1.0 2011-09-21 00:37:02 UTC 2019-11-26 03:21:10 UTC FDB023933 D-Aspartic acid D-Aspartic acid is the D-isomer of aspartic acid. Since its discovery in invertebrates, free D-aspartate (D-Asp) has been identified in a variety of organisms, including microorganisms, plants, and lower animals, mammals and humans. D-Asp in mammalian tissues is present in specific cells, indicating the existence of specific molecular components that regulate D-Asp levels and localization in tissues. In the rat adrenal medulla, D-Asp is closely associated with adrenaline-cells (A-cells), which account for approximately 80% of the total number of chromaffin cells in the tissue, and which make and store adrenaline. D-Asp appears to be absent from noradrenaline-cells (NA-cells), which comprise approximately 20% of the total number of chromaffin cells in the adrenal medulla, and which make and store noradrenaline. D-aspartate oxidase (EC 1.4.3.1, D-AspO), which catalyzes oxidative deamination of D-Asp, appears to be present only in NA-cells, suggesting that the lack of D-Asp in these cells is due to D-Asp oxidase-mediated metabolism of D-Aspecies In the rat adrenal cortex, the distribution of D-Asp changes during development. It has been suggested that developmental changes in the localization of D-Asp reflects the participation of D-Asp in the development and maturation of steroidogenesis in rat adrenal cortical cells. D-Asp is involved in steroid hormone synthesis and secretion in mammals as well. D-Asp is synthesized intracellularly, most likely by Asp racemase (EC 5.1.1.13). Endogenous D-Asp apparently has two different intracellular localization patterns: cytoplasmic and vesicular. D-Asp release can occur through three distinct pathways: 1) spontaneous, continuous release of cytoplasmic D-Asp, which is not associated with a specific stimulus; 2) release of cytoplasmic D-Asp via a volume-sensitive organic anion channel that connects the cytoplasm and extracellular space; 3) exocytotic discharge of vesicular D-Aspecies D-Asp can be released via a mechanism that involves the L-Glu transporter. D-Asp is thus apparently in dynamic flux at the cellular level to carry out its physiological function(s) in mammals. (PMID: 16755369) [HMDB] (-)-Aspartic acid (2R)-2-Aminobutanedioate (2R)-2-Aminobutanedioic acid (R)-2-Aminobutanedioate (R)-2-Aminobutanedioic acid (R)-2-Aminosuccinic acid (R)-Aspartic acid 1-Amino-1,2-carboxyethane Aspartate D-form aspartic acid Aspartic acid D-form D-(-)-Aspartic acid D-Asparaginsaeure D-aspartate D-aspartic acid delta-(-)-Aspartic acid delta-asparaginsaeure delta-aspartate delta-aspartic acid Lopac-alpha-9256 Tocris-0213 C4H7NO4 133.1027 133.037507717 (2R)-2-aminobutanedioic acid D-aspartic acid 1783-96-6 N[C@H](CC(O)=O)C(O)=O InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m1/s1 CKLJMWTZIZZHCS-UWTATZPHSA-N belongs to the class of organic compounds known as aspartic acid and derivatives. Aspartic acid and derivatives are compounds containing an aspartic acid or a derivative thereof resulting from reaction of aspartic acid at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. Aspartic acid and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Amino acids Carbonyl compounds Carboxylic acids D-alpha-amino acids Dicarboxylic acids and derivatives Fatty acids and conjugates Hydrocarbon derivatives Monoalkylamines Organic oxides Organopnictogen compounds Aliphatic acyclic compound Alpha-amino acid Amine Amino acid Aspartic acid or derivatives Carbonyl group Carboxylic acid D-alpha-amino acid Dicarboxylic acid or derivatives Fatty acid Hydrocarbon derivative Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine D-alpha-amino acid Other amino acids aspartic acid Solid logp -3.52 ALOGPS logs 0.03 ALOGPS solubility 1.42e+02 g/l ALOGPS logp -3.5 ChemAxon pka_strongest_acidic 1.7 ChemAxon pka_strongest_basic 9.61 ChemAxon iupac (2R)-2-aminobutanedioic acid ChemAxon average_mass 133.1027 ChemAxon mono_mass 133.037507717 ChemAxon smiles N[C@H](CC(O)=O)C(O)=O ChemAxon formula C4H7NO4 ChemAxon inchi InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m1/s1 ChemAxon inchikey CKLJMWTZIZZHCS-UWTATZPHSA-N ChemAxon polar_surface_area 100.62 ChemAxon refractivity 26.53 ChemAxon polarizability 11.35 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 5 ChemAxon donor_count 3 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Aspartate Metabolism SMP00067 map00250 Specdb::CMs 7210 Specdb::CMs 39025 Specdb::CMs 146126 Specdb::NmrTwoD 1975 Specdb::MsMs 2487 Specdb::MsMs 2488 Specdb::MsMs 2489 Specdb::MsMs 252300 Specdb::MsMs 252301 Specdb::MsMs 252302 Specdb::MsMs 272241 Specdb::MsMs 272242 Specdb::MsMs 272243 Specdb::MsMs 2248952 Specdb::MsMs 2249450 Specdb::MsMs 2250996 Specdb::MsMs 2251402 Specdb::MsMs 2722254 Specdb::MsMs 2722255 Specdb::MsMs 2722256 Specdb::MsMs 2959935 Specdb::MsMs 2959936 Specdb::MsMs 2959937 Specdb::NmrOneD 2041 Specdb::NmrOneD 150240 Specdb::NmrOneD 150241 Specdb::NmrOneD 150242 Specdb::NmrOneD 150243 Specdb::NmrOneD 150244 Specdb::NmrOneD 150245 Specdb::NmrOneD 150246 Specdb::NmrOneD 150247 Specdb::NmrOneD 150248 Specdb::NmrOneD 150249 Specdb::NmrOneD 150250 