1.0 2011-09-21 00:29:43 UTC 2025-11-19 02:44:06 UTC FDB023421 5C-aglycone 5C-aglycone is one of the two major aglycone urinary water-soluble metabolites of Phylloquinone (Vitamin K1) and menaquinones (vitamin K2), usually excreted as glucuronide conjugates; their structure suggests that they are formed by an oxidative degradation of the phytyl side chain involving enzymes of omega- and beta-oxidation. Newborn infants as a group, are known to have precariously low vitamin K stores and are routinely given vitamin K prophylaxis at birth. (PMIDs 7306367, 4833371, 15722567) [HMDB] 1,4-dihydro-a,3-dimethyl-1,4-dioxo-2-Naphthalenebutanoate 1,4-dihydro-a,3-dimethyl-1,4-dioxo-2-Naphthalenebutanoic acid 2-Methyl-3-(3-carboxybutyl)-1,4-naphthoquinone 2-methyl-3-(3'-3'-carboxymethylpropyl)-1,4-naphthoquinone 2-methyl-3-(3'-carboxy-3'-methylpropyl)-1,4-naphthoquinone 2-Methyl-3-(3'-carboxybutyl)-1,4-naphthoquinone C16H16O4 272.2958 272.104859 2-methyl-4-(3-methyl-1,4-dioxo-1,4-dihydronaphthalen-2-yl)butanoic acid 5c-aglycone 34927-45-2 CC(CCC1=C(C)C(=O)C2=C(C=CC=C2)C1=O)C(O)=O InChI=1S/C16H16O4/c1-9(16(19)20)7-8-11-10(2)14(17)12-5-3-4-6-13(12)15(11)18/h3-6,9H,7-8H2,1-2H3,(H,19,20) ALLYVKRLOHDVKI-UHFFFAOYSA-N belongs to the class of organic compounds known as vitamin k compounds. These are quinone lipids containing a methylated naphthoquinone ring structure, and vary in the aliphatic side chain attached at the 3-position. Vitamin K compounds Organic compounds Lipids and lipid-like molecules Prenol lipids Quinone and hydroquinone lipids Aromatic homopolycyclic compounds Aryl ketones Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Naphthoquinones Organic oxides Quinones Aromatic homopolycyclic compound Aryl ketone Benzenoid Carbonyl group Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Ketone Monocarboxylic acid or derivatives Naphthalene Naphthoquinone Organic oxide Organic oxygen compound Organooxygen compound Quinone Solid logp 2.38 ALOGPS logs -3.61 ALOGPS solubility 6.76e-02 g/l ALOGPS logp 2.84 ChemAxon pka_strongest_acidic 3.91 ChemAxon pka_strongest_basic -7.2 ChemAxon iupac 2-methyl-4-(3-methyl-1,4-dioxo-1,4-dihydronaphthalen-2-yl)butanoic acid ChemAxon average_mass 272.2958 ChemAxon mono_mass 272.104859 ChemAxon smiles CC(CCC1=C(C)C(=O)C2=C(C=CC=C2)C1=O)C(O)=O ChemAxon formula C16H16O4 ChemAxon inchi InChI=1S/C16H16O4/c1-9(16(19)20)7-8-11-10(2)14(17)12-5-3-4-6-13(12)15(11)18/h3-6,9H,7-8H2,1-2H3,(H,19,20) ChemAxon inchikey ALLYVKRLOHDVKI-UHFFFAOYSA-N ChemAxon polar_surface_area 71.44 ChemAxon refractivity 74.94 ChemAxon polarizability 28.59 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 4 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 24825 Specdb::CMs 38806 Specdb::CMs 172064 Specdb::MsMs 95985 Specdb::MsMs 95986 Specdb::MsMs 95987 Specdb::MsMs 160374 Specdb::MsMs 160375 Specdb::MsMs 160376 Specdb::MsMs 2690468 Specdb::MsMs 2690469 Specdb::MsMs 2690470 Specdb::MsMs 2988215 Specdb::MsMs 2988216 Specdb::MsMs 2988217 HMDB04810 #<Reference:0x000055ce30e7f618> #<Reference:0x000055ce30e7f410> #<Reference:0x000055ce30e7f1e0> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823