1.0 2011-09-21 00:29:36 UTC 2019-11-26 03:21:09 UTC FDB023414 Vernolic acid 12,13-EpOME is the 12,13-cis epoxide of linoleic acid, generated by neutrophils during the oxidative burst. The toxicity and biosynthesis of 12,13-EpOME has not been well differentiated from 9,10-EpOME, but has been presumed to be essentially the same.P [HMDB]. Vernolic acid is found in rice. (+/-)-12(13)-epoxy-9Z-octadecenoate (+/-)-12(13)-epoxy-9Z-octadecenoic acid (9Z)-11-(3-pentyloxiran-2-yl)undec-9-enoate (9Z)-11-(3-pentyloxiran-2-yl)undec-9-enoic acid (9Z)-11-(3-Pentyloxiran-2-yl)undec-9-enoic acids (9Z)-12,13-epoxyoctadecenoate (9Z)-12,13-epoxyoctadecenoic acid 12,13-cis-Epoxyoctadecenoate 12,13-cis-Epoxyoctadecenoic acid 12,13-epoxy-9(Z)-octadecenoate 12,13-epoxy-9(Z)-octadecenoic acid 12,13-Epoxy-cis-9-octadecenoate 12,13-Epoxy-cis-9-octadecenoic acid 12,13-epoxyoctadec-9(Z)-enoate 12,13-epoxyoctadec-9(Z)-enoic acid 12,13-Monoepoxy-cis-9-octadecenoate 12,13-Monoepoxy-cis-9-octadecenoic acid 12(13)-EpOME Acide vernolique cis-12,13-Ep, 9c-18:1 cis-12,13-Epoxy-9-octadecenoate cis-12,13-Epoxy-9-octadecenoic acid Vernolic acids Vernolsaeure Vernolsaeuren C18H32O3 296.4449 296.23514489 11-(3-pentyloxiran-2-yl)undec-9-enoic acid 11-(3-pentyloxiran-2-yl)undec-9-enoic acid CCCCCC1OC1CC=CCCCCCCCC(O)=O InChI=1S/C18H32O3/c1-2-3-10-13-16-17(21-16)14-11-8-6-4-5-7-9-12-15-18(19)20/h8,11,16-17H,2-7,9-10,12-15H2,1H3,(H,19,20) CCPPLLJZDQAOHD-UHFFFAOYSA-N belongs to the class of organic compounds known as long-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 13 and 21 carbon atoms. Long-chain fatty acids Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acids and conjugates Aliphatic heteromonocyclic compounds Carbonyl compounds Carboxylic acids Dialkyl ethers Epoxides Epoxy fatty acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Oxacyclic compounds Unsaturated fatty acids Aliphatic heteromonocyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Dialkyl ether Epoxy fatty acid Ether Heterocyclic fatty acid Hydrocarbon derivative Long-chain fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Oxirane Unsaturated fatty acid Solid logp 6.37 ALOGPS logs -5.79 ALOGPS solubility 4.78e-04 g/l ALOGPS logp 5.48 ChemAxon pka_strongest_acidic 4.99 ChemAxon pka_strongest_basic -4.2 ChemAxon iupac 11-(3-pentyloxiran-2-yl)undec-9-enoic acid ChemAxon average_mass 296.4449 ChemAxon mono_mass 296.23514489 ChemAxon smiles CCCCCC1OC1CC=CCCCCCCCC(O)=O ChemAxon formula C18H32O3 ChemAxon inchi InChI=1S/C18H32O3/c1-2-3-10-13-16-17(21-16)14-11-8-6-4-5-7-9-12-15-18(19)20/h8,11,16-17H,2-7,9-10,12-15H2,1H3,(H,19,20) ChemAxon inchikey CCPPLLJZDQAOHD-UHFFFAOYSA-N ChemAxon polar_surface_area 49.83 ChemAxon refractivity 86.92 ChemAxon polarizability 37.57 ChemAxon rotatable_bond_count 14 ChemAxon acceptor_count 3 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 115830 Specdb::CMs 130323 Specdb::CMs 833135 Specdb::CMs 833136 Specdb::MsMs 3411704 Specdb::MsMs 3411705 Specdb::MsMs 3411706 Specdb::MsMs 3411707 Specdb::MsMs 3411708 Specdb::MsMs 3411709 HMDB04702 38299 Rice Type 1 specific Oryza sativa 4530 0.01 0.01 0.01 mg/100 g Cytochrome P450 2D6 Q6NWU0 CYP2D6 Cytochrome P450, family 1, subfamily A, polypeptide 1 A0N0X8 CYP1A1