1.0 2011-09-21 00:34:16 UTC 2015-07-21 06:57:50 UTC FDB023758 Kyotorphin Kyotorphin (L-tyrosyl-L-arginine) is a neuroactive dipeptide which plays a role in pain regulation in the brain. It was first isolated from bovine brain by Japanese scientists in 1979. Kyotorphin was named for the site of its discovery, Kyoto, Japan and because of its morphine- (or endorphin-) like analgesic activity. Kyotorphin has an analgesic effect, but it does not interact with the opioid receptors. Instead, it acts by releasing an Met-enkephalin and stabilizing it from degradation. It may also possess properties of neuromediator/neuromodulator. It has been shown that kyotorphin is present in the human cerebrospinal fluid and that it is lower in patients with persistent pain. [HMDB] Kiotorphin L-tyrosyl-l-arginine N(2)-L-Tyrosyl-L-arginine TYR-arg C15H23N5O4 337.3742 337.175004249 (2S)-2-[(2S)-2-amino-3-(4-hydroxyphenyl)propanamido]-5-carbamimidamidopentanoic acid tyr-arg 70904-56-2 N[C@@H](CC1=CC=C(O)C=C1)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O InChI=1S/C15H23N5O4/c16-11(8-9-3-5-10(21)6-4-9)13(22)20-12(14(23)24)2-1-7-19-15(17)18/h3-6,11-12,21H,1-2,7-8,16H2,(H,20,22)(H,23,24)(H4,17,18,19)/t11-,12-/m0/s1 JXNRXNCCROJZFB-RYUDHWBXSA-N belongs to the class of organic compounds known as peptides. Peptides are compounds containing an amide derived from two or more amino carboxylic acid molecules (the same or different) by formation of a covalent bond from the carbonyl carbon of one to the nitrogen atom of another. Peptides Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Amino acids Amphetamines and derivatives Aralkylamines Arginine and derivatives Carbonyl compounds Carboximidamides Carboximidic acids Carboxylic acids Guanidines Hydrocarbon derivatives Imines Monoalkylamines Monocarboxylic acids and derivatives N-acyl-alpha amino acids Organic oxides Organopnictogen compounds Propargyl-type 1,3-dipolar organic compounds 1-hydroxy-2-unsubstituted benzenoid Alpha peptide Alpha-amino acid or derivatives Amine Amino acid Amino acid or derivatives Amphetamine or derivatives Aralkylamine Arginine or derivatives Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboximidamide Carboximidic acid Carboximidic acid derivative Carboxylic acid Guanidine Hydrocarbon derivative Imine Monocarboxylic acid or derivatives Monocyclic benzene moiety N-acyl-alpha amino acid or derivatives N-acyl-alpha-amino acid Organic 1,3-dipolar compound Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Phenol Primary aliphatic amine Primary amine Propargyl-type 1,3-dipolar organic compound dipeptide Solid logp -3.08 ALOGPS logs -3.33 ALOGPS solubility 1.57e-01 g/l ALOGPS logp -2.5 ChemAxon pka_strongest_acidic 3.52 ChemAxon pka_strongest_basic 12.1 ChemAxon iupac (2S)-2-[(2S)-2-amino-3-(4-hydroxyphenyl)propanamido]-5-carbamimidamidopentanoic acid ChemAxon average_mass 337.3742 ChemAxon mono_mass 337.175004249 ChemAxon smiles N[C@@H](CC1=CC=C(O)C=C1)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O ChemAxon formula C15H23N5O4 ChemAxon inchi InChI=1S/C15H23N5O4/c16-11(8-9-3-5-10(21)6-4-9)13(22)20-12(14(23)24)2-1-7-19-15(17)18/h3-6,11-12,21H,1-2,7-8,16H2,(H,20,22)(H,23,24)(H4,17,18,19)/t11-,12-/m0/s1 ChemAxon inchikey JXNRXNCCROJZFB-RYUDHWBXSA-N ChemAxon polar_surface_area 174.55 ChemAxon refractivity 97.82 ChemAxon polarizability 35.31 ChemAxon rotatable_bond_count 9 ChemAxon acceptor_count 8 ChemAxon donor_count 7 ChemAxon physiological_charge 1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 22581 Specdb::CMs 32105 Specdb::CMs 32106 Specdb::CMs 32107 Specdb::CMs 32108 Specdb::CMs 32109 Specdb::CMs 32110 Specdb::CMs 38872 Specdb::CMs 99870 Specdb::CMs 99871 Specdb::CMs 99872 Specdb::CMs 99873 Specdb::CMs 99874 Specdb::CMs 99875 Specdb::CMs 158594 Specdb::MsMs 316147 Specdb::MsMs 316148 Specdb::MsMs 316149 Specdb::MsMs 362323 Specdb::MsMs 362324 Specdb::MsMs 362325 Specdb::MsMs 2434150 Specdb::MsMs 2434151 Specdb::MsMs 2434152 Specdb::MsMs 2504030 Specdb::MsMs 2504031 Specdb::MsMs 2504032 Specdb::NmrOneD 10822 Specdb::NmrOneD 10823 Specdb::NmrOneD 10824 Specdb::NmrOneD 10825 Specdb::NmrOneD 10826 Specdb::NmrOneD 10827 Specdb::NmrOneD 10828 Specdb::NmrOneD 10829 Specdb::NmrOneD 10830 Specdb::NmrOneD 10831 Specdb::NmrOneD 10832 Specdb::NmrOneD 10833 Specdb::NmrOneD 10834 Specdb::NmrOneD 10835 Specdb::NmrOneD 10836 Specdb::NmrOneD 10837 Specdb::NmrOneD 10838 Specdb::NmrOneD 10839 Specdb::NmrOneD 10840 Specdb::NmrOneD 10841 HMDB05768 17537 #<Reference:0x000055ac3f700440> #<Reference:0x000055ac3f700210> #<Reference:0x000055ac3f700030> #<Reference:0x000055ac3f6fbdc8> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823