1.0 2011-09-21 00:28:15 UTC 2018-05-28 18:36:27 UTC FDB023333 Vitamin K1 epoxide-1,4-diol Vitamin K is a family of fat-soluble compounds with a common chemical structure, 2, methyl-1,4-napthoquinone. Phylloquinone is present in food of plant origin, such as green, leafy vegetables and certain plant oils, and is the predominant form in the diet. Bacterial and other forms of vitamin K, referred to as the menaquinones, differ in structure from phylloquinone in their 3-substituted lipophilic side chain. Menaquinone-4 (MK-4), which is alkylated from menadione, is present in animal feeds or is the product of tissue-specific conversion directly from dietary phylloquinone. Vitamin K is a cofactor specific to the formation of gamma-carboxyglutamyl (Gla) residues in certain proteins, including prothrombin necessary for normal hemostatic function. The naturally occurring forms of vitamin K are quinones (i.e. phylloquinone and menaquinones) so vitamin K is reduced to the vitamin K hydroquinone prior to catalyzing the gamma-carboxylation reaction. The active site for the carboxylation reaction is on the napthoquinone ring, which is identical for all forms of vitamin K, including phylloquinone and MK-4. (PMID 16857056) [HMDB] 2-Methyl-3-(3,7,11,15-tetramethyl-2-hexadecenyl)-1,4-naphthalenedione 2-Methyl-3-[(2e)-3,7,11,15-tetramethyl-2-hexadecenyl]naphthoquinone 2', 3'-trans-Vitamin k1 Phytomenadione Reduced vitamin K (phylloquinone) Vitamin K hydroquinone (phylloquinone) α-phylloquinone C31H50O3 470.7269 470.375995466 1a-methyl-7a-(3,7,11,15-tetramethylhexadec-2-en-1-yl)-1aH,2H,7H,7aH-naphtho[2,3-b]oxirene-2,7-diol 1a-methyl-7a-(3,7,11,15-tetramethylhexadec-2-en-1-yl)-2H,7H-naphtho[2,3-b]oxirene-2,7-diol 81382-12-9 CC(C)CCCC(C)CCCC(C)CCCC(C)=CCC12OC1(C)C(O)C1=CC=CC=C1C2O InChI=1S/C31H50O3/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-25(5)20-21-31-29(33)27-19-8-7-18-26(27)28(32)30(31,6)34-31/h7-8,18-20,22-24,28-29,32-33H,9-17,21H2,1-6H3 CBCKYHVYINCXKR-UHFFFAOYSA-N belongs to the class of organic compounds known as diterpenoids. These are terpene compounds formed by four isoprene units. Diterpenoids Organic compounds Lipids and lipid-like molecules Prenol lipids Diterpenoids Aromatic heteropolycyclic compounds Dialkyl ethers Epoxides Hydrocarbon derivatives Oxacyclic compounds Secondary alcohols Tetralins Alcohol Aromatic heteropolycyclic compound Benzenoid Dialkyl ether Diterpenoid Ether Hydrocarbon derivative Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Oxirane Secondary alcohol Tetralin Liquid logp 8.29 ALOGPS logs -6.57 ALOGPS solubility 1.26e-04 g/l ALOGPS logp 8.34 ChemAxon pka_strongest_acidic 12.84 ChemAxon pka_strongest_basic -3.6 ChemAxon iupac 1a-methyl-7a-(3,7,11,15-tetramethylhexadec-2-en-1-yl)-1aH,2H,7H,7aH-naphtho[2,3-b]oxirene-2,7-diol ChemAxon average_mass 470.7269 ChemAxon mono_mass 470.375995466 ChemAxon smiles