1.0 2011-09-21 00:37:46 UTC 2015-07-21 06:57:57 UTC FDB023970 L-4-Hydroxyglutamate semialdehyde L-4-Hydroxyglutamate semialdehyde is an intermediate in Arginine and proline metabolism. L-4-Hydroxyglutamate semialdehyde is the 4th to last step in the synthesis of Glyoxylate and is converted from L-erythro-4-Hydroxyglutamate via the enzyme 1-pyrroline-5-carboxylate dehydrogenase (EC 1.5.1.12). It is then converted to L-1-Pyrroline-3-hydroxy-5-carboxylate via enzymtic reaction. [HMDB] (4R)-4-Hydroxy-5-oxo-L-norvaline 4-amino-3,4-Dideoxy-D-erythro-penturonate 4-amino-3,4-Dideoxy-D-erythro-penturonic acid C5H9NO4 147.1293 147.053157781 (2S,4R)-2-amino-4-hydroxy-5-oxopentanoic acid (2S,4R)-2-amino-4-hydroxy-5-oxopentanoic acid N[C@@H](C[C@@H](O)C=O)C(O)=O InChI=1S/C5H9NO4/c6-4(5(9)10)1-3(8)2-7/h2-4,8H,1,6H2,(H,9,10)/t3-,4+/m1/s1 XCXUZPXOFFRGGP-DMTCNVIQSA-N belongs to the class of organic compounds known as l-alpha-amino acids. These are alpha amino acids which have the L-configuration of the alpha-carbon atom. L-alpha-amino acids Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds 1,3-aminoalcohols Alpha-hydroxyaldehydes Amino acids Carboxylic acids Fatty acids and conjugates Hydrocarbon derivatives Monoalkylamines Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Secondary alcohols Short-chain hydroxy acids and derivatives 1,3-aminoalcohol Alcohol Aldehyde Aliphatic acyclic compound Alpha-hydroxyaldehyde Amine Amino acid Carbonyl group Carboxylic acid Fatty acid Hydrocarbon derivative L-alpha-amino acid Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine Secondary alcohol Short-chain hydroxy acid glutamic semialdehyde Solid logp -2.99 ALOGPS logs -0.06 ALOGPS solubility 1.28e+02 g/l ALOGPS logp -4.3 ChemAxon pka_strongest_acidic 1.88 ChemAxon pka_strongest_basic 8.74 ChemAxon iupac (2S,4R)-2-amino-4-hydroxy-5-oxopentanoic acid ChemAxon average_mass 147.1293 ChemAxon mono_mass 147.053157781 ChemAxon smiles N[C@@H](C[C@@H](O)C=O)C(O)=O ChemAxon formula C5H9NO4 ChemAxon inchi InChI=1S/C5H9NO4/c6-4(5(9)10)1-3(8)2-7/h2-4,8H,1,6H2,(H,9,10)/t3-,4+/m1/s1 ChemAxon inchikey XCXUZPXOFFRGGP-DMTCNVIQSA-N ChemAxon polar_surface_area 100.62 ChemAxon refractivity 31.81 ChemAxon polarizability 13.13 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 5 ChemAxon donor_count 3 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Arginine and Proline Metabolism SMP00020 map00330 Specdb::CMs 2840 Specdb::CMs 39039 Specdb::CMs 145841 Specdb::MsIr 2418 Specdb::MsIr 2419 Specdb::MsIr 2420 Specdb::MsMs 178968 Specdb::MsMs 178969 Specdb::MsMs 178970 Specdb::MsMs 181293 Specdb::MsMs 181294 Specdb::MsMs 181295 Specdb::MsMs 2351788 Specdb::MsMs 2351789 Specdb::MsMs 2351790 Specdb::MsMs 2584397 Specdb::MsMs 2584398 Specdb::MsMs 2584399 Specdb::NmrOneD 74792 Specdb::NmrOneD 74793 Specdb::NmrOneD 74794 Specdb::NmrOneD 74795 Specdb::NmrOneD 74796 Specdb::NmrOneD 74797 Specdb::NmrOneD 74798 Specdb::NmrOneD 74799 Specdb::NmrOneD 74800 Specdb::NmrOneD 74801 Specdb::NmrOneD 74802 Specdb::NmrOneD 74803 Specdb::NmrOneD 74804 Specdb::NmrOneD 74805 Specdb::NmrOneD 74806 Specdb::NmrOneD 74807 Specdb::NmrOneD 74808 Specdb::NmrOneD 74809 Specdb::NmrOneD 74810 Specdb::NmrOneD 74811 HMDB06556 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823