1.0 2011-09-21 00:26:39 UTC 2025-11-19 02:43:32 UTC FDB023231 D-Pantethine Pantethine (Bis-pantethine) or "Co-enzyme pantethine" is a dimeric form of vitamin B5, composed of two molecules of pantothenic acid linked by cysteamine bridging groups. The monomer of this compound is known as pantetheine and is an intermediate in the production of Coenzyme A by the body. Pantethine is considered the more biologically active form of vitamin B5, but is less stable than pantothenic acid and tends to decompose over time if it is not kept refrigerated, so most vitamin B5 supplements are in the form of calcium pantothenate. [HMDB] (R-(R*,r*))-N,n'-(dithiobis(ethyleneimino(3-oxopropane-3,1-diyl)))bis(2,4-dihydroxy-3,3-dimethylbutyramide) Bis(pantothenamidoethyl) disulfide Bis(pantothenamidoethyl) disulphide D-Bis(N-pantothenyl-b-aminoethyl) disulfide D-Bis(N-pantothenyl-b-aminoethyl) disulphide D-Bis(N-pantothenyl-beta-aminoethyl) disulfide D-Bis(N-pantothenyl-beta-aminoethyl) disulphide D-Bis(N-pantothenyl-β-aminoethyl) disulfide D-Bis(N-pantothenyl-β-aminoethyl) disulphide N-[2-[2-[2-[3-[(2,4-Dihydroxy-3,3-dimethyl-butanoyl)amino]propanoylamino]ethyldisulfanyl]ethylcarbamoyl]ethyl]-2,4-dihydroxy-3,3-dimethyl-butanamide N-[2-[2-[2-[3-[(2,4-Dihydroxy-3,3-dimethyl-butanoyl)amino]propanoylamino]ethyldisulphanyl]ethylcarbamoyl]ethyl]-2,4-dihydroxy-3,3-dimethyl-butanamide Pantethine Pantethine (JP15) Pantetina Pantomin Pantosin Pantosin (TN) C22H42N4O8S2 554.721 554.24440572 (2R)-N-[2-({2-[(2-{3-[(2R)-2,4-dihydroxy-3,3-dimethylbutanamido]propanamido}ethyl)disulfanyl]ethyl}carbamoyl)ethyl]-2,4-dihydroxy-3,3-dimethylbutanamide pantethine 16816-67-4 CC(C)(CO)[C@@H](O)C(=O)NCCC(=O)NCCSSCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)CO InChI=1S/C22H42N4O8S2/c1-21(2,13-27)17(31)19(33)25-7-5-15(29)23-9-11-35-36-12-10-24-16(30)6-8-26-20(34)18(32)22(3,4)14-28/h17-18,27-28,31-32H,5-14H2,1-4H3,(H,23,29)(H,24,30)(H,25,33)(H,26,34)/t17-,18-/m0/s1 DJWYOLJPSHDSAL-ROUUACIJSA-N belongs to the class of organic compounds known as beta amino acids and derivatives. These are amino acids having a (-NH2) group attached to the beta carbon atom. Beta amino acids and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Carbonyl compounds Dialkyldisulfides Hydrocarbon derivatives Monosaccharides N-acyl amines Organic oxides Organonitrogen compounds Organopnictogen compounds Primary alcohols Secondary alcohols Secondary carboxylic acid amides Sulfenyl compounds Alcohol Aliphatic acyclic compound Beta amino acid or derivatives Carbonyl group Carboxamide group Dialkyldisulfide Fatty acyl Fatty amide Hydrocarbon derivative Monosaccharide N-acyl-amine Organic disulfide Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Organosulfur compound Primary alcohol Secondary alcohol Secondary carboxylic acid amide Sulfenyl compound organic disulfide Solid logp -0.25 ALOGPS logs -3.67 ALOGPS solubility 1.17e-01 g/l ALOGPS logp -3.4 ChemAxon pka_strongest_acidic 12.38 ChemAxon pka_strongest_basic -2.8 ChemAxon iupac (2R)-N-[2-({2-[(2-{3-[(2R)-2,4-dihydroxy-3,3-dimethylbutanamido]propanamido}ethyl)disulfanyl]ethyl}carbamoyl)ethyl]-2,4-dihydroxy-3,3-dimethylbutanamide ChemAxon average_mass 554.721 ChemAxon mono_mass 554.24440572 ChemAxon smiles CC(C)(CO)[C@@H](O)C(=O)NCCC(=O)NCCSSCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)CO ChemAxon formula C22H42N4O8S2 ChemAxon inchi InChI=1S/C22H42N4O8S2/c1-21(2,13-27)17(31)19(33)25-7-5-15(29)23-9-11-35-36-12-10-24-16(30)6-8-26-20(34)18(32)22(3,4)14-28/h17-18,27-28,31-32H,5-14H2,1-4H3,(H,23,29)(H,24,30)(H,25,33)(H,26,34)/t17-,18-/m0/s1 ChemAxon inchikey DJWYOLJPSHDSAL-ROUUACIJSA-N ChemAxon polar_surface_area 197.32 ChemAxon refractivity 139.83 ChemAxon polarizability 59.42 ChemAxon rotatable_bond_count 19 ChemAxon acceptor_count 8 ChemAxon donor_count 8 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::NmrTwoD 1918 Specdb::NmrOneD 1983 Specdb::NmrOneD 34782 Specdb::NmrOneD 34783 Specdb::NmrOneD 34784 Specdb::NmrOneD 34785 Specdb::NmrOneD 34786 Specdb::NmrOneD 34787 Specdb::NmrOneD 34788 Specdb::NmrOneD 34789 Specdb::NmrOneD 34790 Specdb::NmrOneD 34791 Specdb::NmrOneD 34792 Specdb::NmrOneD 34793 Specdb::NmrOneD 34794 Specdb::NmrOneD 34795 Specdb::NmrOneD 34796 Specdb::NmrOneD 34797 Specdb::NmrOneD 34798 Specdb::NmrOneD 34799 Specdb::NmrOneD 34800 Specdb::NmrOneD 34801 Specdb::CMs 21070 Specdb::CMs 38658 Specdb::CMs 281824 Specdb::CMs 339604 Specdb::CMs 339605 Specdb::CMs 339606 Specdb::CMs 339607 Specdb::CMs 339608 Specdb::CMs 339609 Specdb::CMs 339610 Specdb::CMs 339611 Specdb::CMs 339612 Specdb::CMs 339613 Specdb::CMs 339614 Specdb::CMs 339615 Specdb::CMs 339616 Specdb::CMs 339617 Specdb::CMs 339618 Specdb::CMs 339619 Specdb::CMs 339620 Specdb::CMs 339621 Specdb::CMs 339622 Specdb::CMs 339623 Specdb::CMs 339624 Specdb::CMs 339625 Specdb::MsMs 2343 Specdb::MsMs 2344 Specdb::MsMs 2345 Specdb::MsMs 256170 Specdb::MsMs 256171 Specdb::MsMs 256172 Specdb::MsMs 276111 Specdb::MsMs 276112 Specdb::MsMs 276113 Specdb::MsMs 2673053 Specdb::MsMs 2673054 Specdb::MsMs 2673055 Specdb::MsMs 3033002 Specdb::MsMs 3033003 Specdb::MsMs 3033004 HMDB03828 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823