CC(C)CCCC(C)CCCC(C)CCCC(C)=CCC12OC1(C)C(O)C1=CC=CC=C1C2O ChemAxon formula C31H50O3 ChemAxon inchi InChI=1S/C31H50O3/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-25(5)20-21-31-29(33)27-19-8-7-18-26(27)28(32)30(31,6)34-31/h7-8,18-20,22-24,28-29,32-33H,9-17,21H2,1-6H3 ChemAxon inchikey CBCKYHVYINCXKR-UHFFFAOYSA-N ChemAxon polar_surface_area 52.99 ChemAxon refractivity 142.73 ChemAxon polarizability 59 ChemAxon rotatable_bond_count 14 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon HMDB15157 PQN Agar Type 1 specific Eucheuma 31444 2.3 2.3 2.3 mg/100 g Agave Type 1 specific Agave 39509 5.3 5.3 5.3 mg/100 g Alfalfa Type 1 specific Medicago sativa 3879 30.5 30.5 30.5 mg/100 g Almond Type 1 specific Prunus dulcis 3755 0.0 0.0 0.0 mg/100 g Almond milk Type 1 0.0 0.0 0.0 mg/100 g Amaranth Type 1 specific Amaranthus 3564 0.0 0.0 0.0 mg/100 g American lobster Type 1 specific Homarus americanus 6706 0.0 0.0 0.0 mg/100 g American shad Type 1 specific Alosa sapidissima 34773 0.1 0.1 0.1 mg/100 g Anatidae Type 1 specific Anatidae 8830 5.5 5.5 5.5 mg/100 g Anchovy Type 1 specific Engraulidae 43062 0.1 0.1 0.1 mg/100 g Anguilliformes Type 1 specific Anguilliformes 7933 0.0 0.0 0.0 mg/100 g Apple Type 1 specific Malus pumila 283210 0.15 0.15 0.15 mg/100 g Apple cider Type 2 specific 0.0 0.0 0.0 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 3.3 3.3 3.3 mg/100 g Asian pear Type 1 specific Pyrus pyrifolia 3767 4.5 4.5 4.5 mg/100 g Asparagus Type 1 specific Asparagus officinalis 4686 6.35 6.35 6.35 mg/100 g Atlantic cod Type 1 specific Gadus morhua 8049 0.1 0.1 0.1 mg/100 g Atlantic croaker Type 1 specific Micropogonias undulatus 29154 0.1 0.1 0.1 mg/100 g Atlantic halibut Type 1 specific Hippoglossus hippoglossus 8267 0.0 0.0 0.0 mg/100 g Atlantic herring Type 1 specific Clupea harengus harengus 7950 0.1 0.1 0.1 mg/100 g Atlantic pollock Type 1 specific Pollachius pollachius 185739 5.0 5.0 5.0 mg/100 g Avocado Type 1 specific Persea americana 3435 5.65 5.65 5.65 mg/100 g Bamboo shoots Type 1 specific Phyllostachys edulis 38705 0.0 0.0 0.0 mg/100 g Banana Type 1 specific Musa acuminata 4641 0.35 0.35 0.35 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 2.2 2.2 2.2 mg/100 g Beer Type 2 specific 0.0 0.0 0.0 mg/100 g Black raisin Type 1 2.8 2.8 2.8 mg/100 g Black tea Type 1 0.0 0.0 0.0 mg/100 g Black walnut Type 1 specific Juglans nigra 16719 2.7 2.7 2.7 mg/100 g Black-eyed pea Type 1 specific Vigna unguiculata ssp. unguiculata 3920 5.0 5.0 5.0 mg/100 g Blue cheese Type 2 2.4 2.4 2.4 mg/100 g Blue mussel Type 1 specific Mytilus edulis 6550 0.1 0.1 0.1 mg/100 g Brazil nut Type 1 specific Bertholletia excelsa 3645 0.0 0.0 0.0 mg/100 g Breadfruit Type 1 specific Artocarpus altilis 194251 0.5 0.5 0.5 mg/100 g Broccoli Type 1 specific Brassica oleracea var. italica 36774 29.7 29.7 29.7 mg/100 g Brussel sprouts Type 1 specific Brassica oleracea var. gemmifera 178616 177.0 177.0 