1.0 2011-09-21 00:29:30 UTC 2015-07-21 06:57:41 UTC FDB023410 11,14,15-THETA 11,14,15-trihydroxyeicosatrienoic acid (11,14,15-THETA) is a metabolite of the 15-lipoxygenase (15-LO) pathway of arachidonic acid (AA). Increased amounts of 11,14,15-THETA are synthesized in subacute hypoxia. Prolonged exposure to reduced PO2 activates 15-LO in small pulmonary arteries (PA); activation of 15-LO is associated with translocation of the enzyme from the cytosol to membrane. 11,14,15-THETA is an endothelium-derived relaxing factor. (PMID: 12690037, 9812980, 15388505, 14622984) [HMDB] (5Z,8Z,12E)-11,14,15-Trihydroxyeicosa-5,8,12-trienoate (5Z,8Z,12E)-11,14,15-Trihydroxyeicosa-5,8,12-trienoic acid (5Z,8Z,12E)-11,14,15-Trihydroxyicosa-5,8,12-trienoate (5Z,8Z,12E)-11,14,15-Trihydroxyicosa-5,8,12-trienoic acid 11,14,15-trihydroxy-5Z,8Z,12E-eicosatrienoate 11,14,15-trihydroxy-5Z,8Z,12E-eicosatrienoic acid 11,14,15-Trihydroxyicosatrienoate 11,14,15-Trihydroxyicosatrienoic acid C20H34O5 354.481 354.240624198 11,14,15-trihydroxyicosa-5,8,12-trienoic acid 11,14,15-trihydroxyicosa-5,8,12-trienoic acid CCCCCC(O)C(O)C=CC(O)CC=CCC=CCCCC(O)=O InChI=1S/C20H34O5/c1-2-3-9-13-18(22)19(23)16-15-17(21)12-10-7-5-4-6-8-11-14-20(24)25/h4,6-7,10,15-19,21-23H,2-3,5,8-9,11-14H2,1H3,(H,24,25) YCFPVUKKIWMCJK-UHFFFAOYSA-N belongs to the class of organic compounds known as hydroxyeicosatrienoic acids. These are eicosanoic acids with an attached hydroxyl group and three CC double bonds. Hydroxyeicosatrienoic acids Organic compounds Lipids and lipid-like molecules Fatty Acyls Eicosanoids Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Hydroxy fatty acids Long-chain fatty acids Monocarboxylic acids and derivatives Organic oxides Polyols Secondary alcohols Unsaturated fatty acids Alcohol Aliphatic acyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Fatty acid Hydrocarbon derivative Hydroxy fatty acid Hydroxyeicosatrienoic acid Long-chain fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Polyol Secondary alcohol Unsaturated fatty acid Solid logp 4.47 ALOGPS logs -3.82 ALOGPS solubility 5.32e-02 g/l ALOGPS logp 3.41 ChemAxon pka_strongest_acidic 4.82 ChemAxon pka_strongest_basic -2.9 ChemAxon iupac 11,14,15-trihydroxyicosa-5,8,12-trienoic acid ChemAxon average_mass 354.481 ChemAxon mono_mass 354.240624198 ChemAxon smiles CCCCCC(O)C(O)C=CC(O)CC=CCC=CCCCC(O)=O ChemAxon formula C20H34O5 ChemAxon inchi InChI=1S/C20H34O5/c1-2-3-9-13-18(22)19(23)16-15-17(21)12-10-7-5-4-6-8-11-14-20(24)25/h4,6-7,10,15-19,21-23H,2-3,5,8-9,11-14H2,1H3,(H,24,25) ChemAxon inchikey YCFPVUKKIWMCJK-UHFFFAOYSA-N ChemAxon polar_surface_area 97.99 ChemAxon refractivity 103.23 ChemAxon polarizability 41.15 ChemAxon rotatable_bond_count 15 ChemAxon acceptor_count 5 ChemAxon donor_count 4 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Arachidonic Acid Metabolism SMP00075 map00590 HMDB04694 #<Reference:0x000055ce31dbf920> #<Reference:0x000055ce31dbf768> #<Reference:0x000055ce31dbf5b0> #<Reference:0x000055ce31dbf3f8> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Cytochrome P450 2D6 Q6NWU0 CYP2D6 Cytochrome P450, family 1, subfamily A, polypeptide 1 A0N0X8 CYP1A1