1.0 2011-09-21 00:32:30 UTC 2018-05-28 18:36:48 UTC FDB023620 5-HEPE 5-HEPE is a major eicosanoid formed from eicosapentaenoic acid (EPA). 5-HEPE is produced in human neutrophils. The eicosanoids are a diverse family of molecules that have powerful effects on cell function. They are best known as intercellular messengers, having autocrine and paracrine effects following their secretion from the cells that synthesize them. The diversity of possible products that can be synthesized from eicosatrienoic acid is due, in part to the variety of enzymes that can act on it. Studies have placed many, but not all, of these enzymes at or inside the nucleus. In some cases, the nuclear import or export of eicosatrienoic acid-processing enzymes is highly regulated. Furthermore, nuclear receptors that are activated by specific eicosanoids are known to exist. (PMID: 8847485, 15896193) [HMDB] (+-)-5-HEPE (+-)-5-Hydroxy-6e,8Z,11Z,14Z,17Z-eicosapentaenoate (+-)-5-Hydroxy-6e,8Z,11Z,14Z,17Z-eicosapentaenoic acid (+/-)-5-HEPE (+/-)-5-hydroxy-6E,8Z,11Z,14Z,17Z-eicosapentaenoate (+/-)-5-hydroxy-6E,8Z,11Z,14Z,17Z-eicosapentaenoic acid 5-Hepe 5-Hydroxy-6,8,11,14,17-eicosapentaenoate 5-Hydroxy-6,8,11,14,17-eicosapentaenoic acid 5-Hydroxyeicosapentaenoate 5-Hydroxyeicosapentaenoic acid C20H30O3 318.4504 318.219494826 (6E)-5-hydroxyicosa-6,8,11,14,17-pentaenoic acid (6E)-5-hydroxyicosa-6,8,11,14,17-pentaenoic acid 92008-51-0 CCC=CCC=CCC=CCC=C\C=C\C(O)CCCC(O)=O InChI=1S/C20H30O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19(21)17-15-18-20(22)23/h3-4,6-7,9-10,12-14,16,19,21H,2,5,8,11,15,17-18H2,1H3,(H,22,23)/b4-3?,7-6?,10-9?,13-12?,16-14+ FTAGQROYQYQRHF-OTZRFASISA-N belongs to the class of organic compounds known as hydroxyeicosapentaenoic acids. These are eicosanoic acids with an attached hydroxyl group and five CC double bonds. Hydroxyeicosapentaenoic acids Organic compounds Lipids and lipid-like molecules Fatty Acyls Eicosanoids Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Hydroxy fatty acids Long-chain fatty acids Monocarboxylic acids and derivatives Organic oxides Secondary alcohols Unsaturated fatty acids Alcohol Aliphatic acyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Fatty acid Hydrocarbon derivative Hydroxy fatty acid Hydroxyeicosapentaenoic acid Long-chain fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Secondary alcohol Unsaturated fatty acid Solid logp 5.54 ALOGPS logs -5.05 ALOGPS solubility 2.86e-03 g/l ALOGPS logp 4.99 ChemAxon pka_strongest_acidic 4.58 ChemAxon pka_strongest_basic -1.5 ChemAxon iupac (6E)-5-hydroxyicosa-6,8,11,14,17-pentaenoic acid ChemAxon average_mass 318.4504 ChemAxon mono_mass 318.219494826 ChemAxon smiles CCC=CCC=CCC=CCC=C\C=C\C(O)CCCC(O)=O ChemAxon formula C20H30O3 ChemAxon inchi InChI=1S/C20H30O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19(21)17-15-18-20(22)23/h3-4,6-7,9-10,12-14,16,19,21H,2,5,8,11,15,17-18H2,1H3,(H,22,23)/b4-3?,7-6?,10-9?,13-12?,16-14+ ChemAxon inchikey FTAGQROYQYQRHF-OTZRFASISA-N ChemAxon polar_surface_area 57.53 ChemAxon refractivity 102.59 ChemAxon polarizability 38.51 ChemAxon rotatable_bond_count 13 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon HMDB05081 #<Reference:0x000055ce32f46770> #<Reference:0x000055ce32f46590> #<Reference:0x000055ce32f46388> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823