177.0 mg/100 g Bulgur Type 2 specific 1.9 1.9 1.9 mg/100 g Burdock Type 1 specific Arctium lappa 4217 1.6 1.6 1.6 mg/100 g Butter Type 2 specific 7.0 7.0 7.0 mg/100 g Buttermilk Type 2 specific 0.3 0.3 0.3 mg/100 g Butternut squash Type 1 specific Cucurbita moschata 3662 1.1 1.1 1.1 mg/100 g Cabbage Type 1 specific Brassica oleracea var. capitata 3716 37.4 37.4 37.4 mg/100 g Cantaloupe melon Type 1 Cucumis melo var. cantalupensis 1.2 1.2 1.2 mg/100 g Capers Type 1 specific Capparis spinosa 65558 24.6 24.6 24.6 mg/100 g Caraway Type 1 specific Carum carvi 48032 5.4 5.4 5.4 mg/100 g Carp bream Type 1 specific Abramis brama 38527 0.1 0.1 0.1 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 4.3 4.3 4.3 mg/100 g Cashew nut Type 1 specific Anacardium occidentale 171929 34.7 34.7 34.7 mg/100 g Cassava Type 1 specific Manihot esculenta 3983 1.9 1.9 1.9 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 5.5 5.5 5.5 mg/100 g Celeriac Type 1 specific Apium graveolens var. rapaceum 278110 41.0 41.0 41.0 mg/100 g Celery stalks Type 1 specific Apium graveolens var. dulce 117781 13.1 13.1 13.1 mg/100 g Chayote Type 1 specific Sechium edule 184140 4.1 4.1 4.1 mg/100 g Cheddar Cheese Type 2 Cheddar Cheese 0.6 0.6 0.6 mg/100 g Cheese Type 2 specific 0.1 0.1 0.1 mg/100 g Chickpea Type 1 specific Cicer arietinum 3827 9.0 9.0 9.0 mg/100 g Chicory Type 1 specific Cichorium intybus 13427 297.6 297.6 297.6 mg/100 g Chinese broccoli Type 1 specific Brassica alboglabra 3714 89.1 89.1 89.1 mg/100 g Chinese cabbage Type 1 specific Brassica rapa 3711 45.5 45.5 45.5 mg/100 g Chinese chives Type 1 specific Allium tuberosum 4683 212.7 212.7 212.7 mg/100 g Chives Type 1 specific Allium schoenoprasum 74900 212.7 212.7 212.7 mg/100 g Cichlidae (Tilapia) Type 1 specific Cichlidae 8113 1.4 1.4 1.4 mg/100 g Cinnamon Type 1 specific Cinnamomum 13428 31.2 31.2 31.2 mg/100 g Clam Type 1 0.35 0.35 0.35 mg/100 g Clawed lobster Type 1 specific Nephropidae 6704 0.0 0.0 0.0 mg/100 g Clementine Type 1 Citrus × clementina 0.0 0.0 0.0 mg/100 g Cloves Type 1 specific Syzygium aromaticum 219868 141.8 141.8 141.8 mg/100 g Cocoa butter Type 2 specific 82.35 82.35 82.35 mg/100 g Cocoa powder Type 2 specific 2.5 2.5 2.5 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 0.2 0.2 0.2 mg/100 g Coconut milk Type 1 0.0 0.0 0.0 mg/100 g Coconut oil Type 2 0.6 0.6 0.6 mg/100 g Coho salmon Type 1 specific Oncorhynchus kisutch 8019 0.1 0.1 0.1 mg/100 g Common beet Type 1 specific Beta vulgaris 161934 0.2 0.2 0.2 mg/100 g Common carp Type 1 specific Cyprinus carpio 7962 0.1 0.1 0.1 mg/100 g Common hazelnut Type 1 specific Corylus avellana 13451 6.0 6.0 6.0 mg/100 g Common octopus Type 1 specific Octopus vulgaris 6645 0.1 0.1 0.1 mg/100 g Common oregano Type 1 specific Origanum vulgare 39352 621.7 621.7 621.7 mg/100 g Common thyme Type 1 specific Thymus vulgaris 49992 1714.5 1714.5 1714.5 mg/100 g Common walnut