1.0 2011-09-21 00:34:31 UTC 2015-07-21 06:57:51 UTC FDB023773 2-Acetamido-2-deoxy-6-O-alpha-L-fucopyranosyl-D-glucose 2-Acetamido-2-deoxy-6-O-a-L-fucopyranosyl-D-glucose is an oligosaccharide isolated from the urine of patients with fucosidosis (Fucosidosis is an autosomal recessive lysosomal storage disease caused by defective alpha-L-fucosidase with accumulation of fucose in the tissues. Different phenotypes include clinical features such as neurologic deterioration, growth retardation, visceromegaly, and seizures in a severe early form; coarse facial features, angiokeratoma corporis diffusum, spasticity and delayed psychomotor development in a longer surviving form; and an unusual spondylometaphyseoepiphyseal dysplasia in yet another form. OMIM 230000). (PMID 728478) [HMDB] 2-(Acetylamino)-2-deoxy-6-O-(6-deoxy-a-L-galactopyranosyl)-D-glucose 2-(Acetylamino)-2-deoxy-6-O-(6-deoxy-alpha-L-galactopyranosyl)-D-glucose 2-(acetylamino)-2-Deoxy-6-O-(6-deoxy-alpha-L-galactopyranosyl)-delta-glucose 2-Acetamido-2-deoxy-6-O-a-L-fucopyranosyl-D-glucose C14H25NO10 367.349 367.147846025 N-{3,4,5-trihydroxy-1-oxo-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]hexan-2-yl}acetamide N-{3,4,5-trihydroxy-1-oxo-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]hexan-2-yl}acetamide 37776-59-3 CC1OC(OCC(O)C(O)C(O)C(NC(C)=O)C=O)C(O)C(O)C1O InChI=1S/C14H25NO10/c1-5-9(19)12(22)13(23)14(25-5)24-4-8(18)11(21)10(20)7(3-16)15-6(2)17/h3,5,7-14,18-23H,4H2,1-2H3,(H,15,17) YBWAUUBLHOFOPK-UHFFFAOYSA-N belongs to the class of organic compounds known as fatty acyl glycosides of mono- and disaccharides. Fatty acyl glycosides of mono- and disaccharides are compounds composed of a mono- or disaccharide moiety linked to one hydroxyl group of a fatty alcohol or of a phosphorylated alcohol (phosphoprenols), a hydroxy fatty acid or to one carboxyl group of a fatty acid (ester linkage) or to an amino alcohol. Fatty acyl glycosides of mono- and disaccharides Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acyl glycosides Aliphatic heteromonocyclic compounds Acetals Acetamides Alkyl glycosides Aminosaccharides Beta-hydroxy aldehydes Hexoses Hydrocarbon derivatives O-glycosyl compounds Organic oxides Organonitrogen compounds Organopnictogen compounds Oxacyclic compounds Oxanes Polyols Secondary alcohols Secondary carboxylic acid amides Acetal Acetamide Alcohol Aldehyde Aliphatic heteromonocyclic compound Alkyl glycoside Amino saccharide Beta-hydroxy aldehyde Carbonyl group Carboxamide group Carboxylic acid derivative Fatty acyl glycoside of mono- or disaccharide Glycosyl compound Hexose monosaccharide Hydrocarbon derivative Monosaccharide O-glycosyl compound Organic nitrogen compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Oxacycle Oxane Polyol Secondary alcohol Secondary carboxylic acid amide Solid logp -2.01 ALOGPS logs -0.56 ALOGPS solubility 1.02e+02 g/l ALOGPS logp -4.6 ChemAxon pka_strongest_acidic 11.42 ChemAxon pka_strongest_basic -3.5 ChemAxon iupac N-{3,4,5-trihydroxy-1-oxo-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]hexan-2-yl}acetamide ChemAxon average_mass 367.349 ChemAxon mono_mass 367.147846025 ChemAxon smiles CC1OC(OCC(O)C(O)C(O)C(NC(C)=O)C=O)C(O)C(O)C1O ChemAxon formula C14H25NO10 ChemAxon inchi InChI=1S/C14H25NO10/c1-5-9(19)12(22)13(23)14(25-5)24-4-8(18)11(21)10(20)7(3-16)15-6(2)17/h3,5,7-14,18-23H,4H2,1-2H3,(H,15,17) ChemAxon inchikey YBWAUUBLHOFOPK-UHFFFAOYSA-N ChemAxon polar_surface_area 186.01 ChemAxon refractivity 79.32 ChemAxon polarizability 35.24 ChemAxon rotatable_bond_count 8 ChemAxon acceptor_count 10 ChemAxon donor_count 7 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 23936 Specdb::CMs 38904 Specdb::CMs 153381 Specdb::MsMs 319057 Specdb::MsMs 319058 Specdb::MsMs 319059 Specdb::MsMs 366037 Specdb::MsMs 366038 Specdb::MsMs 366039 Specdb::MsMs 2268700 Specdb::MsMs 2268701 Specdb::MsMs 2268702 Specdb::MsMs 3072888 Specdb::MsMs 3072889 Specdb::MsMs 3072890 Specdb::NmrOneD 61152 Specdb::NmrOneD 61153 Specdb::NmrOneD 61154 Specdb::NmrOneD 61155 Specdb::NmrOneD 61156 Specdb::NmrOneD 61157 Specdb::NmrOneD 61158 Specdb::NmrOneD 61159 Specdb::NmrOneD 61160 Specdb::NmrOneD 61161 Specdb::NmrOneD 61162 Specdb::NmrOneD 61163 Specdb::NmrOneD 61164 Specdb::NmrOneD 61165 Specdb::NmrOneD 61166 Specdb::NmrOneD 61167 Specdb::NmrOneD 61168 Specdb::NmrOneD 61169 Specdb::NmrOneD 61170 Specdb::NmrOneD 61171 HMDB05817 #<Reference:0x000055ce30ba8908> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823