Specdb::NmrOneD 150251 Specdb::NmrOneD 150252 Specdb::NmrOneD 150253 Specdb::NmrOneD 150254 Specdb::NmrOneD 150255 Specdb::NmrOneD 150256 Specdb::NmrOneD 150257 Specdb::NmrOneD 150258 Specdb::NmrOneD 150259 Specdb::NmrOneD 166368 Specdb::NmrOneD 166416 Specdb::NmrOneD 166418 Specdb::NmrOneD 166659 HMDB06483 17364 DAS #<Reference:0x000055ce31c21438> Acorn Type 1 specific Quercus 3511 0.635 0.635 0.635 mg/100 g Acorn squash Type 1 Cucurbita pepo var. turbinata 0.086 0.086 0.086 mg/100 g Adzuki bean Type 1 specific Vigna angularis 3914 0.0 0.0 0.0 mg/100 g Agar Type 1 specific Eucheuma 31444 0.0 0.0 0.0 mg/100 g Agave Type 1 specific Agave 39509 0.041 0.041 0.041 mg/100 g Alfalfa Type 1 specific Medicago sativa 3879 0.0 0.0 0.0 mg/100 g Allium Type 1 specific Allium 4678 167.5 360.0 47.0 mg/100 g Almond Type 1 specific Prunus dulcis 3755 1201.3195 2400.0 2.639 mg/100 g Amaranth Type 1 specific Amaranthus 3564 1.261 1.261 1.261 mg/100 g American butterfish Type 1 specific Peprilus triacanthus 183653 1.77 1.77 1.77 mg/100 g American lobster Type 1 specific Homarus americanus 6706 1.602 1.602 1.602 mg/100 g American shad Type 1 specific Alosa sapidissima 34773 1.734 1.734 1.734 mg/100 g Anatidae Type 1 specific Anatidae 8830 1064.251909 2200.0 1.102 mg/100 g Anchovy Type 1 specific Engraulidae 43062 651.042 1300.0 2.084 mg/100 g Anguilliformes Type 1 specific Anguilliformes 7933 1167.296333 1900.0 1.889 mg/100 g Apple Type 1 specific Malus pumila 283210 107.012333 300.0 0.074 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 220.0785 580.0 0.314 mg/100 g Arabica coffee Type 1 specific Coffea arabica 13443 79.0 460.0 0.0 mg/100 g Asian pear Type 1 specific Pyrus pyrifolia 3767 0.098 0.098 0.098 mg/100 g Asparagus Type 1 specific Asparagus officinalis 4686 144.1016 220.0 0.508 mg/100 g Atlantic cod Type 1 specific Gadus morhua 8049 1.823 1.823 1.823 mg/100 g Atlantic croaker Type 1 specific Micropogonias undulatus 29154 1.821 1.821 1.821 mg/100 g Atlantic halibut Type 1 specific Hippoglossus hippoglossus 8267 1400.932 2100.0 2.796 mg/100 g Atlantic herring Type 1 specific Clupea harengus harengus 7950 1.839 1.839 1.839 mg/100 g Atlantic pollock Type 1 specific Pollachius pollachius 185739 1.905 1.905 1.905 mg/100 g Atlantic salmon Type 1 specific Salmo salar 8030 2.032 2.032 2.032 mg/100 g Atlantic wolffish Type 1 specific Anarhichas lupus 8204 800.896 1600.0 1.792 mg/100 g Avocado Type 1 specific Persea americana 3435 215.118 430.0 0.236 mg/100 g Baby food Type 2 specific 0.0 0.0 0.0 mg/100 g Bamboo shoots Type 1 specific Phyllostachys edulis 38705 0.10625 0.425 0.0 mg/100 g Banana Type 1 specific Musa acuminata 4641 0.124 0.124 0.124 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 360.206333 540.0 0.619 mg/100 g Beech nut Type 1 specific Fagus 21024 1.071 1.071 1.071 mg/100 g Beefalo Type 1 specific Bos taurus X Bison bison 297284 Beer Type 2 specific 11.690727 22.0 0.016 mg/100 g Bilberry Type 1 specific Vaccinium myrtillus 180763 0.0 0.0 0.0 mg/100 g Biscuit Type 2 specific 283.333333 360.0 210.0 mg/100 g Bison Type 1 specific Bison bison 9901 1.824 1.824 1.824 mg/100 g Black salsify Type 1 specific Scorzonera hispanica 114289 0.0 0.0 0.0 mg/100 g Black tea Type 1 0.0 0.0 0.0 mg/100 g Black walnut Type 1 specific Juglans nigra 16719 801.2165 1600.0 2.433 mg/100 g Black-eyed pea Type 1 specific Vigna unguiculata ssp. unguiculata 3920 2.84 2.84 2.84 mg/100 g Blackcurrant Type 1 specific Ribes nigrum 78511 0.0 0.0 0.0 mg/100 g Blue cheese Type 2 1.436 1.436 1.436 mg/100 g Blue crab Type 1 specific Callinectes sapidus 6763 1.866 1.866 1.866 mg/100 g Blue mussel Type 1 specific Mytilus edulis 6550 1.148 1.148 1.148 mg/100 g Blue whiting Type 1 specific Micromesistius poutassou 81636 0.0 0.0 0.0 mg/100 g Bluefish Type 1 specific Pomatomus saltatrix 75034 2.052 2.052 2.052 mg/100 g Brazil nut Type 1 specific Bertholletia excelsa 3645 1300.0 1300.0 1300.0 mg/100 g Breadnut tree seed Type 1 specific Brosimum alicastrum 194253 0.659 0.659 0.659 mg/100 g Breakfast cereal Type 2 specific 333.333333 1300.0 0.0 mg/100 g Broccoli Type 1 specific Brassica oleracea var. italica 36774 0.018875 0.0755 0.0 mg/100 g Brussel sprouts Type 1 specific Brassica oleracea var. gemmifera 178616 397.5 450.0 310.0 mg/100 g Buffalo Type 1 specific Bubalus bubalis 89462 2.034 2.034 2.034 mg/100 g Bulgur Type 2 specific 0.63 0.63 0.63 mg/100 g Burbot Type 1 specific Lota lota 69944 0.989 1.978 0.0 mg/100 g Burdock Type 1 specific Arctium lappa 4217 0.177 0.177 0.177 mg/100 g Butter Type 2 specific 27.354667 41.0 0.064 mg/100 g Buttermilk Type 2 specific 176.758333 270.0 0.275 mg/100 g Butternut Type 1 specific Juglans cinerea 91214 3.096 3.096 3.096 mg/100 g Butternut squash Type 1 specific Cucurbita moschata 3662 0.107 0.107 0.107 mg/100 g Cabbage Type 1 specific Brassica oleracea var. capitata 3716 0.122 0.122 0.122 mg/100 g Cantaloupe melon Type 1 Cucumis melo var. cantalupensis 0.014 0.014 0.014 mg/100 g Carp bream Type 1 specific Abramis brama 38527 0.913 1.826 0.0 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 112.431143 170.0 0.018 mg/100 g Casein Type 2 specific 10100.0 10100.0 10100.0 mg/100 g