Type 1 specific Juglans regia 51240 1.8 1.8 1.8 mg/100 g Coriander Type 1 specific Coriandrum sativum 4047 310.0 310.0 310.0 mg/100 g Corn Type 1 specific Zea mays 4577 0.3 0.3 0.3 mg/100 g Cottonseed oil Type 2 82.35 82.35 82.35 mg/100 g Crayfish Type 1 specific Astacidea 6712 0.1 0.1 0.1 mg/100 g Cream Type 2 specific 1.616667 3.2 0.2 mg/100 g Cucumber Type 1 specific Cucumis sativus 3659 0.0 0.0 0.0 mg/100 g Cumin Type 1 specific Cuminum cyminum 52462 5.4 5.4 5.4 mg/100 g Daikon radish Type 1 specific Raphanus sativus var. longipinnatus 41679 1.3 1.3 1.3 mg/100 g Dandelion Type 1 specific Taraxacum officinale 50225 778.4 778.4 778.4 mg/100 g Date Type 1 specific Phoenix dactylifera 42345 0.05 0.05 0.05 mg/100 g Deer Type 1 specific Cervidae 9850 1.1 1.1 1.1 mg/100 g Dessert wine Type 2 0.0 0.0 0.0 mg/100 g Eastern oyster Type 1 specific Crassostrea virginica 6565 1.0 1.0 1.0 mg/100 g Egg substitute Type 2 specific 0.3 0.4 0.2 mg/100 g Eggplant Type 1 specific Solanum melongena 4111 3.5 3.5 3.5 mg/100 g Endive Type 1 specific Cichorium endivia 114280 231.0 231.0 231.0 mg/100 g European anchovy Type 1 specific Engraulis encrasicolus 184585 0.1 0.1 0.1 mg/100 g Feijoa Type 1 specific Feijoa sellowiana 260130 3.5 3.5 3.5 mg/100 g Fennel Type 1 specific Foeniculum vulgare 48038 62.8 62.8 62.8 mg/100 g Fig Type 1 specific Ficus carica 3494 4.3 4.3 4.3 mg/100 g Flatfish Type 1 specific Pleuronectiformes 8252 0.1 0.1 0.1 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 0.55 0.55 0.55 mg/100 g Florida pompano Type 1 specific Trachinotus carolinus 173342 0.1 0.1 0.1 mg/100 g Freshwater eel Type 1 specific Anguilla 7935 0.0 0.0 0.0 mg/100 g Gadiformes Type 1 specific Gadiformes 8043 0.05 0.1 0.0 mg/100 g Gadus (Common cod) Type 1 specific Gadus 8048 0.1 0.1 0.1 mg/100 g Garden cress Type 1 specific Lepidium sativum 33125 541.9 541.9 541.9 mg/100 g Garden onion Type 1 specific Allium cepa 4679 0.25 0.25 0.25 mg/100 g Garden onion (var.) Type 1 specific Allium cepa var. cepa 4679 0.25 0.25 0.25 mg/100 g Garden rhubarb Type 1 specific Rheum rhabarbarum 3621 29.3 29.3 29.3 mg/100 g Garden tomato Type 1 specific Solanum lycopersicum 4081 0.95 0.95 0.95 mg/100 g Garden tomato (var.) Type 1 specific Solanum lycopersicum var. lycopersicum 397755 0.95 0.95 0.95 mg/100 g Garland chrysanthemum Type 1 specific Chrysanthemum coronarium 99038 350.0 350.0 350.0 mg/100 g Garlic Type 1 specific Allium sativum 4682 1.7 1.7 1.7 mg/100 g German camomile Type 1 specific Matricaria recutita 127986 0.0 0.0 0.0 mg/100 g Ginger Type 1 specific Zingiber officinale 94328 0.1 0.1 0.1 mg/100 g Globe artichoke Type 1 specific Cynara scolymus 59895 14.8 14.8 14.8 mg/100 g Grape Type 1 specific Vitis 3603 9.75 14.6 4.9 mg/100 g Grapefruit/Pummelo hybrid Type 1 specific Citrus paradisi X Citrus maxima 37656 0.0 0.0 0.0 mg/100 g Greater sturgeon Type 1 specific Acipenser 7901 0.1 0.1 0.1 