1.0 2011-09-21 00:25:57 UTC 2025-11-19 02:43:27 UTC FDB023189 dIDP dIDP (deoxyinoside diphosphate) is a nucleoside. Deoxyinosine diphosphate appears in the urine of patients with purine metabolism abnormalities in purine nucleoside phosphorylase deficiency(OMIM 164050) [HMDB] 2'-Deoxyinosine 5'-diate 2'-Deoxyinosine 5'-diic acid 2'-Deoxyinosine 5'-diphosphate 2'-Deoxyinosine-5'-diate 2'-Deoxyinosine-5'-diic acid C10H14N4O10P2 412.1865 412.018515712 {[hydroxy({[(2R,3S,5R)-3-hydroxy-5-(6-oxo-6,9-dihydro-3H-purin-9-yl)oxolan-2-yl]methoxy})phosphoryl]oxy}phosphonic acid 2'-deoxyinosine 26575-15-5 O[C@H]1C[C@@H](O[C@@H]1CO[P@@](O)(=O)OP(O)(O)=O)N1C=NC2=C1NC=NC2=O InChI=1S/C10H14N4O10P2/c15-5-1-7(14-4-13-8-9(14)11-3-12-10(8)16)23-6(5)2-22-26(20,21)24-25(17,18)19/h3-7,15H,1-2H2,(H,20,21)(H,11,12,16)(H2,17,18,19)/t5-,6+,7+/m0/s1 BKUSIKGSPSFQAC-RRKCRQDMSA-N belongs to the class of organic compounds known as purine 2'-deoxyribonucleoside diphosphates. These are purine nucleotides with diphosphate group linked to the ribose moiety lacking a hydroxyl group at position 2. Purine 2'-deoxyribonucleoside diphosphates Organic compounds Nucleosides, nucleotides, and analogues Purine nucleotides Purine deoxyribonucleotides Aromatic heteropolycyclic compounds 6-oxopurines Azacyclic compounds Heteroaromatic compounds Hydrocarbon derivatives Hypoxanthines Monoalkyl phosphates N-substituted imidazoles Organic oxides Organic pyrophosphates Organonitrogen compounds Organopnictogen compounds Oxacyclic compounds Pyrimidones Secondary alcohols Tetrahydrofurans Vinylogous amides 6-oxopurine Alcohol Alkyl phosphate Aromatic heteropolycyclic compound Azacycle Azole Heteroaromatic compound Hydrocarbon derivative Hypoxanthine Imidazole Imidazopyrimidine Monoalkyl phosphate N-substituted imidazole Organic nitrogen compound Organic oxide Organic oxygen compound Organic phosphoric acid derivative Organic pyrophosphate Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Oxacycle Phosphoric acid ester Purine Purine 2'-deoxyribonucleoside diphosphate Pyrimidine Pyrimidone Secondary alcohol Tetrahydrofuran Vinylogous amide deoxyinosine phosphate purine 2'-deoxyribonucleoside 5'-diphosphate Liquid logp -1.00 ALOGPS logs -2.06 ALOGPS solubility 3.62e+00 g/l ALOGPS logp -2.7 ChemAxon pka_strongest_acidic 1.73 ChemAxon pka_strongest_basic 2.67 ChemAxon iupac {[hydroxy({[(2R,3S,5R)-3-hydroxy-5-(6-oxo-6,9-dihydro-3H-purin-9-yl)oxolan-2-yl]methoxy})phosphoryl]oxy}phosphonic acid ChemAxon average_mass 412.1865 ChemAxon mono_mass 412.018515712 ChemAxon smiles O[C@H]1C[C@@H](O[C@@H]1CO[P@@](O)(=O)OP(O)(O)=O)N1C=NC2=C1NC=NC2=O ChemAxon formula C10H14N4O10P2 ChemAxon inchi InChI=1S/C10H14N4O10P2/c15-5-1-7(14-4-13-8-9(14)11-3-12-10(8)16)23-6(5)2-22-26(20,21)24-25(17,18)19/h3-7,15H,1-2H2,(H,20,21)(H,11,12,16)(H2,17,18,19)/t5-,6+,7+/m0/s1 ChemAxon inchikey BKUSIKGSPSFQAC-RRKCRQDMSA-N ChemAxon polar_surface_area 202.03 ChemAxon refractivity 81.13 ChemAxon polarizability 33.01 ChemAxon rotatable_bond_count 6 ChemAxon acceptor_count 11 ChemAxon donor_count 5 ChemAxon physiological_charge -3 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 23723 Specdb::MsMs 23724 Specdb::MsMs 23725 Specdb::MsMs 30521 Specdb::MsMs 30522 Specdb::MsMs 30523 Specdb::MsMs 2809049 Specdb::MsMs 2809050 Specdb::MsMs 2809051 Specdb::MsMs 2900586 Specdb::MsMs 2900587 Specdb::MsMs 2900588 Specdb::NmrOneD 28142 Specdb::NmrOneD 28143 Specdb::NmrOneD 28144 Specdb::NmrOneD 28145 Specdb::NmrOneD 28146 Specdb::NmrOneD 28147 Specdb::NmrOneD 28148 Specdb::NmrOneD 28149 Specdb::NmrOneD 28150 Specdb::NmrOneD 28151 Specdb::NmrOneD 28152 Specdb::NmrOneD 28153 Specdb::NmrOneD 28154 Specdb::NmrOneD 28155 Specdb::NmrOneD 28156 Specdb::NmrOneD 28157 Specdb::NmrOneD 28158 Specdb::NmrOneD 28159 Specdb::NmrOneD 28160 Specdb::NmrOneD 28161 Specdb::CMs 17278 Specdb::CMs 38621 Specdb::CMs 132116 Specdb::CMs 139850 Specdb::CMs 153494 Specdb::CMs 153496 Specdb::CMs 153498 Specdb::CMs 153500 Specdb::CMs 153502 Specdb::CMs 279926 HMDB03536 #<Reference:0x000055ce317f6340> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823