Cashew nut Type 1 specific Anacardium occidentale 171929 1600.0 1700.0 1500.0 mg/100 g Cassava Type 1 specific Manihot esculenta 3983 39.0395 78.0 0.079 mg/100 g Catfish Type 1 specific Siluriformes 7995 800.8385 1600.0 1.677 mg/100 g Catjang pea Type 1 specific Vigna unguiculata ssp. cylindrica 3840 2.881 2.881 2.881 mg/100 g Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 1496.021277 2000.0 0.0 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 140.0295 250.0 0.0 mg/100 g Celeriac Type 1 specific Apium graveolens var. rapaceum 278110 220.0 220.0 220.0 mg/100 g Celery leaves Type 1 specific Apium graveolens var. secalinum 941588 220.0 220.0 220.0 mg/100 g Celery stalks Type 1 specific Apium graveolens var. dulce 117781 0.117 0.117 0.117 mg/100 g Cetacea (Dolphin, Porpoise, Whale) Type 1 specific Cetacea 9721 0.0 0.0 0.0 mg/100 g Channel catfish Type 1 specific Ictalurus punctatus 7998 1.677 1.677 1.677 mg/100 g Chanterelle Type 1 specific Cantharellus cibarius 36066 0.0 0.0 0.0 mg/100 g Charr Type 1 specific Salvelinus 8033 0.0 0.0 0.0 mg/100 g Chayote Type 1 specific Sechium edule 184140 46.046 92.0 0.092 mg/100 g Cheese Type 2 specific 1584.666667 2700.0 280.0 mg/100 g Cherimoya Type 1 specific Annona cherimola 49314 0.0525 0.105 0.0 mg/100 g Chervil Type 1 specific Anthriscus cerefolium 40888 290.0 380.0 200.0 mg/100 g Chestnut Type 1 specific Castanea 21019 175.426 350.0 0.852 mg/100 g Chewing gum Type 2 specific 0.0 0.0 0.0 mg/100 g Chia Type 1 specific Salvia hispanica 49212 1.689 1.689 1.689 mg/100 g Chicken Type 1 specific Gallus gallus 9031 1707.142857 2500.0 0.0 mg/100 g Chickpea Type 1 specific Cicer arietinum 3827 1201.211 2400.0 2.422 mg/100 g Chicory Type 1 specific Cichorium intybus 13427 75.0 150.0 0.0 mg/100 g Chinese cabbage Type 1 specific Brassica rapa 3711 45.054 90.0 0.108 mg/100 g Chinese chestnut Type 1 specific Castanea mollissima 60419 0.852 0.852 0.852 mg/100 g Chinese chives Type 1 specific Allium tuberosum 4683 0.303 0.303 0.303 mg/100 g Chinook salmon Type 1 specific Oncorhynchus tshawytscha 74940 2.054 2.054 2.054 mg/100 g Chives Type 1 specific Allium schoenoprasum 74900 100.1515 200.0 0.303 mg/100 g Chocolate Type 2 specific 418.0 700.0 0.0 mg/100 g Chocolate spread Type 2 specific 0.0 0.0 0.0 mg/100 g Chum salmon Type 1 specific Oncorhynchus keta 8018 2.062 2.062 2.062 mg/100 g Cichlidae (Tilapia) Type 1 specific Cichlidae 8113 2.297 2.297 2.297 mg/100 g Cinnamon Type 1 specific Cinnamomum 13428 0.219 0.438 0.0 mg/100 g Cisco Type 1 specific Coregonus artedi 36181 1.944 1.944 1.944 mg/100 g Clam Type 1 1.608 1.608 1.608 mg/100 g Clawed lobster Type 1 specific Nephropidae 6704 1525.4005 2100.0 1.602 mg/100 g Cloves Type 1 specific Syzygium aromaticum 219868 0.6 0.6 0.6 mg/100 g Clupeinae (Herring, Sardine, Sprat) Type 1 specific Clupeinae 7948 1000.0 2200.0 0.0 mg/100 g Cocoa butter Type 2 specific 0.0 0.0 0.0 mg/100 g Cocoa powder Type 2 specific 1226.666667 1700.0 480.0 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 224.065 660.0 0.0 mg/100 g Coffee Type 1 generic Coffea 13442 79.0 460.0 0.0 mg/100 g Coho salmon Type 1 specific Oncorhynchus kisutch 8019 2.214 2.214 2.214 mg/100 g Cold cut Type 2 specific 900.0 1900.0 0.0 mg/100 g Colorado pinyon Type 1 specific Pinus edulis 3340 1.054 1.054 1.054 mg/100 g Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 640.966 1700.0 1.459 mg/100 g Common bean Type 1 specific Phaseolus vulgaris 3885 618.75 2600.0 200.0 mg/100 g Common beet Type 1 specific Beta vulgaris 161934 0.116 0.116 0.116 mg/100 g Common buckwheat Type 1 specific Fagopyrum esculentum 3617 744.2266 1700.0 0.0 mg/100 g Common cabbage Type 1 specific Brassica oleracea 3712 109.65475 350.0 0.119 mg/100 g Common carp Type 1 specific Cyprinus carpio 7962 1.826 1.826 1.826 mg/100 g Common dab Type 1 specific Limanda limanda 27771 0.0 0.0 0.0 mg/100 g Common hazelnut Type 1 specific Corylus avellana 13451 1.679 1.679 1.679 mg/100 g Common ling Type 1 specific Molva molva 163112 0.972 1.944 0.0 mg/100 g Common mushroom Type 1 specific Agaricus bisporus 5341 150.0 160.0 140.0 mg/100 g Common octopus Type 1 specific Octopus vulgaris 6645 0.719 1.438 0.0 mg/100 g Common oregano Type 1 specific Origanum vulgare 39352 1.009 1.009 1.009 mg/100 g Common pea Type 1 specific Pisum sativum 3888 790.0 2500.0 0.0 mg/100 g Common persimmon Type 1 specific Diospyros virginiana 13493 0.079 0.079 0.079 mg/100 g Common walnut Type 1 specific Juglans regia 51240 1.829 1.829 1.829 mg/100 g Coriander Type 1 specific Coriandrum sativum 4047 0.0 0.0 0.0 mg/100 g Corn Type 1 specific Zea mays 4577 233.0655 620.0 0.0 mg/100 g Cottonseed Type 1 specific Gossypium 3633 1.7735 3.547 0.0 mg/100 g Cottonseed oil Type 2 0.0 0.0 0.0 mg/100 g Crab Type 1 specific Brachyura 6752 1200.944833 2500.0 1.866 mg/100 g Cracker Type 2 specific 420.0 420.0 420.0 mg/100 g Crayfish Type 1 specific Astacidea 6712 1.060333 1.648 0.0 mg/100 g Cream Type 2 specific 153.909385 290.0 0.165 mg/100 g Crisp bread Type 2 specific 792.0 1000.0 530.0 mg/100 g Cucumber Type 1 specific Cucumis sativus 3659 5.720143 40.0 0.0 mg/100 g Cucurbita Type 1 specific Cucurbita 3660 126.75 160.0 