1.0 2011-09-21 00:36:01 UTC 2015-07-21 06:57:54 UTC FDB023867 N-Acetylneuraminate 9-phosphate N-Acetylneuraminate 9-phosphate is an intermediate in Aminosugars metabolism. N-Acetylneuraminate 9-phosphate is the 4th to last step in the synthesis of colominate and is converted from N-Acetyl-D-mannosamine-6-phosphate via the enzyme N-Acylneuraminate-9-phosphate synthase (EC 2.5.1.57). It is then converted to N-Acetylneuraminate via the enzyme N-acylneuraminate-9-phosphatase(EC 3.1.3.29). [HMDB] C11H20NO12P 389.2498 389.072311621 (4R,5S,6S)-6-[(1R,2R)-1,2-dihydroxy-3-(phosphonooxy)propyl]-5-acetamido-2,4-dihydroxyoxane-2-carboxylic acid (4R,5S,6S)-6-[(1R,2R)-1,2-dihydroxy-3-(phosphonooxy)propyl]-5-acetamido-2,4-dihydroxyoxane-2-carboxylic acid CC(=O)N[C@H]1[C@H](O)CC(O)(O[C@@H]1[C@H](O)[C@H](O)COP(O)(O)=O)C(O)=O InChI=1S/C11H20NO12P/c1-4(13)12-7-5(14)2-11(19,10(17)18)24-9(7)8(16)6(15)3-23-25(20,21)22/h5-9,14-16,19H,2-3H2,1H3,(H,12,13)(H,17,18)(H2,20,21,22)/t5-,6-,7+,8-,9+,11?/m1/s1 SQMNIXJSBCSNCI-KHLKYKDFSA-N belongs to the class of organic compounds known as n-acylneuraminic acids. These are neuraminic acids carrying an N-acyl substituent. N-acylneuraminic acids Organic compounds Organic oxygen compounds Organooxygen compounds Carbohydrates and carbohydrate conjugates Aliphatic heteromonocyclic compounds Acetamides Alpha hydroxy acids and derivatives C-glucuronides C-glycosyl compounds Carbonyl compounds Carboxylic acids Hemiacetals Hydrocarbon derivatives Monoalkyl phosphates Monocarboxylic acids and derivatives Neuraminic acids Organic oxides Organonitrogen compounds Organopnictogen compounds Oxacyclic compounds Oxanes Pyrans Secondary alcohols Secondary carboxylic acid amides Acetamide Alcohol Aliphatic heteromonocyclic compound Alkyl phosphate Alpha-hydroxy acid C-glucuronide C-glycosyl compound Carbonyl group Carboxamide group Carboxylic acid Carboxylic acid derivative Glycosyl compound Hemiacetal Hydrocarbon derivative Hydroxy acid Monoalkyl phosphate Monocarboxylic acid or derivatives N-acylneuraminic acid Neuraminic acid Organic nitrogen compound Organic oxide Organic phosphoric acid derivative Organoheterocyclic compound Organonitrogen compound Organopnictogen compound Oxacycle Oxane Phosphoric acid ester Pyran Secondary alcohol Secondary carboxylic acid amide Solid logp -2.57 ALOGPS logs -1.39 ALOGPS solubility 1.59e+01 g/l ALOGPS logp -3.7 ChemAxon pka_strongest_acidic 1.47 ChemAxon pka_strongest_basic -3.1 ChemAxon iupac (4R,5S,6S)-6-[(1R,2R)-1,2-dihydroxy-3-(phosphonooxy)propyl]-5-acetamido-2,4-dihydroxyoxane-2-carboxylic acid ChemAxon average_mass 389.2498 ChemAxon mono_mass 389.072311621 ChemAxon smiles CC(=O)N[C@H]1[C@H](O)CC(O)(O[C@@H]1[C@H](O)[C@H](O)COP(O)(O)=O)C(O)=O ChemAxon formula C11H20NO12P ChemAxon inchi InChI=1S/C11H20NO12P/c1-4(13)12-7-5(14)2-11(19,10(17)18)24-9(7)8(16)6(15)3-23-25(20,21)22/h5-9,14-16,19H,2-3H2,1H3,(H,12,13)(H,17,18)(H2,20,21,22)/t5-,6-,7+,8-,9+,11?/m1/s1 ChemAxon inchikey SQMNIXJSBCSNCI-KHLKYKDFSA-N ChemAxon polar_surface_area 223.31 ChemAxon refractivity 74.65 ChemAxon polarizability 32.28 ChemAxon rotatable_bond_count 7 ChemAxon acceptor_count 11 ChemAxon donor_count 8 ChemAxon physiological_charge -3 ChemAxon formal_charge 0 ChemAxon Amino Sugar Metabolism SMP00045 map00520 Specdb::CMs 24569 Specdb::CMs 38984 Specdb::CMs 155799 Specdb::MsMs 320365 Specdb::MsMs 320366 Specdb::MsMs 320367 Specdb::MsMs 367732 Specdb::MsMs 367733 Specdb::MsMs 367734 Specdb::MsMs 2733147 Specdb::MsMs 2733148 Specdb::MsMs 2733149 Specdb::MsMs 2972814 Specdb::MsMs 2972815 Specdb::MsMs 2972816 Specdb::NmrOneD 68032 Specdb::NmrOneD 68033 Specdb::NmrOneD 68034 Specdb::NmrOneD 68035 Specdb::NmrOneD 68036 Specdb::NmrOneD 68037 Specdb::NmrOneD 68038 Specdb::NmrOneD 68039 Specdb::NmrOneD 68040 Specdb::NmrOneD 68041 Specdb::NmrOneD 68042 Specdb::NmrOneD 68043 Specdb::NmrOneD 68044 Specdb::NmrOneD 68045 Specdb::NmrOneD 68046 Specdb::NmrOneD 68047 Specdb::NmrOneD 68048 Specdb::NmrOneD 68049 Specdb::NmrOneD 68050 Specdb::NmrOneD 68051 HMDB06268 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Sialic acid synthase Q9NR45 NANS