1.0 2011-09-21 00:28:46 UTC 2015-07-21 06:57:39 UTC FDB023364 2'-O-Methyladenosine 2'-O-Methyladenosine is a methylated adenine residue. 2'-O-Methyladenosine is a naturally occurring 2'-O-methylpurine nucleoside with long lasting hypotensive properties; resistance of 2'-O-methyladenosine against adenosine deaminase is thought to contribute to prolonged activity. 2'-O-Methyladenosine occurs in human fluids, and they increase in urines of untreated adenosine deaminase (ADA) deficient patients (OMIM 608958). (PMID: 9539952, 6980397) [HMDB] 2-O-methyla-denosine 2-O-Methyladenosine C11H15N5O4 281.2679 281.112403993 5-(6-amino-9H-purin-9-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-ol 2-O-methyladenosine 2140-79-6 COC1C(O)C(CO)OC1N1C=NC2=C(N)N=CN=C12 InChI=1S/C11H15N5O4/c1-19-8-7(18)5(2-17)20-11(8)16-4-15-6-9(12)13-3-14-10(6)16/h3-5,7-8,11,17-18H,2H2,1H3,(H2,12,13,14) FPUGCISOLXNPPC-UHFFFAOYSA-N belongs to the class of organic compounds known as purine nucleosides. Purine nucleosides are compounds comprising a purine base attached to a ribosyl or deoxyribosyl moiety. Purine nucleosides Organic compounds Nucleosides, nucleotides, and analogues Purine nucleosides Aromatic heteropolycyclic compounds 6-aminopurines Aminopyrimidines and derivatives Azacyclic compounds Dialkyl ethers Glycosylamines Heteroaromatic compounds Hydrocarbon derivatives Imidolactams Monosaccharides N-substituted imidazoles Organopnictogen compounds Oxacyclic compounds Primary alcohols Primary amines Secondary alcohols Tetrahydrofurans 6-aminopurine Alcohol Amine Aminopyrimidine Aromatic heteropolycyclic compound Azacycle Azole Dialkyl ether Ether Glycosyl compound Heteroaromatic compound Hydrocarbon derivative Imidazole Imidazopyrimidine Imidolactam Monosaccharide N-glycosyl compound N-substituted imidazole Organic nitrogen compound Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Oxacycle Primary alcohol Primary amine Purine Purine nucleoside Pyrimidine Secondary alcohol Tetrahydrofuran Solid logp -0.88 ALOGPS logs -1.47 ALOGPS solubility 9.54e+00 g/l ALOGPS logp -1.4 ChemAxon pka_strongest_acidic 12.99 ChemAxon pka_strongest_basic 4.99 ChemAxon iupac 5-(6-amino-9H-purin-9-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-ol ChemAxon average_mass 281.2679 ChemAxon mono_mass 281.112403993 ChemAxon smiles COC1C(O)C(CO)OC1N1C=NC2=C(N)N=CN=C12 ChemAxon formula C11H15N5O4 ChemAxon inchi InChI=1S/C11H15N5O4/c1-19-8-7(18)5(2-17)20-11(8)16-4-15-6-9(12)13-3-14-10(6)16/h3-5,7-8,11,17-18H,2H2,1H3,(H2,12,13,14) ChemAxon inchikey FPUGCISOLXNPPC-UHFFFAOYSA-N ChemAxon polar_surface_area 128.54 ChemAxon refractivity 67.95 ChemAxon polarizability 27.33 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 8 ChemAxon donor_count 3 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 10730 Specdb::CMs 38754 Specdb::CMs 130476 Specdb::CMs 138210 Specdb::NmrOneD 149860 Specdb::NmrOneD 149861 Specdb::NmrOneD 149862 Specdb::NmrOneD 149863 Specdb::NmrOneD 149864 Specdb::NmrOneD 149865 Specdb::NmrOneD 149866 Specdb::NmrOneD 149867 Specdb::NmrOneD 149868 Specdb::NmrOneD 149869 Specdb::NmrOneD 149870 Specdb::NmrOneD 149871 Specdb::NmrOneD 149872 Specdb::NmrOneD 149873 Specdb::NmrOneD 149874 Specdb::NmrOneD 149875 Specdb::NmrOneD 149876 Specdb::NmrOneD 149877 Specdb::NmrOneD 149878 Specdb::NmrOneD 149879 Specdb::MsMs 289624 Specdb::MsMs 289625 Specdb::MsMs 289626 Specdb::MsMs 329092 Specdb::MsMs 329093 Specdb::MsMs 329094 Specdb::MsMs 2361284 Specdb::MsMs 2361285 Specdb::MsMs 2361286 Specdb::MsMs 2601041 Specdb::MsMs 2601042 Specdb::MsMs 2601043 HMDB04326 #<Reference:0x000055ce31ff0d98> #<Reference:0x000055ce31ff0af0> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823