1.0 2011-09-21 00:36:42 UTC 2015-07-21 06:57:56 UTC FDB023907 L-Glyceric acid L-glyceric acid is a human urinary metabolite present in patients with L-Glyceric aciduria. The formation of L-glyceric acid from accumulated hydroxypyruvate is due to deficiency of human glyoxylate reductase/hydroxypyruvate reductase (GRHPR, EC 1.1.1.81), a D-2-hydroxy-acid dehydrogenase that plays a critical role in the removal of the metabolic by-product glyoxylate from within the liver. Deficiency of this enzyme is the underlying cause of primary hyperoxaluria type 2 (PH2) and leads to increased urinary oxalate levels, formation of kidney stones and renal failure. (PMID: 16756993) [HMDB] (2S)-2,3-Dihydroxy-propanoate (2S)-2,3-Dihydroxy-propanoic acid (S)-2,3-Dihydroxy-propanoate (S)-2,3-Dihydroxy-propanoic acid (S)-2,3-Dihydroxypropanoate (S)-2,3-Dihydroxypropanoic acid (S)-Glycerate (S)-Glyceric acid L-Glycerate C3H6O4 106.0773 106.02660868 (2S)-2,3-dihydroxypropanoic acid L-glycerate 28305-26-2 OC[C@H](O)C(O)=O InChI=1S/C3H6O4/c4-1-2(5)3(6)7/h2,4-5H,1H2,(H,6,7)/t2-/m0/s1 RBNPOMFGQQGHHO-REOHCLBHSA-N belongs to the class of organic compounds known as sugar acids and derivatives. Sugar acids and derivatives are compounds containing a saccharide unit which bears a carboxylic acid group. Sugar acids and derivatives Organic compounds Organic oxygen compounds Organooxygen compounds Carbohydrates and carbohydrate conjugates Aliphatic acyclic compounds 1,2-diols Alpha hydroxy acids and derivatives Beta hydroxy acids and derivatives Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Monosaccharides Organic oxides Primary alcohols Secondary alcohols 1,2-diol Alcohol Aliphatic acyclic compound Alpha-hydroxy acid Beta-hydroxy acid Carbonyl group Carboxylic acid Carboxylic acid derivative Glyceric_acid Hydrocarbon derivative Hydroxy acid Monocarboxylic acid or derivatives Monosaccharide Organic oxide Primary alcohol Secondary alcohol Sugar acid glyceric acid Solid logp -1.72 ALOGPS logs 0.78 ALOGPS solubility 6.39e+02 g/l ALOGPS logp -1.5 ChemAxon pka_strongest_acidic 3.42 ChemAxon pka_strongest_basic -3 ChemAxon iupac (2S)-2,3-dihydroxypropanoic acid ChemAxon average_mass 106.0773 ChemAxon mono_mass 106.02660868 ChemAxon smiles OC[C@H](O)C(O)=O ChemAxon formula C3H6O4 ChemAxon inchi InChI=1S/C3H6O4/c4-1-2(5)3(6)7/h2,4-5H,1H2,(H,6,7)/t2-/m0/s1 ChemAxon inchikey RBNPOMFGQQGHHO-REOHCLBHSA-N ChemAxon polar_surface_area 77.76 ChemAxon refractivity 20.38 ChemAxon polarizability 8.94 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 4 ChemAxon donor_count 3 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 19616 Specdb::CMs 39011 Specdb::CMs 160548 Specdb::NmrOneD 74312 Specdb::NmrOneD 74313 Specdb::NmrOneD 74314 Specdb::NmrOneD 74315 Specdb::NmrOneD 74316 Specdb::NmrOneD 74317 Specdb::NmrOneD 74318 Specdb::NmrOneD 74319 Specdb::NmrOneD 74320 Specdb::NmrOneD 74321 Specdb::NmrOneD 74322 Specdb::NmrOneD 74323 Specdb::NmrOneD 74324 Specdb::NmrOneD 74325 Specdb::NmrOneD 74326 Specdb::NmrOneD 74327 Specdb::NmrOneD 74328 Specdb::NmrOneD 74329 Specdb::NmrOneD 74330 Specdb::NmrOneD 74331 Specdb::MsMs 60465 Specdb::MsMs 60466 Specdb::MsMs 60467 Specdb::MsMs 116793 Specdb::MsMs 116794 Specdb::MsMs 116795 Specdb::MsMs 2362745 Specdb::MsMs 2362746 Specdb::MsMs 2362747 Specdb::MsMs 2602457 Specdb::MsMs 2602458 Specdb::MsMs 2602459 HMDB06372 #<Reference:0x000055ce324a9e98> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823