1.0 2011-09-21 00:27:38 UTC 2015-07-21 06:57:38 UTC FDB023293 5,6-Dihydroxyindole 5,6-Dihydroxyindole is a substrate for Tyrosinase. [HMDB] aminochrome DHI Dopamine lutine dopaminochrome C8H7NO2 149.1467 149.047678473 1H-indole-5,6-diol 5,6-dihydroxyindole 3131-52-0 OC1=C(O)C=C2C=CNC2=C1 InChI=1S/C8H7NO2/c10-7-3-5-1-2-9-6(5)4-8(7)11/h1-4,9-11H SGNZYJXNUURYCH-UHFFFAOYSA-N belongs to the class of organic compounds known as hydroxyindoles. These are organic compounds containing an indole moiety that carries a hydroxyl group. Hydroxyindoles Organic compounds Organoheterocyclic compounds Indoles and derivatives Hydroxyindoles Aromatic heteropolycyclic compounds 1-hydroxy-2-unsubstituted benzenoids Azacyclic compounds Heteroaromatic compounds Hydrocarbon derivatives Indoles Organonitrogen compounds Organooxygen compounds Organopnictogen compounds Pyrroles 1-hydroxy-2-unsubstituted benzenoid Aromatic heteropolycyclic compound Azacycle Benzenoid Heteroaromatic compound Hydrocarbon derivative Hydroxyindole Indole Organic nitrogen compound Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Pyrrole a small molecule dihydroxyindole Solid logp 1.11 ALOGPS logs -1.41 ALOGPS solubility 5.78e+00 g/l ALOGPS logp 1.46 ChemAxon pka_strongest_acidic 8.72 ChemAxon pka_strongest_basic -6.3 ChemAxon iupac 1H-indole-5,6-diol ChemAxon average_mass 149.1467 ChemAxon mono_mass 149.047678473 ChemAxon smiles OC1=C(O)C=C2C=CNC2=C1 ChemAxon formula C8H7NO2 ChemAxon inchi InChI=1S/C8H7NO2/c10-7-3-5-1-2-9-6(5)4-8(7)11/h1-4,9-11H ChemAxon inchikey SGNZYJXNUURYCH-UHFFFAOYSA-N ChemAxon polar_surface_area 56.25 ChemAxon refractivity 41.11 ChemAxon polarizability 14.74 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 2 ChemAxon donor_count 3 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Tyrosine Metabolism SMP00006 map00350 Specdb::MsIr 2097 Specdb::MsIr 2098 Specdb::MsIr 2099 Specdb::NmrOneD 41402 Specdb::NmrOneD 41403 Specdb::NmrOneD 41404 Specdb::NmrOneD 41405 Specdb::NmrOneD 41406 Specdb::NmrOneD 41407 Specdb::NmrOneD 41408 Specdb::NmrOneD 41409 Specdb::NmrOneD 41410 Specdb::NmrOneD 41411 Specdb::NmrOneD 41412 Specdb::NmrOneD 41413 Specdb::NmrOneD 41414 Specdb::NmrOneD 41415 Specdb::NmrOneD 41416 Specdb::NmrOneD 41417 Specdb::NmrOneD 41418 Specdb::NmrOneD 41419 Specdb::NmrOneD 41420 Specdb::NmrOneD 41421 Specdb::CMs 6567 Specdb::CMs 38697 Specdb::CMs 170110 Specdb::MsMs 248349 Specdb::MsMs 248350 Specdb::MsMs 248351 Specdb::MsMs 268290 Specdb::MsMs 268291 Specdb::MsMs 268292 Specdb::MsMs 2748973 Specdb::MsMs 2748974 Specdb::MsMs 2748975 Specdb::MsMs 2932929 Specdb::MsMs 2932930 Specdb::MsMs 2932931 HMDB04058 27404 3ID #<Reference:0x000055ce3280e0e8> #<Reference:0x000055ce3280dda0> #<Reference:0x000055ce3280db98> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 D-dopachrome decarboxylase P30046 DDT