1.0 2011-09-21 00:36:04 UTC 2017-04-03 05:02:16 UTC FDB023870 5-Amino-2-oxopentanoic acid 5-Amino-2-oxopentanoic acid is a breakdown product of D-proline. D-proline is first converted to 1-pyrroline-2-carboxylic acid via D-amino acid oxidase, which then spontaneously breaks down into 5-amino-2-oxopentanoic acid. [HMDB] 2-Oxo-5-amino-pentanoate 2-Oxo-5-amino-pentanoic acid 2-Oxo-5-aminopentanoate 2-Oxo-5-aminopentanoic acid 2-Oxo-5-aminovalerate 2-oxo-5-Aminovaleric acid 5-Amino-2-oxopentanoate 5-Amino-2-oxopentanoic acid 5-amino-2-Oxovalerate 5-amino-2-Oxovaleric acid a-keto-delta-Aminopentanoate a-keto-delta-Aminopentanoic acid a-keto-δ-aminopentanoate a-keto-δ-aminopentanoic acid Alpha-keto-delta-aminopentanoate Alpha-keto-delta-aminopentanoic acid α-keto-δ-aminopentanoate α-keto-δ-aminopentanoic acid C5H9NO3 131.1299 131.058243159 5-amino-2-oxopentanoic acid 5-amino-2-oxopentanoic acid 617-45-8 NCCCC(=O)C(O)=O InChI=1S/C5H9NO3/c6-3-1-2-4(7)5(8)9/h1-3,6H2,(H,8,9) BWHGMFYTDQEALD-UHFFFAOYSA-N belongs to the class of organic compounds known as short-chain keto acids and derivatives. These are keto acids with an alkyl chain the contains less than 6 carbon atoms. Short-chain keto acids and derivatives Organic compounds Organic acids and derivatives Keto acids and derivatives Short-chain keto acids and derivatives Aliphatic acyclic compounds Alpha-hydroxy ketones Alpha-keto acids and derivatives Amino acids Carboxylic acids Gamma-amino ketones Hydrocarbon derivatives Monoalkylamines Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Aliphatic acyclic compound Alpha-hydroxy ketone Alpha-keto acid Amine Amino acid Amino acid or derivatives Carbonyl group Carboxylic acid Carboxylic acid derivative Gamma-aminoketone Hydrocarbon derivative Ketone Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine Short-chain keto acid 2-oxo monocarboxylic acid Oxo fatty acids Oxo fatty acids delta-amino acid Solid logp -2.46 ALOGPS logs -0.37 ALOGPS solubility 5.61e+01 g/l ALOGPS logp -2.6 ChemAxon pka_strongest_acidic 3.11 ChemAxon pka_strongest_basic 9.79 ChemAxon iupac 5-amino-2-oxopentanoic acid ChemAxon average_mass 131.1299 ChemAxon mono_mass 131.058243159 ChemAxon smiles NCCCC(=O)C(O)=O ChemAxon formula C5H9NO3 ChemAxon inchi InChI=1S/C5H9NO3/c6-3-1-2-4(7)5(8)9/h1-3,6H2,(H,8,9) ChemAxon inchikey BWHGMFYTDQEALD-UHFFFAOYSA-N ChemAxon polar_surface_area 80.39 ChemAxon refractivity 30.8 ChemAxon polarizability 12.59 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 4 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon D-Arginine and D-Ornithine Metabolism SMP00036 map00472 Fatty Acid Elongation In Mitochondria SMP00054 map00062 Specdb::CMs 23979 Specdb::CMs 38987 Specdb::CMs 135952 Specdb::CMs 143686 Specdb::MsIr 2386 Specdb::MsIr 2387 Specdb::MsIr 2388 Specdb::MsMs 319162 Specdb::MsMs 319163 Specdb::MsMs 319164 Specdb::MsMs 366172 Specdb::MsMs 366173 Specdb::MsMs 366174 Specdb::MsMs 2441572 Specdb::MsMs 2441573 Specdb::MsMs 2441574 Specdb::MsMs 2524929 Specdb::MsMs 2524930 Specdb::MsMs 2524931 Specdb::NmrOneD 68052 Specdb::NmrOneD 68053 Specdb::NmrOneD 68054 Specdb::NmrOneD 68055 Specdb::NmrOneD 68056 Specdb::NmrOneD 68057 Specdb::NmrOneD 68058 Specdb::NmrOneD 68059 Specdb::NmrOneD 68060 Specdb::NmrOneD 68061 Specdb::NmrOneD 68062 Specdb::NmrOneD 68063 Specdb::NmrOneD 68064 Specdb::NmrOneD 68065 Specdb::NmrOneD 68066 Specdb::NmrOneD 68067 Specdb::NmrOneD 68068 Specdb::NmrOneD 68069 Specdb::NmrOneD 68070 Specdb::NmrOneD 68071 HMDB06272 17572 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 3-ketoacyl-CoA thiolase, mitochondrial P42765 ACAA2