77.0 mg/100 g Curry powder Type 2 specific 0.0 0.0 0.0 mg/100 g Cusk Type 1 specific Brosme brosme 81638 1.945 1.945 1.945 mg/100 g Cuttlefish Type 1 specific Sepiidae 6608 1.567 1.567 1.567 mg/100 g Daikon radish Type 1 specific Raphanus sativus var. longipinnatus 41679 19.354667 58.0 0.0 mg/100 g Dandelion Type 1 specific Taraxacum officinale 50225 0.0 0.0 0.0 mg/100 g Date Type 1 specific Phoenix dactylifera 42345 60.11 120.0 0.22 mg/100 g Deer Type 1 specific Cervidae 9850 2.13 2.13 2.13 mg/100 g Dill Type 1 specific Anethum graveolens 40922 0.114333 0.343 0.0 mg/100 g Dock Type 1 specific Rumex 3618 0.181 0.181 0.181 mg/100 g Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 1544.45679 3300.0 0.0 mg/100 g Dragée Type 2 specific 0.0 0.0 0.0 mg/100 g Dried milk Type 2 specific 2600.0 2900.0 2300.0 mg/100 g Dumpling Type 2 specific 0.0 0.0 0.0 mg/100 g Dungeness crab Type 1 specific Cancer magister 29965 1.799 1.799 1.799 mg/100 g Eastern oyster Type 1 specific Crassostrea virginica 6565 0.491 0.491 0.491 mg/100 g Egg substitute Type 2 specific 0.928 0.928 0.928 mg/100 g Egg yolk Type 1 0.1 0.1 0.1 mg/100 g Eggplant Type 1 specific Solanum melongena 4111 50.054667 150.0 0.0 mg/100 g Eggs Unknown generic 2010.009643 8300.0 0.135 mg/100 g Elderberry Type 1 specific Sambucus 4201 48.666667 58.0 44.0 mg/100 g Elk Type 1 specific Cervus canadensis 1574408 1.826 1.826 1.826 mg/100 g Emu Type 1 specific Dromaius novaehollandiae 8790 1.981 1.981 1.981 mg/100 g Endive Type 1 specific Cichorium endivia 114280 86.71 130.0 0.13 mg/100 g European anchovy Type 1 specific Engraulis encrasicolus 184585 2.084 2.084 2.084 mg/100 g European chestnut Type 1 specific Castanea sativa 21020 0.281 0.281 0.281 mg/100 g European plum Type 1 specific Prunus domestica 3758 547.5 1000.0 95.0 mg/100 g European rabbit Type 1 specific Oryctolagus 9984 2.129 2.129 2.129 mg/100 g Feijoa Type 1 specific Feijoa sellowiana 260130 0.075 0.075 0.075 mg/100 g Fennel Type 1 specific Foeniculum vulgare 48038 900.0 1800.0 0.0 mg/100 g Fenugreek Type 1 specific Trigonella foenum-graecum 78534 2.708 2.708 2.708 mg/100 g Fig Type 1 specific Ficus carica 3494 342.56025 790.0 0.241 mg/100 g Fish oil Type 1 0.0 0.0 0.0 mg/100 g Flatfish Type 1 specific Pleuronectiformes 8252 900.691 1800.0 1.382 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 934.015333 2800.0 0.0 mg/100 g Florida pompano Type 1 specific Trachinotus carolinus 173342 1.892 1.892 1.892 mg/100 g French plantain Type 1 specific Musa X paradisiaca 89151 110.0 110.0 110.0 mg/100 g Freshwater drum Type 1 specific Aplodinotus grunniens 225389 1.796 1.796 1.796 mg/100 g Freshwater eel Type 1 specific Anguilla 7935 1.889 1.889 1.889 mg/100 g Fruit gum Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit juice Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit preserve Type 2 specific 0.0 0.0 0.0 mg/100 g Gadiformes Type 1 specific Gadiformes 8043 1.116 1.823 0.0 mg/100 g Gadus (Common cod) Type 1 specific Gadus 8048 798.121533 2600.0 0.0 mg/100 g Garden cress Type 1 specific Lepidium sativum 33125 250.0 250.0 250.0 mg/100 g Garden onion Type 1 specific Allium cepa 4679 0.091 0.091 0.091 mg/100 g Garden onion (var.) Type 1 specific Allium cepa var. cepa 4679 0.091 0.091 0.091 mg/100 g Garden rhubarb Type 1 specific Rheum rhabarbarum 3621 46.0 46.0 46.0 mg/100 g Garden tomato Type 1 specific Solanum lycopersicum 4081 456.125 2000.0 80.0 mg/100 g Garfish Type 1 specific Belone belone 129037 2000.0 2000.0 2000.0 mg/100 g Garlic Type 1 specific Allium sativum 4682 596.829667 1300.0 0.489 mg/100 g Gelatin Type 2 specific 5100.0 5100.0 5100.0 mg/100 g Gelatin dessert Type 2 specific 0.0 0.0 0.0 mg/100 g Ginger Type 1 specific Zingiber officinale 94328 105.104 210.0 0.208 mg/100 g Ginkgo nuts Type 1 specific Ginkgo biloba 3311 0.543 0.543 0.543 mg/100 g Globe artichoke Type 1 specific Cynara scolymus 59895 0.0 0.0 0.0 mg/100 g Goji Type 1 1.711 1.711 1.711 mg/100 g Gooseberry Type 1 specific Ribes uva-crispa 135518 0.0 0.0 0.0 mg/100 g Grape Type 1 specific Vitis 3603 33.8525 120.0 0.0 mg/100 g Grape wine Type 2 specific 0.0 0.0 0.0 mg/100 g Grapefruit Type 1 specific Citrus X paradisi 37656 79.703667 180.0 0.111 mg/100 g Grapefruit/Pummelo hybrid Type 1 specific Citrus paradisi X Citrus maxima 37656 0.138 0.138 0.138 mg/100 g Grapeseed oil Type 2 0.0 0.0 0.0 mg/100 g Greater sturgeon Type 1 specific Acipenser 7901 1.653 1.653 1.653 mg/100 g Greek feta cheese Type 2 0.779 0.779 0.779 mg/100 g Green lentil Type 1 Lens culinaris 2.725 2.725 2.725 mg/100 g Green plum Type 1 0.352 0.352 0.352 mg/100 g Green tea Type 1 0.0 0.0 0.0 mg/100 g Green zucchini Type 1 specific Cucurbita pepo var. cylindrica 0.332 0.332 0.332 mg/100 g Greenland halibut/turbot Type 1 specific Reinhardtius hippoglossoides 111784 325.36775 1300.0 0.0 mg/100 g Greylag goose Type 1 specific Anser anser 8843 Groundcherry Type 1 specific Physalis 24663 0.0 0.0 0.0 mg/100 g Grouper Type 1 specific Epinephelus 94231 1.984 1.984 1.984 mg/100 g Guava Type 1 specific Psidium guajava 120290 29.081 58.0 0.162 mg/100 g Guinea hen Type 1 specific Numida meleagris 8996 1.84 1.84 1.84 mg/100 g Haddock Type 1 