1.0 2011-09-21 00:28:16 UTC 2015-07-21 06:57:38 UTC FDB023334 L-alpha-Glutamyl-L-lysine Glutamyl-L-lysine is a dipeptide whose absorption is facilitated by the human intestinal oligopeptide transporter (PEPT1) (PMID 16759105). Glutamyl-L-lysine is an isopeptides found in human hair. ( Schriftenreihe des Deutschen Wollforschungsinstitutes (Technische Hochschule Aachen) (1979), (Sonderband, Haarwiss. Symp. Dtsch. Wollforschungsinst., 1st, 1978), 128-30. ) [HMDB] E-K EK Glutamyllysine L-alpha-glutamyl-L-Lysine L-Glu-L-lys N2-a-glutamyl-lysine N2-alpha-glutamyl-lysine N2-L-a-glutamyl-Lysine N2-L-a-Glutamyllysine N2-L-alpha-glutamyl-Lysine N2-L-alpha-Glutamyllysine C11H21N3O5 275.3015 275.148120797 (2S)-6-amino-2-[(2S)-2-amino-4-carboxybutanamido]hexanoic acid L-α-glutamyl-L-lysine 5891-53-2 NCCCC[C@H](NC(=O)[C@@H](N)CCC(O)=O)C(O)=O InChI=1S/C11H21N3O5/c12-6-2-1-3-8(11(18)19)14-10(17)7(13)4-5-9(15)16/h7-8H,1-6,12-13H2,(H,14,17)(H,15,16)(H,18,19)/t7-,8-/m0/s1 BBBXWRGITSUJPB-YUMQZZPRSA-N belongs to the class of organic compounds known as dipeptides. These are organic compounds containing a sequence of exactly two alpha-amino acids joined by a peptide bond. Dipeptides Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Alpha amino acid amides Amino acids Amino fatty acids Carbonyl compounds Carboxylic acid salts Carboxylic acids Dicarboxylic acids and derivatives Glutamic acid and derivatives Hydrocarbon derivatives Medium-chain fatty acids Monoalkylamines N-acyl amines N-acyl-L-alpha-amino acids Organic oxides Organic salts Organic zwitterions Organopnictogen compounds Secondary carboxylic acid amides Aliphatic acyclic compound Alpha-amino acid amide Alpha-amino acid or derivatives Alpha-dipeptide Amine Amino acid Amino acid or derivatives Amino fatty acid Carbonyl group Carboxamide group Carboxylic acid Carboxylic acid salt Dicarboxylic acid or derivatives Fatty acid Fatty acyl Fatty amide Glutamic acid or derivatives Hydrocarbon derivative Medium-chain fatty acid N-acyl-alpha amino acid or derivatives N-acyl-alpha-amino acid N-acyl-amine N-acyl-l-alpha-amino acid Organic nitrogen compound Organic oxide Organic oxygen compound Organic salt Organic zwitterion Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine Secondary carboxylic acid amide dipeptide Solid logp -3.90 ALOGPS logs -1.73 ALOGPS solubility 5.13e+00 g/l ALOGPS logp -6.1 ChemAxon pka_strongest_acidic 3.33 ChemAxon pka_strongest_basic 10.21 ChemAxon iupac (2S)-6-amino-2-[(2S)-2-amino-4-carboxybutanamido]hexanoic acid ChemAxon average_mass 275.3015 ChemAxon mono_mass 275.148120797 ChemAxon smiles NCCCC[C@H](NC(=O)[C@@H](N)CCC(O)=O)C(O)=O ChemAxon formula C11H21N3O5 ChemAxon inchi InChI=1S/C11H21N3O5/c12-6-2-1-3-8(11(18)19)14-10(17)7(13)4-5-9(15)16/h7-8H,1-6,12-13H2,(H,14,17)(H,15,16)(H,18,19)/t7-,8-/m0/s1 ChemAxon inchikey BBBXWRGITSUJPB-YUMQZZPRSA-N ChemAxon polar_surface_area 155.74 ChemAxon refractivity 65.9 ChemAxon polarizability 28.33 ChemAxon rotatable_bond_count 10 ChemAxon acceptor_count 7 ChemAxon donor_count 5 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 24628 Specdb::CMs 38730 Specdb::CMs 132815 Specdb::CMs 140549 Specdb::NmrOneD 47882 Specdb::NmrOneD 47883 Specdb::NmrOneD 47884 Specdb::NmrOneD 47885 Specdb::NmrOneD 47886 Specdb::NmrOneD 47887 Specdb::NmrOneD 47888 Specdb::NmrOneD 47889 Specdb::NmrOneD 47890 Specdb::NmrOneD 47891 Specdb::NmrOneD 47892 Specdb::NmrOneD 47893 Specdb::NmrOneD 47894 Specdb::NmrOneD 47895 Specdb::NmrOneD 47896 Specdb::NmrOneD 47897 Specdb::NmrOneD 47898 Specdb::NmrOneD 47899 Specdb::NmrOneD 47900 Specdb::NmrOneD 47901 Specdb::MsMs 320536 Specdb::MsMs 320537 Specdb::MsMs 320538 Specdb::MsMs 367918 Specdb::MsMs 367919 Specdb::MsMs 367920 Specdb::MsMs 2408576 Specdb::MsMs 2408577 Specdb::MsMs 2408578 Specdb::MsMs 2554267 Specdb::MsMs 2554268 Specdb::MsMs 2554269 HMDB04207 #<Reference:0x000055ce318e3de8> #<Reference:0x000055ce318e3c30> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823