mg/100 g Greek feta cheese Type 2 1.8 1.8 1.8 mg/100 g Green cabbage Type 1 Brassica oleracea var. sabauda L. 76.0 76.0 76.0 mg/100 g Green lentil Type 1 Lens culinaris 5.0 5.0 5.0 mg/100 g Green plum Type 1 1.9 1.9 1.9 mg/100 g Green tea Type 1 0.0 0.0 0.0 mg/100 g Greenland halibut/turbot Type 1 specific Reinhardtius hippoglossoides 111784 0.1 0.1 0.1 mg/100 g Guava Type 1 specific Psidium guajava 120290 2.6 2.6 2.6 mg/100 g Hard wheat Type 1 specific Triticum durum 4567 1.9 1.9 1.9 mg/100 g Hazelnut Type 1 specific Corylus 13450 6.0 6.0 6.0 mg/100 g Heart of palm Type 1 specific 0.0 0.0 0.0 mg/100 g Hibiscus tea Type 1 specific Hibiscus sabbariffa 183260 0.0 0.0 0.0 mg/100 g Hippoglossus (Common halibut) Type 1 specific Hippoglossus 8266 0.0 0.0 0.0 mg/100 g Honey Type 2 specific 0.0 0.0 0.0 mg/100 g Horseradish Type 1 specific Armoracia rusticana 3704 1.3 1.3 1.3 mg/100 g Iceberg lettuce Type 1 10.3 10.3 10.3 mg/100 g Irish moss Type 1 specific Chondrus crispus 2769 5.0 5.0 5.0 mg/100 g Italian oregano Type 1 specific Origanum X majoricum 1384207 621.7 621.7 621.7 mg/100 g Jalapeno pepper Type 1 Capsicum annuum 'Jalapeño' 1.25 1.25 1.25 mg/100 g Japanese persimmon Type 1 specific Diospyros kaki 35925 2.6 2.6 2.6 mg/100 g Japanese sea bass Type 1 Lateolabrax japonicus 0.1 0.1 0.1 mg/100 g Jerusalem artichoke Type 1 specific Helianthus tuberosus 4233 0.1 0.1 0.1 mg/100 g Jicama Type 1 specific Pachyrhizus erosus 109171 0.3 0.3 0.3 mg/100 g Kale Type 1 specific Brassica napus var. pabularia 26.5 26.5 26.5 mg/100 g Kefir Type 2 specific 0.1 0.1 0.1 mg/100 g Kelp Type 1 specific Laminaria 33637 66.0 66.0 66.0 mg/100 g Kiwi Type 1 specific Actinidia chinensis 3625 8.2 8.2 8.2 mg/100 g Kohlrabi Type 1 specific Brassica oleracea var. gongylodes 109379 0.1 0.1 0.1 mg/100 g Kumquat Type 1 specific Fortunella 2706 0.0 0.0 0.0 mg/100 g Lard Type 2 specific 0.0 0.0 0.0 mg/100 g Leek Type 1 specific Allium porrum 47.0 47.0 47.0 mg/100 g Lemon Type 1 specific Citrus limon 2708 0.0 0.0 0.0 mg/100 g Lemon sole Type 1 specific Microstomus kitt 106175 0.1 0.1 0.1 mg/100 g Lentils Type 1 generic Lens culinaris 3864 5.0 5.0 5.0 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 29.65 29.65 29.65 mg/100 g Lichee Type 1 specific Litchi chinensis 151069 0.4 0.4 0.4 mg/100 g Lima bean Type 1 specific Phaseolus lunatus 3884 5.6 5.6 5.6 mg/100 g Lime Type 1 specific Citrus aurantiifolia 159033 0.6 0.6 0.6 mg/100 g Loganberry Type 1 specific Rubus loganobaccus 7.8 7.8 7.8 mg/100 g Maitake Type 1 specific Grifola frondosa 5627 0.0 0.0 0.0 mg/100 g Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 0.0 0.0 0.0 mg/100 g Mango Type 1 specific Mangifera indica 29780 4.2 4.2 4.2 mg/100 g Marine mussel Type 1 specific Mytilidae 6547 0.1 0.1 0.1 mg/100 g Mexican oregano Type 1 specific Lippia graveolens 621.7 621.7 621.7 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 0.9 0.9 0.9 