1.0 2011-09-21 00:32:41 UTC 2015-07-21 06:57:48 UTC FDB023632 Homovanillin 3 -Methoxy-4-hydroxyphenylacetaldehyde is an intermediary aldehyde of dopamine metabolism, metabolized by the class I human liver alcohol dehydrogenases (ADHs) . ADH catalyzes both ethanol and acetaldehyde, and the dopamine intermediates compete for the same site of ADH, a basis for the ethanol-induced in vivo alterations of dopamine metabolism. (PMID 2432930) [HMDB] (4-Hydroxy-3-methoxyphenyl)acetaldehyde 2-(4-hydroxy-3-methoxyphenyl) Ethanal 3-Methoxy-4-hydroxyphenylacetaldehyde 4-hydroxy-3-methoxy-Benzeneacetaldehyde 4-hydroxy-3-methoxybenzeneacetaldehyde HMPAL C9H10O3 166.1739 166.062994186 2-(4-hydroxy-3-methoxyphenyl)acetaldehyde homovanillin 5703-24-2 COC1=C(O)C=CC(CC=O)=C1 InChI=1S/C9H10O3/c1-12-9-6-7(4-5-10)2-3-8(9)11/h2-3,5-6,11H,4H2,1H3 GOQGGGANVKPMNH-UHFFFAOYSA-N belongs to the class of organic compounds known as methoxyphenols. Methoxyphenols are compounds containing a methoxy group attached to the benzene ring of a phenol moiety. Methoxyphenols Organic compounds Benzenoids Phenols Methoxyphenols Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Alkyl aryl ethers Alpha-hydrogen aldehydes Anisoles Hydrocarbon derivatives Methoxybenzenes Organic oxides Phenoxy compounds Phenylacetaldehydes 1-hydroxy-2-unsubstituted benzenoid Aldehyde Alkyl aryl ether Alpha-hydrogen aldehyde Anisole Aromatic homomonocyclic compound Carbonyl group Ether Hydrocarbon derivative Methoxybenzene Methoxyphenol Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound Phenol ether Phenoxy compound Phenylacetaldehyde alpha-CH2-containing aldehyde phenylacetaldehydes Solid logp 1.52 ALOGPS logs -1.76 ALOGPS solubility 2.90e+00 g/l ALOGPS logp 0.99 ChemAxon pka_strongest_acidic 9.94 ChemAxon pka_strongest_basic -4.9 ChemAxon iupac 2-(4-hydroxy-3-methoxyphenyl)acetaldehyde ChemAxon average_mass 166.1739 ChemAxon mono_mass 166.062994186 ChemAxon smiles COC1=C(O)C=CC(CC=O)=C1 ChemAxon formula C9H10O3 ChemAxon inchi InChI=1S/C9H10O3/c1-12-9-6-7(4-5-10)2-3-8(9)11/h2-3,5-6,11H,4H2,1H3 ChemAxon inchikey GOQGGGANVKPMNH-UHFFFAOYSA-N ChemAxon polar_surface_area 46.53 ChemAxon refractivity 44.88 ChemAxon polarizability 16.81 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 3 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Tyrosine Metabolism SMP00006 map00350 Specdb::CMs 26613 Specdb::CMs 38866 Specdb::CMs 133160 Specdb::CMs 140894 Specdb::MsMs 325003 Specdb::MsMs 325004 Specdb::MsMs 325005 Specdb::MsMs 373552 Specdb::MsMs 373553 Specdb::MsMs 373554 Specdb::MsMs 2817699 Specdb::MsMs 2817700 Specdb::MsMs 2817701 Specdb::MsMs 2887253 Specdb::MsMs 2887254 Specdb::MsMs 2887255 Specdb::MsIr 2282 Specdb::MsIr 2283 Specdb::MsIr 2284 Specdb::NmrOneD 54962 Specdb::NmrOneD 54963 Specdb::NmrOneD 54964 Specdb::NmrOneD 54965 Specdb::NmrOneD 54966 Specdb::NmrOneD 54967 Specdb::NmrOneD 54968 Specdb::NmrOneD 54969 Specdb::NmrOneD 54970 Specdb::NmrOneD 54971 Specdb::NmrOneD 54972 Specdb::NmrOneD 54973 Specdb::NmrOneD 54974 Specdb::NmrOneD 54975 Specdb::NmrOneD 54976 Specdb::NmrOneD 54977 Specdb::NmrOneD 54978 Specdb::NmrOneD 54979 Specdb::NmrOneD 54980 Specdb::NmrOneD 54981 HMDB05175 28111 #<Reference:0x000055ce32b96850> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 floral vanilla