1.0 2011-09-21 00:37:45 UTC 2015-07-21 06:57:57 UTC FDB023969 dIMP dIMP is a deoxyribonucleoside and is considered a derivative of the nucleoside inosine, differing from the latter by the replacement of a hydroxyl group (-OH) by hydrogen (-H) at the 2' position of its ribose sugar moiety. The hydrolytic deamination of dAMP residues in DNA yields dIMP residues. The deamination of adenine residues in DNA generates hypoxanthine, which is mutagenic since it can pair not only with thymine but also with cytosine and therefore would result in A-T to G-C transitions after DNA replication. Hypoxanthine DNA glycosylase (EC 3.2.2.15) excises hypoxanthine from DNA containing dIMP residues in mammalian cells. (PMID: 10684927, 8016081) [HMDB] [(2R,3S,4R,5R)-3-Hydroxy-5-(6-hydroxy-9H-purin-9-yl)tetrahydrofuran-2-yl]methyl dihydrogen ate [(2R,3S,4R,5R)-3-hydroxy-5-(6-hydroxy-9H-purin-9-yl)tetrahydrofuran-2-yl]methyl dihydrogen phosphate 2'-deoxy-5'-inosinic acid 2'-Deoxyinosine 5'-ate 2'-Deoxyinosine 5'-ic acid 2'-Deoxyinosine 5'-monoate 2'-Deoxyinosine 5'-monoic acid 2'-Deoxyinosine 5'-monophosphate 2'-Deoxyinosine 5'-phosphate 9-(2-Deoxy-5-O-ONO-b-D-erythro-pentofuranosyl)-9H-purin-6-ol 9-(2-Deoxy-5-O-ONO-beta-D-erythro-pentofuranosyl)-9H-purin-6-ol 9-(2-Deoxy-5-O-ONO-beta-delta-erythro-pentofuranosyl)-9H-purin-6-ol 9-(2-Deoxy-5-O-ONO-β-D-erythro-pentofuranosyl)-9H-purin-6-ol 9-(2-deoxy-5-O-phosphono-beta-D-erythro-pentofuranosyl)-9H-purin-6-ol 9-(2-deoxy-5-O-phosphono-beta-delta-erythro-pentofuranosyl)-9H-purin-6-ol Deoxyinosine monoate Deoxyinosine monoic acid deoxyinosine monophosphate Hypoxanthine deoxyriboside C10H13N4O7P 332.2066 332.052185302 {[(2R,3S,5R)-3-hydroxy-5-(6-oxo-6,9-dihydro-3H-purin-9-yl)oxolan-2-yl]methoxy}phosphonic acid [(2R,3S,5R)-3-hydroxy-5-(6-oxo-3H-purin-9-yl)oxolan-2-yl]methoxyphosphonic acid 3393-18-8 O[C@H]1C[C@@H](O[C@@H]1COP(O)(O)=O)N1C=NC2=C1NC=NC2=O InChI=1S/C10H13N4O7P/c15-5-1-7(21-6(5)2-20-22(17,18)19)14-4-13-8-9(14)11-3-12-10(8)16/h3-7,15H,1-2H2,(H,11,12,16)(H2,17,18,19)/t5-,6+,7+/m0/s1 PHNGFPPXDJJADG-RRKCRQDMSA-N belongs to the class of organic compounds known as purine 2'-deoxyribonucleoside monophosphates. These are purine nucleotides with monophosphate group linked to the ribose moiety lacking a hydroxyl group at position 2. Purine 2'-deoxyribonucleoside monophosphates Organic compounds Nucleosides, nucleotides, and analogues Purine nucleotides Purine deoxyribonucleotides Aromatic heteropolycyclic compounds Azacyclic compounds Heteroaromatic compounds Hydrocarbon derivatives Hydroxypyrimidines Hypoxanthines Monoalkyl phosphates N-substituted imidazoles Organic oxides Organonitrogen compounds Organopnictogen compounds Oxacyclic compounds Secondary alcohols Tetrahydrofurans Alcohol Alkyl phosphate Aromatic heteropolycyclic compound Azacycle Azole Heteroaromatic compound Hydrocarbon derivative Hydroxypyrimidine Hypoxanthine Imidazole Imidazopyrimidine Monoalkyl phosphate N-substituted imidazole Organic nitrogen compound Organic oxide Organic oxygen compound Organic phosphoric acid derivative Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Oxacycle Phosphoric acid ester Purine Purine 2'-deoxyribonucleoside monophosphate Pyrimidine Secondary alcohol Tetrahydrofuran deoxyinosine phosphate purine 2'-deoxyribonucleoside 5'-monophosphate Solid logp -1.58 ALOGPS logs -2.20 ALOGPS solubility 2.10e+00 g/l ALOGPS logp -2.6 ChemAxon pka_strongest_acidic 1.22 ChemAxon pka_strongest_basic 2.77 ChemAxon iupac {[(2R,3S,5R)-3-hydroxy-5-(6-oxo-6,9-dihydro-3H-purin-9-yl)oxolan-2-yl]methoxy}phosphonic acid ChemAxon average_mass 332.2066 ChemAxon mono_mass 332.052185302 ChemAxon smiles O[C@H]1C[C@@H](O[C@@H]1COP(O)(O)=O)N1C=NC2=C1NC=NC2=O ChemAxon formula C10H13N4O7P ChemAxon inchi InChI=1S/C10H13N4O7P/c15-5-1-7(21-6(5)2-20-22(17,18)19)14-4-13-8-9(14)11-3-12-10(8)16/h3-7,15H,1-2H2,(H,11,12,16)(H2,17,18,19)/t5-,6+,7+/m0/s1 ChemAxon inchikey PHNGFPPXDJJADG-RRKCRQDMSA-N ChemAxon polar_surface_area 155.5 ChemAxon refractivity 70.26 ChemAxon polarizability 27.21 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 9 ChemAxon donor_count 4 ChemAxon physiological_charge -3 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 883 Specdb::CMs 14679 Specdb::CMs 30896 Specdb::CMs 39038 Specdb::CMs 163105 Specdb::NmrOneD 74772 Specdb::NmrOneD 74773 Specdb::NmrOneD 74774 Specdb::NmrOneD 74775 Specdb::NmrOneD 74776 Specdb::NmrOneD 74777 Specdb::NmrOneD 74778 Specdb::NmrOneD 74779 Specdb::NmrOneD 74780 Specdb::NmrOneD 74781 Specdb::NmrOneD 74782 Specdb::NmrOneD 74783 Specdb::NmrOneD 74784 Specdb::NmrOneD 74785 Specdb::NmrOneD 74786 Specdb::NmrOneD 74787 Specdb::NmrOneD 74788 Specdb::NmrOneD 74789 Specdb::NmrOneD 74790 Specdb::NmrOneD 74791 Specdb::MsMs 6472 Specdb::MsMs 6473 Specdb::MsMs 6474 Specdb::MsMs 298444 Specdb::MsMs 298445 Specdb::MsMs 298446 Specdb::MsMs 340210 Specdb::MsMs 340211 Specdb::MsMs 340212 Specdb::MsMs 439045 Specdb::MsMs 447976 Specdb::MsMs 447977 Specdb::MsMs 2233365 Specdb::MsMs 2675602 Specdb::MsMs 2675603 Specdb::MsMs 2675604 Specdb::MsMs 3033587 Specdb::MsMs 3033588 Specdb::MsMs 3033589 HMDB06555 28806 DI #<Reference:0x000055ce332916c8> #<Reference:0x000055ce33291498> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823