mg/100 g Molasses Type 2 specific 0.0 0.0 0.0 mg/100 g Mountain yam Type 1 specific Dioscorea pentaphylla 167592 1.4 1.4 1.4 mg/100 g Mozzarella cheese Type 2 0.45 0.45 0.45 mg/100 g Mung bean Type 1 specific Vigna radiata 157791 9.0 9.0 9.0 mg/100 g Muskmelon Type 1 specific Cucumis melo 3656 2.5 2.5 2.5 mg/100 g Nance Type 1 specific Byrsonima crassifolia 4270 1.9 1.9 1.9 mg/100 g Naranjilla Type 1 specific Solanum quitoense 227725 3.05 3.05 3.05 mg/100 g Narrowleaf cattail Type 1 specific Typha angustifolia 59011 1.2 1.2 1.2 mg/100 g Nectarine Type 1 specific Prunus persica var. nucipersica 323851 0.6 0.6 0.6 mg/100 g New Zealand spinach Type 1 specific Tetragonia tetragonioides 45318 337.0 337.0 337.0 mg/100 g Nopal Type 1 specific Opuntia cochenillifera 338184 5.3 5.3 5.3 mg/100 g Northern bluefin tuna Type 1 specific Thunnus thynnus 8237 0.0 0.0 0.0 mg/100 g Northern pike Type 1 specific Esox lucius 8010 0.1 0.1 0.1 mg/100 g Nutmeg Type 1 specific Myristica fragrans 51089 0.0 0.0 0.0 mg/100 g Oat Type 1 specific Avena sativa 4498 3.2 3.2 3.2 mg/100 g Oil palm Type 1 specific Elaeis 51952 8.0 8.0 8.0 mg/100 g Okra Type 1 specific Abelmoschus esculentus 455045 31.3 31.3 31.3 mg/100 g Olive Type 1 specific Olea europaea 4146 3.8 3.8 3.8 mg/100 g Orange roughy Type 1 specific Hoplostethus atlanticus 96778 0.7 0.7 0.7 mg/100 g Oriental wheat Type 1 specific Triticum turanicum 376534 1.8 1.8 1.8 mg/100 g Oyster mushroom Type 1 specific Pleurotus ostreatus 5322 0.0 0.0 0.0 mg/100 g Pacific cod Type 1 specific Gadus macrocephalus 80720 0.0 0.0 0.0 mg/100 g Pacific halibut Type 1 specific Hippoglossus stenolepis 195615 0.0 0.0 0.0 mg/100 g Pacific jack mackerel Type 1 specific Trachurus symmetricus 271940 0.1 0.1 0.1 mg/100 g Pacific ocean perch Type 1 specific Sebastes alutus 72055 0.1 0.1 0.1 mg/100 g Pacific rockfish Type 1 specific Sebastes 34820 0.0 0.0 0.0 mg/100 g Pak choy Type 1 specific Brassica rapa var. chinensis 93385 45.5 45.5 45.5 mg/100 g Papaya Type 1 specific Carica papaya 3649 2.6 2.6 2.6 mg/100 g Parmesan cheese Type 2 0.2 0.2 0.2 mg/100 g Parsley Type 1 specific Petroselinum crispum 4043 2560.0 2560.0 2560.0 mg/100 g Parsnip Type 1 specific Pastinaca sativa 4041 22.5 22.5 22.5 mg/100 g Passion fruit Type 1 specific Passiflora edulis 78168 0.7 0.7 0.7 mg/100 g Pea shoots Type 1 24.8 24.8 24.8 mg/100 g Peach Type 1 specific Prunus persica 3760 0.55 0.55 0.55 mg/100 g Peach (var.) Type 1 specific Prunus persica var. persica 323852 0.55 0.55 0.55 mg/100 g Peanut Type 1 specific Arachis hypogaea 3818 0.0 0.0 0.0 mg/100 g Peanut oil Type 2 0.45 0.45 0.45 mg/100 g Pear Type 1 specific Pyrus communis 23211 1.5 1.5 1.5 mg/100 g Pecan nut Type 1 specific Carya illinoinensis 32201 2.15 2.15 2.15 mg/100 g Pectin Type 2 specific 0.0 0.0 0.0 mg/100 g Pepper (Spice) Type 1 specific Piper nigrum 13216 36.9 36.9 36.9 mg/100 g Persian lime Type 1 specific