1.0 2011-09-21 00:35:15 UTC 2025-11-19 02:45:02 UTC FDB023817 Norsalsolinol A human metabolite taken as a putative food compound of mammalian origin [HMDB] 1,2,3,4-Tetrahydro-6,7-isoquinolinediol 6,7-dihydroxy-1,2,3,4-tetrahydroisoquinoline 6,7-Dihydroxytetrahydroisoquinoline tetrahydro-6,7-Isoquinolinediol C9H11NO2 165.1891 165.078978601 1,2,3,4-tetrahydroisoquinoline-6,7-diol norsalsolinol 34827-33-3 OC1=C(O)C=C2CNCCC2=C1 InChI=1S/C9H11NO2/c11-8-3-6-1-2-10-5-7(6)4-9(8)12/h3-4,10-12H,1-2,5H2 MBFUSGLXKQWVDW-UHFFFAOYSA-N belongs to the class of organic compounds known as tetrahydroisoquinolines. These are tetrahydrogenated isoquinoline derivatives. Tetrahydroisoquinolines Organic compounds Organoheterocyclic compounds Tetrahydroisoquinolines Aromatic heteropolycyclic compounds 1-hydroxy-2-unsubstituted benzenoids Aralkylamines Azacyclic compounds Dialkylamines Hydrocarbon derivatives Organooxygen compounds Organopnictogen compounds 1-hydroxy-2-unsubstituted benzenoid Amine Aralkylamine Aromatic heteropolycyclic compound Azacycle Benzenoid Hydrocarbon derivative Organic nitrogen compound Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Secondary aliphatic amine Secondary amine Tetrahydroisoquinoline Solid logp -0.13 ALOGPS logs -1.14 ALOGPS solubility 1.20e+01 g/l ALOGPS logp 0.58 ChemAxon pka_strongest_acidic 9.58 ChemAxon pka_strongest_basic 8.64 ChemAxon iupac 1,2,3,4-tetrahydroisoquinoline-6,7-diol ChemAxon average_mass 165.1891 ChemAxon mono_mass 165.078978601 ChemAxon smiles OC1=C(O)C=C2CNCCC2=C1 ChemAxon formula C9H11NO2 ChemAxon inchi InChI=1S/C9H11NO2/c11-8-3-6-1-2-10-5-7(6)4-9(8)12/h3-4,10-12H,1-2,5H2 ChemAxon inchikey MBFUSGLXKQWVDW-UHFFFAOYSA-N ChemAxon polar_surface_area 52.49 ChemAxon refractivity 46.58 ChemAxon polarizability 17.28 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 3 ChemAxon donor_count 3 ChemAxon physiological_charge 1 ChemAxon formal_charge 0 ChemAxon Specdb::MsIr 2356 Specdb::MsIr 2357 Specdb::MsIr 2358 Specdb::CMs 17262 Specdb::CMs 38946 Specdb::CMs 137121 Specdb::CMs 144855 Specdb::NmrOneD 61592 Specdb::NmrOneD 61593 Specdb::NmrOneD 61594 Specdb::NmrOneD 61595 Specdb::NmrOneD 61596 Specdb::NmrOneD 61597 Specdb::NmrOneD 61598 Specdb::NmrOneD 61599 Specdb::NmrOneD 61600 Specdb::NmrOneD 61601 Specdb::NmrOneD 61602 Specdb::NmrOneD 61603 Specdb::NmrOneD 61604 Specdb::NmrOneD 61605 Specdb::NmrOneD 61606 Specdb::NmrOneD 61607 Specdb::NmrOneD 61608 Specdb::NmrOneD 61609 Specdb::NmrOneD 61610 Specdb::NmrOneD 61611 Specdb::MsMs 304165 Specdb::MsMs 304166 Specdb::MsMs 304167 Specdb::MsMs 347290 Specdb::MsMs 347291 Specdb::MsMs 347292 Specdb::MsMs 2304117 Specdb::MsMs 2304118 Specdb::MsMs 2304119 Specdb::MsMs 2658094 Specdb::MsMs 2658095 Specdb::MsMs 2658096 HMDB06044 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823