specific Melanogrammus aeglefinus 8056 1533.333333 2600.0 0.0 mg/100 g Hard wheat Type 1 specific Triticum durum 4567 0.0 0.0 0.0 mg/100 g Hazelnut Type 1 specific Corylus 13450 900.8395 1800.0 1.679 mg/100 g Herbal tea Type 1 0.0 0.0 0.0 mg/100 g Hickory nut Type 1 specific Carya 13402 1.368 1.368 1.368 mg/100 g Hippoglossus (Common halibut) Type 1 specific Hippoglossus 8266 2.131 2.131 2.131 mg/100 g Honey Type 2 specific 0.027 0.027 0.027 mg/100 g Horse Type 1 specific Equus caballus 9796 2.104 2.104 2.104 mg/100 g Horseradish Type 1 specific Armoracia rusticana 3704 212.5 370.0 55.0 mg/100 g Hot chocolate Type 2 specific 292.5 300.0 290.0 mg/100 g Hyacinth bean Type 1 specific Lablab purpureus 35936 2.821 2.821 2.821 mg/100 g Ice cream Type 2 specific 132.0 330.0 0.0 mg/100 g Iceberg lettuce Type 1 0.125 0.125 0.125 mg/100 g Italian oregano Type 1 specific Origanum X majoricum 1384207 1.009 1.009 1.009 mg/100 g Jackfruit Type 1 specific Artocarpus heterophyllus 3489 0.172 0.172 0.172 mg/100 g Japanese chestnut Type 1 specific Castanea crenata 103480 0.474 0.474 0.474 mg/100 g Japanese persimmon Type 1 specific Diospyros kaki 35925 0.057 0.057 0.057 mg/100 g Japanese sea bass Type 1 Lateolabrax japonicus 1.887 1.887 1.887 mg/100 g Jerusalem artichoke Type 1 specific Helianthus tuberosus 4233 0.0 0.0 0.0 mg/100 g Jicama Type 1 specific Pachyrhizus erosus 109171 0.2 0.2 0.2 mg/100 g Jute Type 1 specific Corchorus olitorius 93759 0.567 0.567 0.567 mg/100 g Kale Type 1 specific Brassica napus var. pabularia 200.0 200.0 200.0 mg/100 g Kefir Type 2 specific 280.0 280.0 280.0 mg/100 g Kelp Type 1 specific Laminaria 33637 0.125 0.125 0.125 mg/100 g Ketchup Type 2 specific 185.0 370.0 0.0 mg/100 g King mackerel Type 1 specific Scomberomorus cavalla 13679 2.077 2.077 2.077 mg/100 g Kiwi Type 1 specific Actinidia chinensis 3625 55.00675 110.0 0.0135 mg/100 g Kohlrabi Type 1 specific Brassica oleracea var. gongylodes 109379 0.0 0.0 0.0 mg/100 g Kombu Type 1 specific Saccharina japonica 88149 0.0 0.0 0.0 mg/100 g Kumquat Type 1 specific Fortunella 2706 0.0 0.0 0.0 mg/100 g Lake trout Type 1 specific Salvelinus namaycush 8040 0.0 0.0 0.0 mg/100 g Lambsquarters Type 1 specific Chenopodium album 3559 0.431 0.431 0.431 mg/100 g Lard Type 2 specific 0.0 0.0 0.0 mg/100 g Leavening agent Type 2 specific 1732.5 3500.0 0.0 mg/100 g Leek Type 1 specific Allium porrum 80.07 160.0 0.14 mg/100 g Lemon Type 1 specific Citrus limon 2708 23.0 69.0 0.0 mg/100 g Lemon sole Type 1 specific Microstomus kitt 106175 1233.794 1900.0 1.382 mg/100 g Lentils Type 1 generic Lens culinaris 3864 880.545 3000.0 0.0 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 108.0022 140.0 0.011 mg/100 g Lichee Type 1 specific Litchi chinensis 151069 0.0 0.0 0.0 mg/100 g Lima bean Type 1 specific Phaseolus lunatus 3884 0.735 0.735 0.735 mg/100 g Lime Type 1 specific Citrus aurantiifolia 159033 0.0 0.0 0.0 mg/100 g Lingcod Type 1 specific Ophiodon elongatus 225387 1.808 1.808 1.808 mg/100 g Lingonberry Type 1 specific Vaccinium vitis-idaea 180772 0.0 0.0 0.0 mg/100 g Liquor Type 2 specific 27.5 220.0 0.0 mg/100 g Liquorice Type 2 specific 0.0 0.0 0.0 mg/100 g Loganberry Type 1 specific Rubus loganobaccus 0.0 0.0 0.0 mg/100 g Longan Type 1 specific Dimocarpus longan 128017 0.126 0.126 0.126 mg/100 g Loquat Type 1 specific Eriobotrya japonica 32224 29.029 58.0 0.058 mg/100 g Lotus Type 1 specific Nelumbo 4430 0.369 0.369 0.369 mg/100 g Lumpsucker Type 1 specific Cyclopteridae 8101 0.0 0.0 0.0 mg/100 g Lupine Type 1 specific Lupinus 3869 3.877 3.877 3.877 mg/100 g Macadamia nut Type 1 specific Macadamia 4329 1.099 1.099 1.099 mg/100 g Macadamia nut (M. tetraphylla) Type 1 specific Macadamia tetraphylla 512563 1.099 1.099 1.099 mg/100 g Maitake Type 1 specific Grifola frondosa 5627 0.205 0.205 0.205 mg/100 g Mallard duck Type 1 specific Anas platyrhynchos 8839 Malus (Crab apple) Type 1 specific Malus 3749 70.0 70.0 70.0 mg/100 g Mamey sapote Type 1 specific Pouteria sapota 233744 0.147 0.147 0.147 mg/100 g Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 67.043 140.0 0.129 mg/100 g Mango Type 1 specific Mangifera indica 29780 20.534 41.0 0.068 mg/100 g Margarine Type 2 specific 42.0 58.0 0.0 mg/100 g Margarine-like spread Type 2 specific 30.0 30.0 30.0 mg/100 g Marine mussel Type 1 specific Mytilidae 6547 1475.287 2700.0 1.148 mg/100 g Marshmallow Type 2 specific 0.0 0.0 0.0 mg/100 g Marzipan Type 2 specific 650.0 1300.0 0.0 mg/100 g Meat bouillon Type 2 specific 654.0 2400.0 0.0 mg/100 g Meatball Type 2 specific 0.0 0.0 0.0 mg/100 g Meringue Type 2 specific 0.0 0.0 0.0 mg/100 g Mexican oregano Type 1 specific Lippia graveolens 1.009 1.009 1.009 mg/100 g Milk (Cow) Type 2 specific 14411.52381 293000.0 0.0 mg/100 g Milk (Human) Type 2 specific 0.0 0.0 0.0 mg/100 g Milk (Other mammals) Type 2 specific 210.0 210.0 210.0 mg/100 g Milkfish Type 1 specific Chanos chanos 29144 2.102 2.102 2.102 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 240.242 720.0 0.0 mg/100 g Miso Type 2 specific 0.0 0.0 0.0 mg/100 g Monkfish Type 1 specific Lophius piscatorius 8074 1.483 1.483 1.483 mg/100 g Mountain hare Type 1 specific Lepus timidus 