1.0 2011-09-21 00:29:10 UTC 2025-11-19 02:43:56 UTC FDB023387 O-Desmethylangolensin O-Desmethylangolensin (ODMA) is a metabolite of the soy isoflavone daidzein by intestinal bacteria in approximately 80-90% of persons. Studies suggest beneficial health effects associated with daidzein-metabolizing phenotypes, and there is some small association between ODMA production and some phenotypes. Few dietary factors are associated with daidzein-metabolizing phenotypes. However, it remains unclear why some, but not all, persons harbor ODMA-producing bacteria. ODMA production is inversely associated with age, height, weight, and body mass index. In addition, Asians are less likely than whites to be ODMA producers, and former smokers were more likely than never smokers to be ODMA producers. Investigators have attempted to identify the bacteria involved in ODMA production, and several candidate bacteria were associated, but not definitely identified. ODMA production is correlated with the abundance of methanogens, indicating that the metabolic fate of daidzein may be related to intestinal H(2) metabolism. (PMID: 18326607, 17506823) [HMDB] 2,4-Dihydroxyphenyl p-hydroxyphenethyl ketone 2',4'-dihydroxy-2-(p-hydroxyphenyl)-Propiophenone O-Demethylangolensin O-Demethylangolesin C15H14O4 258.2693 258.089208936 1-(2,4-dihydroxyphenyl)-2-(4-hydroxyphenyl)propan-1-one O-desmethylangolensin 21255-69-6 CC(C(=O)C1=C(O)C=C(O)C=C1)C1=CC=C(O)C=C1 InChI=1S/C15H14O4/c1-9(10-2-4-11(16)5-3-10)15(19)13-7-6-12(17)8-14(13)18/h2-9,16-18H,1H3 JDJPNKPFDDUBFV-UHFFFAOYSA-N belongs to the class of organic compounds known as alpha-methyldeoxybenzoin flavonoids. These are flavonoids with a structure based on a 1,2-diphenyl-2-propan-2-one. Alpha-methyldeoxybenzoin flavonoids Organic compounds Phenylpropanoids and polyketides Alpha-methyldeoxybenzoin flavonoids Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids 1-hydroxy-4-unsubstituted benzenoids Alkyl-phenylketones Aryl alkyl ketones Benzoyl derivatives Hydrocarbon derivatives Organic oxides Phenylpropanes Resorcinols Stilbenes Vinylogous acids 1-hydroxy-2-unsubstituted benzenoid 1-hydroxy-4-unsubstituted benzenoid Alkyl-phenylketone Alpha-methyldeoxybenzoin flavonoid Aromatic homomonocyclic compound Aryl alkyl ketone Aryl ketone Benzenoid Benzoyl Hydrocarbon derivative Ketone Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound Phenol Phenylketone Phenylpropane Resorcinol Stilbene Vinylogous acid Solid logp 2.98 ALOGPS logs -3.49 ALOGPS solubility 8.39e-02 g/l ALOGPS logp 3.65 ChemAxon pka_strongest_acidic 7.83 ChemAxon pka_strongest_basic -4.9 ChemAxon iupac 1-(2,4-dihydroxyphenyl)-2-(4-hydroxyphenyl)propan-1-one ChemAxon average_mass 258.2693 ChemAxon mono_mass 258.089208936 ChemAxon smiles CC(C(=O)C1=C(O)C=C(O)C=C1)C1=CC=C(O)C=C1 ChemAxon formula C15H14O4 ChemAxon inchi InChI=1S/C15H14O4/c1-9(10-2-4-11(16)5-3-10)15(19)13-7-6-12(17)8-14(13)18/h2-9,16-18H,1H3 ChemAxon inchikey JDJPNKPFDDUBFV-UHFFFAOYSA-N ChemAxon polar_surface_area 77.76 ChemAxon refractivity 71.7 ChemAxon polarizability 26.38 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 4 ChemAxon donor_count 3 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 18683 Specdb::CMs 38774 Specdb::CMs 132368 Specdb::CMs 140102 Specdb::MsMs 53490 Specdb::MsMs 53491 Specdb::MsMs 53492 Specdb::MsMs 120639 Specdb::MsMs 120640 Specdb::MsMs 120641 Specdb::MsMs 2759318 Specdb::MsMs 2759319 Specdb::MsMs 2759320 Specdb::MsMs 2949828 Specdb::MsMs 2949829 Specdb::MsMs 2949830 HMDB04629 #<Reference:0x000055ce331b8968> #<Reference:0x000055ce331b87b0> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823