1.0 2011-09-21 00:25:50 UTC 2015-07-21 06:57:34 UTC FDB023180 N-Formyl-L-glutamic acid N-Formyl-L-glutamate is an intermediate in the histidine metabolism, in a reaction mediated by the enzyme formiminotransferase cyclodeaminase [EC:2.1.2.5 4.3.1.4], a bifunctional enzyme that channels 1-carbon units from formiminoglutamate to the folate pool.(KEGG) [HMDB] (2S)-2-(formylamino)pentanedioate (2S)-2-(formylamino)pentanedioic acid (2S)-2-formamidopentanedioate (2S)-2-formamidopentanedioic acid N-Formyl-L-glutamate N-Formyl-L-glutamic acid C6H9NO5 175.1394 175.048072403 (2S)-2-formamidopentanedioic acid N-formyl-L-glutamic acid 1681-96-5 OC(=O)CC[C@H](NC=O)C(O)=O InChI=1S/C6H9NO5/c8-3-7-4(6(11)12)1-2-5(9)10/h3-4H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/t4-/m0/s1 ADZLWSMFHHHOBV-BYPYZUCNSA-N belongs to the class of organic compounds known as glutamic acid and derivatives. Glutamic acid and derivatives are compounds containing glutamic acid or a derivative thereof resulting from reaction of glutamic acid at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. Glutamic acid and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Dicarboxylic acids and derivatives Fatty acids and conjugates Hydrocarbon derivatives N-acyl-L-alpha-amino acids N-formyl-alpha amino acids Organic oxides Organonitrogen compounds Organopnictogen compounds Secondary carboxylic acid amides Aliphatic acyclic compound Carbonyl group Carboxamide group Carboxylic acid Dicarboxylic acid or derivatives Fatty acid Glutamic acid or derivatives Hydrocarbon derivative N-acyl-l-alpha-amino acid N-formyl-alpha amino acid or derivatives N-formyl-alpha-amino acid Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Secondary carboxylic acid amide N-acyl-L-glutamic acid N-formyl amino acid Solid logp -0.86 ALOGPS logs -0.85 ALOGPS solubility 2.45e+01 g/l ALOGPS logp -1.2 ChemAxon pka_strongest_acidic 3.3 ChemAxon pka_strongest_basic -0.91 ChemAxon iupac (2S)-2-formamidopentanedioic acid ChemAxon average_mass 175.1394 ChemAxon mono_mass 175.048072403 ChemAxon smiles OC(=O)CC[C@H](NC=O)C(O)=O ChemAxon formula C6H9NO5 ChemAxon inchi InChI=1S/C6H9NO5/c8-3-7-4(6(11)12)1-2-5(9)10/h3-4H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/t4-/m0/s1 ChemAxon inchikey ADZLWSMFHHHOBV-BYPYZUCNSA-N ChemAxon polar_surface_area 103.7 ChemAxon refractivity 36.24 ChemAxon polarizability 15.42 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 5 ChemAxon donor_count 3 ChemAxon physiological_charge -2 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 17027 Specdb::CMs 38611 Specdb::CMs 175304 Specdb::MsIr 1993 Specdb::MsIr 1994 Specdb::MsIr 1995 Specdb::NmrOneD 149560 Specdb::NmrOneD 149561 Specdb::NmrOneD 149562 Specdb::NmrOneD 149563 Specdb::NmrOneD 149564 Specdb::NmrOneD 149565 Specdb::NmrOneD 149566 Specdb::NmrOneD 149567 Specdb::NmrOneD 149568 Specdb::NmrOneD 149569 Specdb::NmrOneD 149570 Specdb::NmrOneD 149571 Specdb::NmrOneD 149572 Specdb::NmrOneD 149573 Specdb::NmrOneD 149574 Specdb::NmrOneD 149575 Specdb::NmrOneD 149576 Specdb::NmrOneD 149577 Specdb::NmrOneD 149578 Specdb::NmrOneD 149579 Specdb::MsMs 303691 Specdb::MsMs 303692 Specdb::MsMs 303693 Specdb::MsMs 346690 Specdb::MsMs 346691 Specdb::MsMs 346692 Specdb::MsMs 2797718 Specdb::MsMs 2797719 Specdb::MsMs 2797720 Specdb::MsMs 2880494 Specdb::MsMs 2880495 Specdb::MsMs 2880496 HMDB03470 21711 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Formimidoyltransferase-cyclodeaminase O95954 FTCD