62621 0.0 0.0 0.0 mg/100 g Mountain yam Type 1 specific Dioscorea pentaphylla 167592 0.136 0.136 0.136 mg/100 g Mule deer Type 1 specific Odocoileus 9871 Mung bean Type 1 specific Vigna radiata 157791 1060.918667 2700.0 2.756 mg/100 g Muskmelon Type 1 specific Cucumis melo 3656 56.25 130.0 0.0 mg/100 g Mustard Type 2 specific 265.0 530.0 0.0 mg/100 g Nectarine Type 1 specific Prunus persica var. nucipersica 323851 280.03125 560.0 0.0625 mg/100 g Nopal Type 1 specific Opuntia cochenillifera 338184 0.086 0.086 0.086 mg/100 g Northern bluefin tuna Type 1 specific Thunnus thynnus 8237 2.388 2.388 2.388 mg/100 g Northern pike Type 1 specific Esox lucius 8010 0.986 1.972 0.0 mg/100 g Norway haddock Type 1 specific Sebastes viviparus 394708 0.0 0.0 0.0 mg/100 g Norway lobster Type 1 specific Nephrops norvegicus 6829 2100.0 2100.0 2100.0 mg/100 g Norway pout Type 1 specific Trisopterus esmarkii 80723 0.852 1.704 0.0 mg/100 g Nutmeg Type 1 specific Myristica fragrans 51089 0.0 0.0 0.0 mg/100 g Oat Type 1 specific Avena sativa 4498 720.3152 1200.0 0.0 mg/100 g Ocean pout Type 1 specific Zoarces americanus 8199 1.704 1.704 1.704 mg/100 g Oil palm Type 1 specific Elaeis 51952 0.0 0.0 0.0 mg/100 g Okra Type 1 specific Abelmoschus esculentus 455045 70.0725 140.0 0.145 mg/100 g Olive Type 1 specific Olea europaea 4146 0.0 0.0 0.0 mg/100 g Orange roughy Type 1 specific Hoplostethus atlanticus 96778 1.845 1.845 1.845 mg/100 g Oriental wheat Type 1 specific Triticum turanicum 376534 0.802 0.802 0.802 mg/100 g Ostrich Type 1 specific Struthio camelus 8801 2.001 2.057 1.891 mg/100 g Other alcoholic beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Other animal fat Type 2 specific 220.0 440.0 0.0 mg/100 g Other bread Type 2 specific 43.333333 390.0 0.0 mg/100 g Other bread product Type 2 specific 260.0 520.0 0.0 mg/100 g Other candy Type 2 specific 0.0 0.0 0.0 mg/100 g Other dish Type 2 specific 813.333333 920.0 710.0 mg/100 g Other fermented milk Type 2 specific 290.0 300.0 280.0 mg/100 g Other fish product Type 2 specific 0.0 0.0 0.0 mg/100 g Other frozen dessert Type 2 specific 0.0 0.0 0.0 mg/100 g Other fruit product Type 2 specific 520.0 520.0 520.0 mg/100 g Other snack food Type 2 specific 0.0 0.0 0.0 mg/100 g Oyster mushroom Type 1 specific Pleurotus ostreatus 5322 425.1475 850.0 0.295 mg/100 g Pacific cod Type 1 specific Gadus macrocephalus 80720 1.525 1.525 1.525 mg/100 g Pacific halibut Type 1 specific Hippoglossus stenolepis 195615 2.131 2.131 2.131 mg/100 g Pacific herring Type 1 specific Clupea pallasii 30724 1.679 1.679 1.679 mg/100 g Pacific jack mackerel Type 1 specific Trachurus symmetricus 271940 2.055 2.055 2.055 mg/100 g Pacific ocean perch Type 1 specific Sebastes alutus 72055 0.779 1.558 0.0 mg/100 g Pacific oyster Type 1 specific Crassostrea gigas 29159 0.912 0.912 0.912 mg/100 g Pacific rockfish Type 1 specific Sebastes 34820 1.921 1.921 1.921 mg/100 g Pak choy Type 1 specific Brassica rapa var. chinensis 93385 55.054 110.0 0.108 mg/100 g Papaya Type 1 specific Carica papaya 3649 28.0245 56.0 0.049 mg/100 g Parsley Type 1 specific Petroselinum crispum 4043 213.431333 370.0 0.294 mg/100 g Parsnip Type 1 specific Pastinaca sativa 4041 230.0 230.0 230.0 mg/100 g Passion fruit Type 1 specific Passiflora edulis 78168 0.0 0.0 0.0 mg/100 g Pasta Type 2 specific 480.0 620.0 240.0 mg/100 g Pastry Type 2 specific 147.272727 400.0 0.0 mg/100 g Pate Type 2 specific 0.0 0.0 0.0 mg/100 g Pea shoots Type 1 0.496 0.496 0.496 mg/100 g Peach Type 1 specific Prunus persica 3760 178.511375 540.0 0.0455 mg/100 g Peach (var.) Type 1 specific Prunus persica var. persica 323852 0.0455 0.0455 0.0455 mg/100 g Peanut Type 1 specific Arachis hypogaea 3818 2080.6292 3700.0 0.0 mg/100 g Peanut oil Type 2 0.0 0.0 0.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 38.667 60.0 0.001 mg/100 g Pecan nut Type 1 specific Carya illinoinensis 32201 710.23225 970.0 0.929 mg/100 g Pepper Type 1 specific Capsicum annuum 4072 135.714286 290.0 0.0 mg/100 g Pepper (Spice) Type 1 specific Piper nigrum 13216 0.7065 1.413 0.0 mg/100 g Peppermint Type 1 specific Mentha X piperita 34256 0.443 0.443 0.443 mg/100 g Perciformes Type 1 specific Perciformes 8111 0.0 0.0 0.0 mg/100 g Percoidei (Bass and others) Type 1 specific Percoidei 8112 1.816 1.816 1.816 mg/100 g Persimmon Type 1 specific Diospyros 13492 34.0395 68.0 0.079 mg/100 g Pheasant Type 1 specific Phasianus colchicus 9054 2.324 2.363 2.285 mg/100 g Pigeon pea Type 1 specific Cajanus cajan 3821 2.146 2.146 2.146 mg/100 g Pikeperch Type 1 specific Sander lucioperca 283035 0.0 0.0 0.0 mg/100 g Pili nut Type 1 specific Canarium ovatum 43691 1.222 1.222 1.222 mg/100 g Pine nut Type 1 specific Pinus 3337 650.6515 1300.0 1.303 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 15.6242 78.0 0.0 mg/100 g Pink salmon Type 1 specific Oncorhynchus gorbuscha 8017 2.575 2.575 2.575 mg/100 g Pistachio Type 1 specific Pistacia vera 55513 690.628 1800.0 1.884 mg/100 g Pizza Type 2 specific 0.0 0.0 0.0 mg/100 g Pleuronectidae (Dab, Halibut, Plaice) Type 1 specific Pleuronectidae 8256 600.0 1800.0 0.0 mg/100 g Pollock Type 1 specific Pollachius 8059 0.3275 1.31 0.0 mg/100 g