1.0 2011-09-21 00:23:13 UTC 2015-10-09 22:32:42 UTC FDB023009 alpha-Ketoglutaric acid oxime Alpha-Ketoglutaric acid oxime is an organic acid being described in human urine in some cases of maple syrup urine disease. (PMID: 7438430, 699273) [HMDB] 2-(hydroxyimino)- Pentanedioate 2-(hydroxyimino)- Pentanedioic acid 2-oxime-(8CI)-2-oxoglutarate 2-oxime-(8CI)-2-oxoglutaric acid a-Ketoglutaric acid oxime Alpha-Ketoglutaric acid oxime oxime-(6CI,7CI)-2-oxoglutarate oxime-(6CI,7CI)-2-oxoglutaric acid C5H7NO5 161.1128 161.032422339 2-(hydroxyimino)pentanedioic acid 2-(hydroxyimino)pentanedioic acid 2211-15-6 ON=C(CCC(O)=O)C(O)=O InChI=1S/C5H7NO5/c7-4(8)2-1-3(6-11)5(9)10/h11H,1-2H2,(H,7,8)(H,9,10) RSXBEVMDACDZRB-UHFFFAOYSA-N belongs to the class of organic compounds known as dicarboxylic acids and derivatives. These are organic compounds containing exactly two carboxylic acid groups. Dicarboxylic acids and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Dicarboxylic acids and derivatives Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Fatty acids and conjugates Hydrocarbon derivatives Ketoximes Organic oxides Organopnictogen compounds Aliphatic acyclic compound Carbonyl group Carboxylic acid Dicarboxylic acid or derivatives Fatty acid Hydrocarbon derivative Ketoxime Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Oxime Solid logp -0.66 ALOGPS logs -1.34 ALOGPS solubility 7.35e+00 g/l ALOGPS logp -0.1 ChemAxon pka_strongest_acidic 3.08 ChemAxon pka_strongest_basic -2.8 ChemAxon iupac 2-(hydroxyimino)pentanedioic acid ChemAxon average_mass 161.1128 ChemAxon mono_mass 161.032422339 ChemAxon smiles ON=C(CCC(O)=O)C(O)=O ChemAxon formula C5H7NO5 ChemAxon inchi InChI=1S/C5H7NO5/c7-4(8)2-1-3(6-11)5(9)10/h11H,1-2H2,(H,7,8)(H,9,10) ChemAxon inchikey RSXBEVMDACDZRB-UHFFFAOYSA-N ChemAxon polar_surface_area 107.19 ChemAxon refractivity 32.7 ChemAxon polarizability 13.62 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 6 ChemAxon donor_count 3 ChemAxon physiological_charge -2 ChemAxon formal_charge 0 ChemAxon HMDB02467 #<Reference:0x000055ce328a85a8> #<Reference:0x000055ce328a81c0>