1.0 2011-09-21 00:27:53 UTC 2019-11-26 03:21:08 UTC FDB023311 5-Methoxytryptamine Serotonin derivative proposed as potentiator for hypnotics and sedatives. [HMDB] 2-(5-Methoxy-1H-indol-3-yl)ethanamine 2-(5-Methoxyindol-3-yl)ethylamine 3-(2-Aminoethyl)-5-methoxyindole 5-MeOT 5-Methoxy-1H-indole-3-ethanamine 5-Mot 5-MT 5MOT Lopac-M-6628 Meksamin Methoxytryptamine Mexamine Mexamine base C11H14N2O 190.2417 190.11061308 2-(5-methoxy-1H-indol-3-yl)ethan-1-amine 5 methoxytryptamine 608-07-1 COC1=CC2=C(NC=C2CCN)C=C1 InChI=1S/C11H14N2O/c1-14-9-2-3-11-10(6-9)8(4-5-12)7-13-11/h2-3,6-7,13H,4-5,12H2,1H3 JTEJPPKMYBDEMY-UHFFFAOYSA-N belongs to the class of organic compounds known as tryptamines and derivatives. Tryptamines and derivatives are compounds containing the tryptamine backbone, which is structurally characterized by an indole ring substituted at the 3-position by an ethanamine. Tryptamines and derivatives Organic compounds Organoheterocyclic compounds Indoles and derivatives Tryptamines and derivatives Aromatic heteropolycyclic compounds 2-arylethylamines 3-alkylindoles Alkyl aryl ethers Anisoles Aralkylamines Azacyclic compounds Heteroaromatic compounds Hydrocarbon derivatives Monoalkylamines Organopnictogen compounds Substituted pyrroles 2-arylethylamine 3-alkylindole Alkyl aryl ether Amine Anisole Aralkylamine Aromatic heteropolycyclic compound Azacycle Benzenoid Ether Heteroaromatic compound Hydrocarbon derivative Indole Organic nitrogen compound Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine Pyrrole Substituted pyrrole Tryptamine a small molecule aromatic ether tryptamines Solid logp 1.41 ALOGPS logs -2.38 ALOGPS solubility 7.93e-01 g/l ALOGPS logp 1.33 ChemAxon pka_strongest_acidic 17.45 ChemAxon pka_strongest_basic 9.76 ChemAxon iupac 2-(5-methoxy-1H-indol-3-yl)ethan-1-amine ChemAxon average_mass 190.2417 ChemAxon mono_mass 190.11061308 ChemAxon smiles COC1=CC2=C(NC=C2CCN)C=C1 ChemAxon formula C11H14N2O ChemAxon inchi InChI=1S/C11H14N2O/c1-14-9-2-3-11-10(6-9)8(4-5-12)7-13-11/h2-3,6-7,13H,4-5,12H2,1H3 ChemAxon inchikey JTEJPPKMYBDEMY-UHFFFAOYSA-N ChemAxon polar_surface_area 51.04 ChemAxon refractivity 56.84 ChemAxon polarizability 21.32 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 2 ChemAxon donor_count 2 ChemAxon physiological_charge 1 ChemAxon formal_charge 0 ChemAxon Specdb::MsIr 2129 Specdb::MsIr 2130 Specdb::MsIr 2131 Specdb::NmrTwoD 1925 Specdb::CMs 1847 Specdb::CMs 1981 Specdb::CMs 20079 Specdb::CMs 31500 Specdb::CMs 31501 Specdb::CMs 32087 Specdb::CMs 32088 Specdb::CMs 172624 Specdb::NmrOneD 1990 Specdb::MsMs 2361 Specdb::MsMs 2362 Specdb::MsMs 2363 Specdb::MsMs 5998 Specdb::MsMs 5999 Specdb::MsMs 6000 Specdb::MsMs 6001 Specdb::MsMs 6002 Specdb::MsMs 6003 Specdb::MsMs 6004 Specdb::MsMs 6005 Specdb::MsMs 6006 Specdb::MsMs 6007 Specdb::MsMs 310729 Specdb::MsMs 310730 Specdb::MsMs 310731 Specdb::MsMs 355552 Specdb::MsMs 355553 Specdb::MsMs 355554 Specdb::MsMs 438104 Specdb::MsMs 438105 Specdb::MsMs 438106 Specdb::MsMs 438107 Specdb::MsMs 438108 Specdb::MsMs 439578 HMDB04095 #<Reference:0x000055ce323b8f48> #<Reference:0x000055ce323b8d90> #<Reference:0x000055ce323b8bd8> #<Reference:0x000055ce323b8a20> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Milk (Cow) Type 2 specific Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Serotonin N-acetyltransferase Q16613 AANAT