Pomegranate Type 1 specific Punica granatum 22663 0.0 0.0 0.0 mg/100 g Poppy Type 1 specific Papaver 3468 2200.0 2200.0 2200.0 mg/100 g Potato Type 1 specific Solanum tuberosum 4113 845.2 2300.0 0.0 mg/100 g Prickly pear Type 1 specific Opuntia 106975 0.0 0.0 0.0 mg/100 g Prunus (Cherry, Plum) Type 1 specific Prunus 3754 452.5 740.0 270.0 mg/100 g Pumpkinseed sunfish Type 1 specific Lepomis gibbosus 270329 1.987 1.987 1.987 mg/100 g Purple laver Type 1 specific Porphyra laciniata 0.567 0.567 0.567 mg/100 g Quail Type 1 specific Phasianidae 9005 1.814 1.814 1.814 mg/100 g Quince Type 1 specific Cydonia oblonga 36610 0.0 0.0 0.0 mg/100 g Quinoa Type 1 specific Chenopodium quinoa 63459 1.134 1.134 1.134 mg/100 g Rabbit Type 1 specific Leporidae 9979 1101.0645 2200.0 2.129 mg/100 g Radish Type 1 specific Raphanus sativus 3726 0.064 0.064 0.064 mg/100 g Rainbow smelt Type 1 specific Osmerus mordax 8014 1.805 1.805 1.805 mg/100 g Rainbow trout Type 1 specific Oncorhynchus mykiss 8022 0.699 2.097 0.0 mg/100 g Rape Type 1 specific Brassica napus var. napus 138011 0.0 0.0 0.0 mg/100 g Rapeseed oil Type 2 0.0 0.0 0.0 mg/100 g Red beetroot Type 1 specific Beta vulgaris var. rubra 61.333333 86.0 47.0 mg/100 g Red king crab Type 1 specific Paralithodes camtschaticus 6741 1.891 1.891 1.891 mg/100 g Red rice Type 1 specific Oryza rufipogon 4529 0.743 0.743 0.743 mg/100 g Red tea Type 1 0.0 0.0 0.0 mg/100 g Redcurrant Type 1 specific Ribes rubrum 175228 0.0 0.0 0.0 mg/100 g Remoulade Type 2 specific 0.0 0.0 0.0 mg/100 g Rice Type 1 specific Oryza sativa 4530 597.625 1200.0 0.0 mg/100 g Robusta coffee Type 1 specific Coffea canephora 49390 79.0 460.0 0.0 mg/100 g Rock ptarmigan Type 1 specific Lagopus muta 64668 0.0 0.0 0.0 mg/100 g Roe Type 2 generic 1.789 1.789 1.789 mg/100 g Rose hip Type 1 specific Rosa 3764 0.0 0.0 0.0 mg/100 g Rosemary Type 1 specific Rosmarinus officinalis 39367 0.391 0.391 0.391 mg/100 g Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 0.0 0.0 0.0 mg/100 g Rye Type 1 specific Secale cereale 4550 313.426667 670.0 0.0 mg/100 g Rye bread Type 2 specific 94.117647 460.0 0.0 mg/100 g Sablefish Type 1 specific Anoplopoma fimbria 229290 1.373 1.373 1.373 mg/100 g Safflower Type 1 specific Carthamus tinctorius 4222 0.0 0.0 0.0 mg/100 g Salad dressing Type 2 specific 43.083333 320.0 0.0 mg/100 g Salmonidae (Salmon, Trout) Type 1 specific Salmonidae 8015 1600.0 2100.0 0.0 mg/100 g Salt Type 2 specific 0.0 0.0 0.0 mg/100 g Salted butter Type 1 0.064 0.064 0.064 mg/100 g Sapodilla Type 1 specific Manilkara zapota 3741 0.032 0.032 0.032 mg/100 g Sauce Type 2 specific 0.0 0.0 0.0 mg/100 g Sausage Type 2 specific 965.882353 1800.0 0.0 mg/100 g Savoy cabbage Type 1 specific Brassica oleracea var. sabauda 1216010 100.0985 200.0 0.197 mg/100 g Scallop Type 1 specific Pectinidae 6566 0.147 0.147 0.147 mg/100 g Scombridae (Bonito, Mackerel, Tuna) Type 1 specific Scombridae 8224 1650.0 1800.0 1300.0 mg/100 g Scup Type 1 specific Stenotomus chrysops 35579 1.933 1.933 1.933 mg/100 g Sea trout Type 1 specific Salmo trutta forma trutta 13028 1.715 1.715 1.715 mg/100 g Semolina Type 2 specific 400.0 400.0 400.0 mg/100 g Sesame Type 1 specific Sesamum orientale 4182 975.4115 2000.0 0.0 mg/100 g Sesame oil Type 2 0.0 0.0 0.0 mg/100 g Shallot Type 1 specific Allium ascalonicum 1476995 0.231 0.231 0.231 mg/100 g Shark Type 1 specific Squaliformes 282414 2.148 2.148 2.148 mg/100 g Sheefish Type 1 specific Stenodus leucichthys 59296 2.07 2.07 2.07 mg/100 g Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 1488.888889 1800.0 1100.0 mg/100 g Sheepshead Type 1 specific Archosargus probatocephalus 119682 2.07 2.07 2.07 mg/100 g Sherry Type 2 specific 0.0 0.0 0.0 mg/100 g Shiitake Type 1 specific Lentinus edodes 5353 0.301 0.301 0.301 mg/100 g Shrimp Type 1 specific Caridea 6694 2066.666667 2600.0 1800.0 mg/100 g Skipjack tuna Type 1 specific Katsuwonus pelamis 8226 2.253 2.253 2.253 mg/100 g Snail Type 1 specific Gastropoda 6448 0.0 0.0 0.0 mg/100 g Snapper Type 1 specific Lutjanidae 30850 2.1 2.1 2.1 mg/100 g Sockeye salmon Type 1 specific Oncorhynchus nerka 8023 2.276 2.276 2.276 mg/100 g Soft drink Type 2 specific 0.0 0.0 0.0 mg/100 g Soft-necked garlic Type 1 specific Allium sativum L. var. sativum 4682 0.489 0.489 0.489 mg/100 g Sorghum Type 1 specific Sorghum bicolor 4558 0.743 0.743 0.743 mg/100 g Sorrel Type 1 specific Rumex acetosa 41241 180.0 180.0 180.0 mg/100 g Soup Type 2 specific 130.0 130.0 130.0 mg/100 g Soy bean Type 1 specific Glycine max 3847 1443.568143 4800.0 0.0 mg/100 g Soy milk Type 2 specific 0.0 0.0 0.0 mg/100 g Soy sauce Type 2 specific 335.441 670.0 0.882 mg/100 g Soybean oil Type 2 0.0 0.0 0.0 mg/100 g Spanish mackerel Type 1 specific Scomberomorus maculatus 99344 1.975 1.975 1.975 mg/100 g Spearmint Type 1 specific Mentha spicata 29719 0.388 0.388 0.388 mg/100 g Spelt Type 1 specific Triticum spelta 58933 0.757 0.757 0.757 mg/100 g Spinach Type 1 specific Spinacia oleracea 3562 140.08 230.0 0.24 mg/100 g Spiny dogfish Type 1 specific Squalus acanthias 7797 0.0 0.0 0.0 mg/100 g Spiny lobster Type 1 specific Palinuridae 6731 2.129 2.129 2.129 mg/100 g Spirit Type 2 specific 0.0 