1.0 2011-09-21 00:26:40 UTC 2015-07-21 06:57:36 UTC FDB023232 beta-Tyrosine The use of tyrosine kinase receptor inhibitors is increasingly becoming a valuable therapeutic alternative in tumors carrying activated tyrosine kinase receptors. GMR beta tyrosine residues are not necessary for activation of the JAK/STAT pathway, or for proliferation, viability, or adhesion signaling in Ba/F3 cells, although tyrosine residues significantly affect the magnitude of the response. (PMID:10372132) [HMDB] 3-Amino-3-(4-hydroxyphenyl)propanoate 3-Amino-3-(4-hydroxyphenyl)propanoic acid 3-amino-3-(4-Hydroxyphenyl)propionate 3-amino-3-(4-Hydroxyphenyl)propionic acid b-Tyrosine beta-Tyrosine β-tyrosine C9H11NO3 181.1885 181.073893223 3-amino-3-(4-hydroxyphenyl)propanoic acid β-tyrosine NC(CC(O)=O)C1=CC=C(O)C=C1 InChI=1S/C9H11NO3/c10-8(5-9(12)13)6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13) JYPHNHPXFNEZBR-UHFFFAOYSA-N belongs to the class of organic compounds known as beta amino acids and derivatives. These are amino acids having a (-NH2) group attached to the beta carbon atom. Beta amino acids and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Amino acids Aralkylamines Benzene and substituted derivatives Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monoalkylamines Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Phenylpropanoic acids 1-hydroxy-2-unsubstituted benzenoid 3-phenylpropanoic-acid Amine Amino acid Aralkylamine Aromatic homomonocyclic compound Benzenoid Beta amino acid or derivatives Carbonyl group Carboxylic acid Hydrocarbon derivative Monocarboxylic acid or derivatives Monocyclic benzene moiety Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Phenol Primary aliphatic amine Primary amine beta-amino acid Solid logp -2.33 ALOGPS logs -1.76 ALOGPS solubility 3.18e+00 g/l ALOGPS logp -1.7 ChemAxon pka_strongest_acidic 3.57 ChemAxon pka_strongest_basic 10.14 ChemAxon iupac 3-amino-3-(4-hydroxyphenyl)propanoic acid ChemAxon average_mass 181.1885 ChemAxon mono_mass 181.073893223 ChemAxon smiles NC(CC(O)=O)C1=CC=C(O)C=C1 ChemAxon formula C9H11NO3 ChemAxon inchi InChI=1S/C9H11NO3/c10-8(5-9(12)13)6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13) ChemAxon inchikey JYPHNHPXFNEZBR-UHFFFAOYSA-N ChemAxon polar_surface_area 83.55 ChemAxon refractivity 46.97 ChemAxon polarizability 17.93 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 4 ChemAxon donor_count 3 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsIr 2067 Specdb::MsIr 2068 Specdb::MsIr 2069 Specdb::CMs 1558 Specdb::CMs 1615 Specdb::CMs 13531 Specdb::CMs 31485 Specdb::CMs 31486 Specdb::CMs 38659 Specdb::CMs 132248 Specdb::CMs 139982 Specdb::MsMs 295813 Specdb::MsMs 295814 Specdb::MsMs 295815 Specdb::MsMs 336943 Specdb::MsMs 336944 Specdb::MsMs 336945 Specdb::MsMs 437289 Specdb::MsMs 437290 Specdb::MsMs 437291 Specdb::MsMs 437292 Specdb::MsMs 437293 Specdb::MsMs 2238235 Specdb::MsMs 2239356 Specdb::MsMs 2794052 Specdb::MsMs 2794053 Specdb::MsMs 2794054 Specdb::MsMs 2885513 Specdb::MsMs 2885514 Specdb::MsMs 2885515 Specdb::NmrOneD 34802 Specdb::NmrOneD 34803 Specdb::NmrOneD 34804 Specdb::NmrOneD 34805 Specdb::NmrOneD 34806 Specdb::NmrOneD 34807 Specdb::NmrOneD 34808 Specdb::NmrOneD 34809 Specdb::NmrOneD 34810 Specdb::NmrOneD 34811 Specdb::NmrOneD 34812 Specdb::NmrOneD 34813 Specdb::NmrOneD 34814 Specdb::NmrOneD 34815 Specdb::NmrOneD 34816 Specdb::NmrOneD 34817 Specdb::NmrOneD 34818 Specdb::NmrOneD 34819 Specdb::NmrOneD 34820 Specdb::NmrOneD 34821 HMDB03831 16939 #<Reference:0x000055ce31dd2250> #<Reference:0x000055ce31dd2098> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823