1.0 2011-09-21 00:29:45 UTC 2025-11-19 02:44:06 UTC FDB023423 2,5-Furandicarboxylic acid 2,5-Furandicarboxylic acid is a normal urinary metabolite in humans. (PMIDs 14708889, 8087979, 2338430, 3711221) Dietary studies show that the furan derivatives or their precursors are of exogenous origin. They are originated from furan derivatives found in food prepared by strong heating. This may explain the absence of 2,5-furandicarboxylic acid in urine of breastfed children, and the absence of these acids in the urine of rat, pig, cow, ox, rabbit, and monkey. (PMID 4630229) [HMDB] (1,5-dimethylhexyl)Hydrazine 2,5-Dicarboxyfuran 2,5-furandicarboxylate Dehydromucate Dehydromucic acid Dehydroschleimsaeure Furan 2,5-dicarboxylate Furan 2,5-dicarboxylic acid Furan-2,5-dicarbonsaeure furan-2,5-dicarboxylate furan-2,5-dicarboxylic acid Furane-a,a'-dicarboxylate Furane-a,a'-dicarboxylic acid Furane-a,alpha'-dicarboxylate Furane-a,alpha'-dicarboxylic acid Furane-alpha,alpha'-dicarboxylate Furane-alpha,alpha'-dicarboxylic acid Furane-α,alpha'-dicarboxylate Furane-α,alpha'-dicarboxylic acid C6H4O5 156.093 156.005873238 furan-2,5-dicarboxylic acid 2,5-furandicarboxylic acid 3238-40-2 OC(=O)C1=CC=C(O1)C(O)=O InChI=1S/C6H4O5/c7-5(8)3-1-2-4(11-3)6(9)10/h1-2H,(H,7,8)(H,9,10) CHTHALBTIRVDBM-UHFFFAOYSA-N belongs to the class of organic compounds known as furoic acids. These are organic compounds containing a furoic acid moiety, with a structure characterized by a furan ring bearing a carboxylic acid group at the C2 or C3 carbon atom. Furoic acids Organic compounds Organoheterocyclic compounds Furans Furoic acid and derivatives Aromatic heteromonocyclic compounds Carboxylic acids Dicarboxylic acids and derivatives Heteroaromatic compounds Hydrocarbon derivatives Organic oxides Organooxygen compounds Oxacyclic compounds Aromatic heteromonocyclic compound Carboxylic acid Carboxylic acid derivative Dicarboxylic acid or derivatives Furoic acid Heteroaromatic compound Hydrocarbon derivative Organic oxide Organic oxygen compound Organooxygen compound Oxacycle dicarboxylic acid furans Solid logp 0.66 ALOGPS logs -1.12 ALOGPS solubility 1.18e+01 g/l ALOGPS logp 0.27 ChemAxon pka_strongest_acidic -4.6 ChemAxon pka_strongest_basic 11.11 ChemAxon iupac furan-2,5-dicarboxylic acid ChemAxon average_mass 156.093 ChemAxon mono_mass 156.005873238 ChemAxon smiles OC(=O)C1=CC=C(O1)C(O)=O ChemAxon formula C6H4O5 ChemAxon inchi InChI=1S/C6H4O5/c7-5(8)3-1-2-4(11-3)6(9)10/h1-2H,(H,7,8)(H,9,10) ChemAxon inchikey CHTHALBTIRVDBM-UHFFFAOYSA-N ChemAxon polar_surface_area 87.74 ChemAxon refractivity 32.84 ChemAxon polarizability 13.05 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 4 ChemAxon donor_count 2 ChemAxon physiological_charge -2 ChemAxon formal_charge 0 ChemAxon Specdb::MsIr 2237 Specdb::MsIr 2238 Specdb::MsIr 2239 Specdb::CMs 22307 Specdb::CMs 38808 Specdb::CMs 131369 Specdb::CMs 139103 Specdb::NmrTwoD 1940 Specdb::MsMs 2403 Specdb::MsMs 2404 Specdb::MsMs 2405 Specdb::MsMs 315523 Specdb::MsMs 315524 Specdb::MsMs 315525 Specdb::MsMs 361531 Specdb::MsMs 361532 Specdb::MsMs 361533 Specdb::MsMs 2749498 Specdb::MsMs 2749499 Specdb::MsMs 2749500 Specdb::MsMs 2933265 Specdb::MsMs 2933266 Specdb::MsMs 2933267 Specdb::NmrOneD 2005 Specdb::NmrOneD 48422 Specdb::NmrOneD 48423 Specdb::NmrOneD 48424 Specdb::NmrOneD 48425 Specdb::NmrOneD 48426 Specdb::NmrOneD 48427 Specdb::NmrOneD 48428 Specdb::NmrOneD 48429 Specdb::NmrOneD 48430 Specdb::NmrOneD 48431 Specdb::NmrOneD 48432 Specdb::NmrOneD 48433 Specdb::NmrOneD 48434 Specdb::NmrOneD 48435 Specdb::NmrOneD 48436 Specdb::NmrOneD 48437 Specdb::NmrOneD 48438 Specdb::NmrOneD 48439 Specdb::NmrOneD 48440 Specdb::NmrOneD 48441 Specdb::NmrOneD 166347 Specdb::NmrOneD 166634 HMDB04812 #<Reference:0x00005577b735d778> #<Reference:0x00005577b735d5c0> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columba 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 Animal Capra aegagrus hircus 9925 Domestic pig Type 1 Animal Sus scrofa domesticus 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus cuniculus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus hemionus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823