0.0 0.0 mg/100 g Spirulina Type 1 specific Spirulina 551299 0.597 0.597 0.597 mg/100 g Spot croaker Type 1 specific Leiostomus xanthurus 59837 1.896 1.896 1.896 mg/100 g Squab Type 1 specific Columba 8931 1.459 1.459 1.459 mg/100 g Squid Type 1 specific Teuthida 551290 1.503 1.503 1.503 mg/100 g Star fruit Type 1 specific Averrhoa carambola 28974 49.049 98.0 0.098 mg/100 g Strawberry Type 1 specific Fragaria X ananassa 3747 69.75 98.0 44.0 mg/100 g Strawberry guava Type 1 specific Psidium cattleianum 375274 0.037 0.037 0.037 mg/100 g Striped bass Type 1 specific Morone saxatilis 34816 1.816 1.816 1.816 mg/100 g Striped mullet Type 1 specific Mugil cephalus 48193 1.981 1.981 1.981 mg/100 g Sturgeon Type 1 specific Acipenseridae 7900 0.551 1.653 0.0 mg/100 g Sugar Type 2 specific 0.0 0.0 0.0 mg/100 g Sugar substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Sunflower Type 1 specific Helianthus annuus 4232 0.0 0.0 0.0 mg/100 g Sunflower oil Type 2 0.0 0.0 0.0 mg/100 g Swede Type 1 specific Brassica napus 3708 0.0 0.0 0.0 mg/100 g Sweet basil Type 1 specific Ocimum basilicum 39350 0.301 0.301 0.301 mg/100 g Sweet orange Type 1 specific Citrus sinensis 2711 57.753125 110.0 0.0125 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 265.0955 410.0 0.382 mg/100 g Swiss chard Type 1 specific Beta vulgaris ssp. cicla 1527200 0.0 0.0 0.0 mg/100 g Swordfish Type 1 specific Xiphias gladius 8245 2.028 2.028 2.028 mg/100 g Syrup Type 2 specific 0.0 0.0 0.0 mg/100 g Tallow Type 2 specific 965.0 1800.0 0.0 mg/100 g Tamarind Type 1 specific Tamarindus indica 58860 0.0 0.0 0.0 mg/100 g Tapioca pearl Type 2 specific 0.011 0.011 0.011 mg/100 g Taro Type 1 specific Colocasia esculenta 4460 0.192 0.192 0.192 mg/100 g Tea Type 1 specific Camellia sinensis 4442 0.0 0.0 0.0 mg/100 g Teff Type 1 specific Eragrostis tef 110835 0.82 0.82 0.82 mg/100 g Thistle Type 1 specific Cirsium 41549 0.0 0.0 0.0 mg/100 g Thunnus Type 1 specific Thunnus 8234 2225.0 2500.0 1800.0 mg/100 g Tilefish Type 1 specific Lopholatilus chamaeleonticeps 390349 1.792 1.792 1.792 mg/100 g Toffee Type 2 specific 0.0 0.0 0.0 mg/100 g Tofu Type 2 specific 2.09425 5.298 0.0 mg/100 g Triticale Type 1 specific X Triticosecale rimpaui 0.785 0.785 0.785 mg/100 g True frog Type 1 specific Ranidae 8397 0.0 0.0 0.0 mg/100 g True seal Type 1 specific Phocidae 9709 0.0 0.0 0.0 mg/100 g True sole Type 1 specific Soleidae 30948 1.382 1.382 1.382 mg/100 g Turbot Type 1 specific Scophthalmus maximus 52904 850.822 1700.0 1.644 mg/100 g Turkey Type 1 specific Meleagris gallopavo 9103 720.362 1900.0 0.0 mg/100 g Turmeric Type 1 specific Curcuma longa 136217 1.86 1.86 1.86 mg/100 g Turnip Type 1 specific Brassica rapa var. rapa 51350 17.5315 35.0 0.063 mg/100 g Ucuhuba Type 1 specific Virola surinamensis 224910 0.0 0.0 0.0 mg/100 g Unclassified food or beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Vaccinium (Blueberry, Cranberry, Huckleberry) Type 1 specific Vaccinium 13749 111.5 190.0 33.0 mg/100 g Vegetable juice Type 2 specific 0.0 0.0 0.0 mg/100 g Velvet duck Type 1 specific Melanitta fusca 371864 Vermouth Type 2 specific 0.0 0.0 0.0 mg/100 g Vodka Type 2 specific 0.0 0.0 0.0 mg/100 g Wakame Type 1 specific Undaria pinnatifida 74381 0.179 0.179 0.179 mg/100 g Walnut Type 1 specific Juglans 16718 1.2165 2.433 0.0 mg/100 g Water Type 2 specific 0.0 0.0 0.0 mg/100 g Water spinach Type 1 Ipomoea aquatica 0.24 0.24 0.24 mg/100 g Watercress Type 1 specific Rorippa nasturtium-aquaticum 135518 70.0935 140.0 0.187 mg/100 g Watermelon Type 1 specific Citrullus lanatus 3654 25.5195 51.0 0.039 mg/100 g Welsh onion Type 1 specific Allium fistulosum 35875 0.176 0.176 0.176 mg/100 g Wheat Type 1 specific Triticum 4564 580.0 1500.0 0.0 mg/100 g Wheat bread Type 2 specific 224.736842 490.0 0.0 mg/100 g Whelk Type 1 specific Buccinidae 37796 2.563 2.563 2.563 mg/100 g Whey Type 2 specific 827.333333 1300.0 82.0 mg/100 g Whisky Type 2 specific 0.0 0.0 0.0 mg/100 g White bread Type 1 0.0 0.0 0.0 mg/100 g White sucker Type 1 specific Catostomus commersonii 7971 1.716 1.716 1.716 mg/100 g Whitefish Type 1 specific Coregonus 27772 0.9775 1.955 0.0 mg/100 g Whiting Type 1 specific Merlangius merlangus 8058 0.9375 1.875 0.0 mg/100 g Wild boar Type 1 specific Sus scrofa 9823 1.996 1.996 1.996 mg/100 g Wild carrot Type 1 specific Daucus carota 4039 0.018 0.018 0.018 mg/100 g Wild celery Type 1 specific Apium graveolens 4045 65.0585 130.0 0.117 mg/100 g Wild leek Type 1 specific Allium ampeloprasum 4681 0.14 0.14 0.14 mg/100 g Wild rice Type 1 specific Zizania 15949 1.419 1.419 1.419 mg/100 g Winged bean Type 1 specific Psophocarpus tetragonolobus 3891 3.187 3.187 3.187 mg/100 g Winter squash Type 1 specific Cucurbita maxima 3661 0.086 0.086 0.086 mg/100 g Yam Type 1 specific Dioscorea 4672 75.0775 150.0 0.155 mg/100 g Yellow zucchini Type 1 specific Cucurbita pepo var. cylindrica 0.115 0.115 0.115 mg/100 g Yellowfin tuna Type 1 specific Thunnus albacares 8236 2.394 2.394 2.394 mg/100 g Yellowtail amberjack Type 1 specific Seriola lalandi 302047 2.37 2.37 2.37 mg/100 g Ymer Type 2 specific 495.0 500.0 490.0 mg/100 g Yogurt Type 2 specific 236.2 330.0 0.0 mg/100 g