614 Specdb::MsIr 1783 Specdb::MsIr 1784 Specdb::MsIr 1785 Specdb::MsMs 321172 Specdb::MsMs 321173 Specdb::MsMs 321174 Specdb::MsMs 368713 Specdb::MsMs 368714 Specdb::MsMs 368715 Specdb::MsMs 2779840 Specdb::MsMs 2779841 Specdb::MsMs 2779842 Specdb::MsMs 2925145 Specdb::MsMs 2925146 Specdb::MsMs 2925147 Specdb::NmrOneD 1892 Specdb::NmrOneD 122498 Specdb::NmrOneD 122499 Specdb::NmrOneD 122500 Specdb::NmrOneD 122501 Specdb::NmrOneD 122502 Specdb::NmrOneD 122503 Specdb::NmrOneD 122504 Specdb::NmrOneD 122505 Specdb::NmrOneD 122506 Specdb::NmrOneD 122507 Specdb::NmrOneD 122508 Specdb::NmrOneD 122509 Specdb::NmrOneD 122510 Specdb::NmrOneD 122511 Specdb::NmrOneD 122512 Specdb::NmrOneD 122513 Specdb::NmrOneD 122514 Specdb::NmrOneD 122515 Specdb::NmrOneD 122516 Specdb::NmrOneD 122517 HMDB02455 #<Reference:0x000055ce319cadb0> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823