1.0 2011-09-21 00:28:47 UTC 2025-11-19 02:43:52 UTC FDB023366 Anabasine Anabasine is a nicotinic receptor agonist toxin and Cholinesterase inhibitor which acts upon the nicotinic acetylcholine receptors. Anabasine is an unstable yellow liquid which is succeptable to light, heat and moisture. It's decomposition products include Nitrogen oxides, carbon monoxide, irritating and toxic fumes and gases and carbon dioxide. Anabasine is a pyridine alkaloid found in the stem of the (Nicotiana glauca) plant, a close relative of (Nicotiana tabacum) the common tobacco plant. Anabasine is a metabolite of nicotine which can be used as an indicator of a person's exposure to tobbacco smoke. A piperidine botanical insecticide. [HMDB] (-)-2-(3'-Pyridyl)piperidine (-)-Anabasine (+-)-Anabasine (+/-)-Anabasine (S)-3-(2-Piperidinyl)pyridine 2-(3-Pyridinyl)piperidine 2-(3'-Pyridyl) piperidine 3-(2-Piperidinyl)pyridine Anabasin Anabazin DL-Anabasine L-3-(2'-Piperidyl)pyridine Neonicotine Neonikotin S-(-)-Anabasine C10H14N2 162.2316 162.115698458 3-(piperidin-2-yl)pyridine anabasine 13078-04-1 C1CCC(NC1)C1=CN=CC=C1 InChI=1S/C10H14N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h3-4,6,8,10,12H,1-2,5,7H2 MTXSIJUGVMTTMU-UHFFFAOYSA-N belongs to the class of organic compounds known as alkaloids and derivatives. These are naturally occurring chemical compounds that contain mostly basic nitrogen atoms. This group also includes some related compounds with neutral and even weakly acidic properties. Also some synthetic compounds of similar structure are attributed to alkaloids. In addition to carbon, hydrogen and nitrogen, alkaloids may also contain oxygen, sulfur and more rarely other elements such as chlorine, bromine, and phosphorus. Alkaloids and derivatives Organic compounds Alkaloids and derivatives Aromatic heteromonocyclic compounds Aralkylamines Azacyclic compounds Dialkylamines Heteroaromatic compounds Hydrocarbon derivatives Organopnictogen compounds Piperidines Pyridines and derivatives Alkaloid or derivatives Amine Aralkylamine Aromatic heteromonocyclic compound Azacycle Heteroaromatic compound Hydrocarbon derivative Organic nitrogen compound Organoheterocyclic compound Organonitrogen compound Organopnictogen compound Piperidine Pyridine Secondary aliphatic amine Secondary amine Pyridine alkaloids piperidine alkaloid pyridine alkaloid Liquid logp 0.90 ALOGPS logs -1.21 ALOGPS solubility 9.90e+00 g/l ALOGPS logp 1.22 ChemAxon pka_strongest_basic 9 ChemAxon iupac 3-(piperidin-2-yl)pyridine ChemAxon average_mass 162.2316 ChemAxon mono_mass 162.115698458 ChemAxon smiles C1CCC(NC1)C1=CN=CC=C1 ChemAxon formula C10H14N2 ChemAxon inchi InChI=1S/C10H14N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h3-4,6,8,10,12H,1-2,5,7H2 ChemAxon inchikey MTXSIJUGVMTTMU-UHFFFAOYSA-N ChemAxon polar_surface_area 24.92 ChemAxon refractivity 48.96 ChemAxon polarizability 18.71 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge 1 ChemAxon formal_charge 0 ChemAxon Specdb::NmrTwoD 1933 Specdb::CMs 1198 Specdb::CMs 20965 Specdb::CMs 31523 Specdb::CMs 31742 Specdb::CMs 31743 Specdb::CMs 132509 Specdb::CMs 140243 Specdb::MsIr 2199 Specdb::MsIr 2200 Specdb::MsIr 2201 Specdb::NmrOneD 1998 Specdb::NmrOneD 48182 Specdb::NmrOneD 48183 Specdb::NmrOneD 48184 Specdb::NmrOneD 48185 Specdb::NmrOneD 48186 Specdb::NmrOneD 48187 Specdb::NmrOneD 48188 Specdb::NmrOneD 48189 Specdb::NmrOneD 48190 Specdb::NmrOneD 48191 Specdb::NmrOneD 48192 Specdb::NmrOneD 48193 Specdb::NmrOneD 48194 Specdb::NmrOneD 48195 Specdb::NmrOneD 48196 Specdb::NmrOneD 48197 Specdb::NmrOneD 48198 Specdb::NmrOneD 48199 Specdb::NmrOneD 48200 Specdb::NmrOneD 48201 Specdb::MsMs 91032 Specdb::MsMs 91033 Specdb::MsMs 91034 Specdb::MsMs 154329 Specdb::MsMs 154330 Specdb::MsMs 154331 Specdb::MsMs 2443351 Specdb::MsMs 2443352 Specdb::MsMs 2443353 Specdb::MsMs 2519795 Specdb::MsMs 2519796 Specdb::MsMs 2519797 HMDB04350 #<Reference:0x000055ce307a7818> #<Reference:0x000055ce307a7638> #<Reference:0x000055ce307a7318> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823