1.0 2011-09-21 00:23:42 UTC 2025-11-19 02:43:05 UTC FDB023041 6-Hydroxynicotinic acid 6-hydroxynicotinic acid (6-OHNA) is exploited in the use of NMR spectroscopy or gas chromatography--mass spectrometry for the diagnosis of Pseudomonas aeruginosa in urinary tract infection. Among the common bacteria causing urinary infection, only P. aeruginosa produces 6-hydroxynicotinic acid from nicotinic acid. Pseudomonas aeruginosa infection has been reported to be the third leading cause of urinary infection, accounting for 11% of such infections, the first and second being Escherichia coli and Klebsiella pneumonia, respectively. Analyses of the NMR spectra of the bacterial media with variable cell count of P. aeruginosa, shows that the intensity of the signals of the 6-hydroxynicotinic acid increases with increasing number of bacterial cells. (PMID: 3926801, 15759292) [HMDB] 1,6-Dihydro-6-oxo-3-pyridinecarboxylic acid 1,6-dihydro-6-oxo-Nicotinic acid 2-Hydroxy-5-carboxypyridine 2-Hydroxypyridine-5-carboxylic acid 2-Pyridone-5-carboxylic acid 5-Carboxy-2-pyridone 6-hydroxy-Nicotinic acid 6-Hydroxyniacin 6-Hydroxynicotinate 6-Hydroxynicotinic acid 6-Hydroxypyridine-3-carboxylic acid C6H5NO3 139.1088 139.026943031 6-hydroxypyridine-3-carboxylic acid 6-hydroxynicotinic acid 5006-66-6 OC(=O)C1=CN=C(O)C=C1 InChI=1S/C6H5NO3/c8-5-2-1-4(3-7-5)6(9)10/h1-3H,(H,7,8)(H,9,10) BLHCMGRVFXRYRN-UHFFFAOYSA-N belongs to the class of organic compounds known as pyridinecarboxylic acids. Pyridinecarboxylic acids are compounds containing a pyridine ring bearing a carboxylic acid group. Pyridinecarboxylic acids Organic compounds Organoheterocyclic compounds Pyridines and derivatives Pyridinecarboxylic acids and derivatives Aromatic heteromonocyclic compounds Azacyclic compounds Carboxylic acids Heteroaromatic compounds Hydrocarbon derivatives Hydroxypyridines Monocarboxylic acids and derivatives Organic oxides Organonitrogen compounds Organooxygen compounds Organopnictogen compounds Aromatic heteromonocyclic compound Azacycle Carboxylic acid Carboxylic acid derivative Heteroaromatic compound Hydrocarbon derivative Hydroxypyridine Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Pyridine carboxylic acid Pyridine alkaloids monohydroxypyridine Solid logp 0.71 ALOGPS logs -1.01 ALOGPS solubility 1.37e+01 g/l ALOGPS logp 0.7 ChemAxon pka_strongest_acidic 3.77 ChemAxon pka_strongest_basic 0.51 ChemAxon iupac 6-hydroxypyridine-3-carboxylic acid ChemAxon average_mass 139.1088 ChemAxon mono_mass 139.026943031 ChemAxon smiles OC(=O)C1=CN=C(O)C=C1 ChemAxon formula C6H5NO3 ChemAxon inchi InChI=1S/C6H5NO3/c8-5-2-1-4(3-7-5)6(9)10/h1-3H,(H,7,8)(H,9,10) ChemAxon inchikey BLHCMGRVFXRYRN-UHFFFAOYSA-N ChemAxon polar_surface_area 70.42 ChemAxon refractivity 33.45 ChemAxon polarizability 12.31 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 4 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::NmrTwoD 1834 Specdb::MsIr 1811 Specdb::MsIr 1812 Specdb::MsIr 1813 Specdb::MsMs 6347 Specdb::MsMs 6348 Specdb::MsMs 6349 Specdb::MsMs 6350 Specdb::MsMs 6351 Specdb::MsMs 6352 Specdb::MsMs 6353 Specdb::MsMs 6354 Specdb::MsMs 6355 Specdb::MsMs 6356 Specdb::MsMs 6358 Specdb::MsMs 6359 Specdb::MsMs 6360 Specdb::MsMs 299074 Specdb::MsMs 299075 Specdb::MsMs 299076 Specdb::MsMs 340993 Specdb::MsMs 340994 Specdb::MsMs 340995 Specdb::MsMs 437796 Specdb::MsMs 437797 Specdb::MsMs 437798 Specdb::MsMs 437799 Specdb::MsMs 437800 Specdb::MsMs 439174 Specdb::CMs 870 Specdb::CMs 1266 Specdb::CMs 14933 Specdb::CMs 30061 Specdb::CMs 30467 Specdb::CMs 31423 Specdb::CMs 32034 Specdb::CMs 38456 Specdb::CMs 166170 Specdb::NmrOneD 1898 Specdb::NmrOneD 122778 Specdb::NmrOneD 122779 Specdb::NmrOneD 122780 Specdb::NmrOneD 122781 Specdb::NmrOneD 122782 Specdb::NmrOneD 122783 Specdb::NmrOneD 122784 Specdb::NmrOneD 122785 Specdb::NmrOneD 122786 Specdb::NmrOneD 122787 Specdb::NmrOneD 122788 Specdb::NmrOneD 122789 Specdb::NmrOneD 122790 Specdb::NmrOneD 122791 Specdb::NmrOneD 122792 Specdb::NmrOneD 122793 Specdb::NmrOneD 122794 Specdb::NmrOneD 122795 Specdb::NmrOneD 122796 Specdb::NmrOneD 122797 HMDB02658 16168 #<Reference:0x000055ce3361bbb8> #<Reference:0x000055ce3361ba00> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823