Citrus latifolia 200541 0.6 0.6 0.6 mg/100 g Pine nut Type 1 specific Pinus 3337 20.15 20.15 20.15 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 0.5 0.5 0.5 mg/100 g Pink salmon Type 1 specific Oncorhynchus gorbuscha 8017 0.4 0.4 0.4 mg/100 g Pollock Type 1 specific Pollachius 8059 0.0 0.0 0.0 mg/100 g Pomegranate Type 1 specific Punica granatum 22663 10.35 10.35 10.35 mg/100 g Prairie turnip Type 1 specific Pediomelum esculentum 458363 0.0 0.0 0.0 mg/100 g Purple laver Type 1 specific Porphyra laciniata 4.0 4.0 4.0 mg/100 g Quinoa Type 1 specific Chenopodium quinoa 63459 0.0 0.0 0.0 mg/100 g Radish Type 1 specific Raphanus sativus 3726 1.3 1.3 1.3 mg/100 g Rainbow smelt Type 1 specific Osmerus mordax 8014 0.1 0.1 0.1 mg/100 g Red rice Type 1 specific Oryza rufipogon 4529 0.15 0.15 0.15 mg/100 g Red wine Type 2 0.4 0.4 0.4 mg/100 g Redcurrant Type 1 specific Ribes rubrum 175228 11.0 11.0 11.0 mg/100 g Rocket salad (ssp.) Type 1 specific Eruca vesicaria ssp. sativa 29727 108.6 108.6 108.6 mg/100 g Roe Type 2 generic 0.2 0.2 0.2 mg/100 g Roman camomile Type 1 specific Chamaemelum nobile 99037 0.0 0.0 0.0 mg/100 g Rose hip Type 1 specific Rosa 3764 25.9 25.9 25.9 mg/100 g Rosé wine Type 2 0.0 0.0 0.0 mg/100 g Rye Type 1 specific Secale cereale 4550 5.9 5.9 5.9 mg/100 g Sake Type 2 specific 0.0 0.0 0.0 mg/100 g Salted butter Type 1 7.0 7.0 7.0 mg/100 g Savoy cabbage Type 1 specific Brassica oleracea var. sabauda 1216010 68.8 68.8 68.8 mg/100 g Scallop Type 1 specific Pectinidae 6566 3.3 3.3 3.3 mg/100 g Scup Type 1 specific Stenotomus chrysops 35579 0.1 0.1 0.1 mg/100 g Sesame Type 1 specific Sesamum orientale 4182 0.0 0.0 0.0 mg/100 g Sesame oil Type 2 4.35 4.35 4.35 mg/100 g Shallot Type 1 specific Allium ascalonicum 1476995 0.8 0.8 0.8 mg/100 g Shark Type 1 specific Squaliformes 282414 0.1 0.1 0.1 mg/100 g Sheefish Type 1 specific Stenodus leucichthys 59296 0.0 0.0 0.0 mg/100 g Snail Type 1 specific Gastropoda 6448 0.1 0.1 0.1 mg/100 g Snapper Type 1 specific Lutjanidae 30850 0.1 0.1 0.1 mg/100 g Sockeye salmon Type 1 specific Oncorhynchus nerka 8023 0.15 0.15 0.15 mg/100 g Soft-necked garlic Type 1 specific Allium sativum L. var. sativum 4682 1.7 1.7 1.7 mg/100 g Sour cream Type 2 0.5 0.5 0.5 mg/100 g Soursop Type 1 specific Annona muricata 13337 0.4 0.4 0.4 mg/100 g Soy bean Type 1 specific Glycine max 3847 37.0 37.0 37.0 mg/100 g Soy milk Type 2 specific 3.0 3.0 3.0 mg/100 g Soy sauce Type 2 specific 0.0 0.0 0.0 mg/100 g Soybean oil Type 2 86.65 90.95 82.35 mg/100 g Spanish mackerel Type 1 specific Scomberomorus maculatus 99344 0.1 0.1 0.1 mg/100 g Spelt Type 1 specific Triticum spelta 58933 3.6 3.6 3.6 mg/100 g Spinach Type 1 specific Spinacia oleracea 3562 482.9 482.9 482.9 mg/100 g Spirulina Type 1 specific Spirulina 551299 2.5 2.5 2.5 mg/100 g Squid Type 1 specific Teuthida 551290 0.0 0.0 0.0 mg/100 g Star fruit Type 1 specific Averrhoa carambola 28974 0.0 0.0 0.0 mg/100 g Striped mullet Type 1 specific Mugil cephalus 48193 0.1 0.1 0.1 mg/100 g Sturgeon Type 1 specific Acipenseridae 7900 0.1 0.1 0.1 mg/100 g Sunflower oil Type 2 4.5 4.5 4.5 mg/100 g Swede Type 1 specific Brassica napus 3708 0.3 0.3 0.3 mg/100 g Sweet basil Type 1 specific Ocimum basilicum 39350 414.8 414.8 414.8 mg/100 g Sweet marjoram Type 1 specific Origanum majorana 268884 621.7 621.7 621.7 mg/100 g Sweet orange Type 1 specific Citrus sinensis 2711 0.05 0.05 0.05 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 0.25 0.25 0.25 mg/100 g Swiss chard Type 1 specific Beta vulgaris ssp. cicla 1527200 830.0 830.0 830.0 mg/100 g Swiss cheese Type 2 0.1 0.1 0.1 mg/100 g Swordfish Type 1 specific Xiphias gladius 8245 0.1 0.1 0.1 mg/100 g Syrup Type 2 specific 0.0 0.0 0.0 mg/100 g Tallow Type 2 specific 0.0 0.0 0.0 mg/100 g Tamarind Type 1 specific Tamarindus indica 58860 2.8 2.8 2.8 mg/100 g Tapioca pearl Type 2 specific 0.0 0.0 0.0 mg/100 g Taro Type 1 specific Colocasia esculenta 4460 1.0 1.0 1.0 mg/100 g Teff Type 1 specific Eragrostis tef 110835 1.9 1.9 1.9 mg/100 g Tofu Type 2 specific 2.4 2.4 2.4 mg/100 g True frog Type 1 specific Ranidae 8397 0.1 0.1 0.1 mg/100 g True sole Type 1 specific Soleidae 30948 0.1 0.1 0.1 mg/100 g Turkey Type 1 specific Meleagris gallopavo 9103 0.0 0.0 0.0 mg/100 g Turmeric Type 1 specific Curcuma longa 136217 13.4 13.4 13.4 mg/100 g Turnip Type 1 specific Brassica rapa var. rapa 51350 0.1 0.1 0.1 mg/100 g Vanilla Type 1 specific Vanilla 51238 0.0 0.0 0.0 mg/100 g Vinegar Type 2 specific 0.0 0.0 0.0 mg/100 g Wakame Type 1 specific Undaria pinnatifida 74381 5.3 5.3 5.3 mg/100 g Walnut Type 1 specific Juglans 16718 2.7 2.7 2.7 mg/100 g Wasabi Type 1 specific Wasabia japonica 75806 3.5 3.5 3.5 mg/100 g Water spinach Type 1 Ipomoea aquatica 482.9 482.9 482.9 mg/100 g Watercress Type 1 specific Rorippa nasturtium-aquaticum 135518 250.0 250.0 250.0 mg/100 g Watermelon Type 1 specific Citrullus lanatus 3654 0.15 0.15 0.15 mg/100 g Welsh onion Type 1 specific Allium fistulosum 35875 193.4 193.4 193.4 mg/100 g Whelk Type 1 specific Buccinidae 37796 0.1 0.1 0.1 mg/100 g White wine Type 2 0.4 0.4 0.4 mg/100 g Whitefish Type 1 specific Coregonus 27772 0.1 0.1 0.1 mg/100 g Whiting Type 1 specific Merlangius merlangus 8058 0.1 0.1 0.1 mg/100 g Wild carrot Type 1 specific Daucus carota 4039 4.3 4.3 4.3 mg/100 g Wild celery Type 1 specific Apium graveolens 4045 13.1 13.1 13.1 mg/100 g Wild leek Type 1 specific Allium ampeloprasum 4681 47.0 47.0 47.0 mg/100 g Wild rice Type 1 specific Zizania 15949 1.9 1.9 1.9 mg/100 g Yam Type 1 specific Dioscorea 4672 2.3 2.3 2.3 mg/100 g Yellow zucchini Type 1 specific Cucurbita pepo var. cylindrica 3.2 3.2 3.2 mg/100 g Yellowfin tuna Type 1 specific Thunnus albacares 8236 0.1 0.1 0.1 mg/100 g Yellowtail amberjack Type 1 specific Seriola lalandi 302047 0.1 0.1 0.1 mg/100 g