1.0 2011-09-21 00:37:47 UTC 2015-07-21 06:57:57 UTC FDB023971 Heptaglutamyl folic acid Heptaglutamyl folic acid is a naturally occurring form of folate. In contrast to synthetic folic acid, natural food folates are predominantly polyglutamates with a variable number of glutamate residues. (PMID 15831124) Approximately two-thirds of total folate intake from a mixed unfortified diet is in the polyglutamyl form, derived mainly from vegetables. These polyglutamates need to be hydrolysed to the monoglutamate form for normal absorption in the proximal small intestine. This process is controlled by the intestinal brush-border enzyme glutamate carboxypeptidase II (GCPII). (PMID 12042451) [HMDB] C54H68N14O27 1345.1953 1344.43783304 (3S,9S)-3,9-diamino-5,6,6-tris[(2S)-2-amino-4-carboxybutanoyl]-7-{N-[(2S)-2-amino-4-carboxybutanoyl]-1-(4-{[(2-amino-4-oxo-3,4-dihydropteridin-6-yl)methyl]amino}phenyl)formamido}-7-({[(2S)-2-amino-4-carboxybutanoyl]oxy}carbonyl)-4,8-dioxoundecane-1,5,11-tricarboxylic acid (3S,9S)-3,9-diamino-5,6,6-tris[(2S)-2-amino-4-carboxybutanoyl]-7-{N-[(2S)-2-amino-4-carboxybutanoyl]-1-(4-{[(2-amino-4-oxo-3H-pteridin-6-yl)methyl]amino}phenyl)formamido}-7-({[(2S)-2-amino-4-carboxybutanoyl]oxy}carbonyl)-4,8-dioxoundecane-1,5,11-tricarboxylic acid N[C@@H](CCC(O)=O)C(=O)OC(=O)C(N(C(=O)[C@@H](N)CCC(O)=O)C(=O)C1=CC=C(NCC2=NC3=C(N=C2)N=C(N)NC3=O)C=C1)(C(=O)[C@@H](N)CCC(O)=O)C(C(=O)[C@@H](N)CCC(O)=O)(C(=O)[C@@H](N)CCC(O)=O)C(C(O)=O)(C(=O)[C@@H](N)CCC(O)=O)C(=O)[C@@H](N)CCC(O)=O InChI=1S/C54H68N14O27/c55-24(5-12-31(69)70)39(83)52(49(92)93,40(84)25(56)6-13-32(71)72)53(41(85)26(57)7-14-33(73)74,42(86)27(58)8-15-34(75)76)54(43(87)28(59)9-16-35(77)78,50(94)95-48(91)30(61)11-18-37(81)82)68(47(90)29(60)10-17-36(79)80)46(89)21-1-3-22(4-2-21)63-19-23-20-64-44-38(65-23)45(88)67-51(62)66-44/h1-4,20,24-30,63H,5-19,55-61H2,(H,69,70)(H,71,72)(H,73,74)(H,75,76)(H,77,78)(H,79,80)(H,81,82)(H,92,93)(H3,62,64,66,67,88)/t24-,25-,26-,27-,28-,29-,30-,54?/m0/s1 KNLHIYYNBQALAI-IMYKNWLQSA-N belongs to the class of organic compounds known as peptides. Peptides are compounds containing an amide derived from two or more amino carboxylic acid molecules (the same or different) by formation of a covalent bond from the carbonyl carbon of one to the nitrogen atom of another. Peptides Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aromatic heteropolycyclic compounds Alpha amino acid amides Alpha-amino ketones Amino acids Amino fatty acids Aminobenzamides Aminopyrimidines and derivatives Aniline and substituted anilines Azacyclic compounds Benzoyl derivatives Beta-hydroxy ketones Beta-keto acids and derivatives Carboxylic acid anhydrides Carboxylic acids Dicarboximides Gamma amino acids and derivatives Gamma-amino ketones Gamma-keto acids and derivatives Glutamic acid and derivatives Heteroaromatic compounds Hippuric acids and derivatives Hydrocarbon derivatives Monoalkylamines N-acyl amines N-substituted carboxylic acid imides Organic oxides Organopnictogen compounds Phenylalkylamines Pterins and derivatives Pyrazines Pyrimidones Secondary alkylarylamines Vinylogous amides Alpha peptide Alpha-amino acid amide Alpha-amino acid or derivatives Alpha-aminoketone Amine Amino acid Amino acid or derivatives Amino fatty acid Aminobenzamide Aminobenzoic acid or derivatives Aminopyrimidine Aniline or substituted anilines Aralkylamine Aromatic heteropolycyclic compound Azacycle Benzenoid Benzoic acid or derivatives Benzoyl Beta-hydroxy ketone Beta-keto acid Carbonyl group Carboxylic acid Carboxylic acid anhydride Carboxylic acid imide Carboxylic acid imide, n-substituted Dicarboximide Fatty acyl Gamma amino acid or derivatives Gamma-aminoketone Gamma-keto acid Glutamic acid or derivatives Heteroaromatic compound Hippuric acid or derivatives Hydrocarbon derivative Keto acid Ketone Monocyclic benzene moiety N-acyl-amine Organic nitrogen compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Phenylalkylamine Primary aliphatic amine Primary amine Pteridine Pterin Pyrazine Pyrimidine Pyrimidone Secondary aliphatic/aromatic amine Secondary amine Vinylogous amide Solid logp -2.86 ALOGPS logs -3.38 ALOGPS solubility 5.61e-01 g/l ALOGPS logp -5.9 ChemAxon pka_strongest_acidic 2.24 ChemAxon iupac (3S,9S)-3,9-diamino-5,6,6-tris[(2S)-2-amino-4-carboxybutanoyl]-7-{N-[(2S)-2-amino-4-carboxybutanoyl]-1-(4-{[(2-amino-4-oxo-3,4-dihydropteridin-6-yl)methyl]amino}phenyl)formamido}-7-({[(2S)-2-amino-4-carboxybutanoyl]oxy}carbonyl)-4,8-dioxoundecane-1,5,11-tricarboxylic acid ChemAxon average_mass 1345.1953 ChemAxon mono_mass 1344.43783304 ChemAxon smiles N[C@@H](CCC(O)=O)C(=O)OC(=O)C(N(C(=O)[C@@H](N)CCC(O)=O)C(=O)C1=CC=C(NCC2=NC3=C(N=C2)N=C(N)NC3=O)C=C1)(C(=O)[C@@H](N)CCC(O)=O)C(C(=O)[C@@H](N)CCC(O)=O)(C(=O)[C@@H](N)CCC(O)=O)C(C(O)=O)(C(=O)[C@@H](N)CCC(O)=O)C(=O)[C@@H](N)CCC(O)=O ChemAxon formula C54H68N14O27 ChemAxon inchi InChI=1S/C54H68N14O27/c55-24(5-12-31(69)70)39(83)52(49(92)93,40(84)25(56)6-13-32(71)72)53(41(85)26(57)7-14-33(73)74,42(86)27(58)8-15-34(75)76)54(43(87)28(59)9-16-35(77)78,50(94)95-48(91)30(61)11-18-37(81)82)68(47(90)29(60)10-17-36(79)80)46(89)21-1-3-22(4-2-21)63-19-23-20-64-44-38(65-23)45(88)67-51(62)66-44/h1-4,20,24-30,63H,5-19,55-61H2,(H,69,70)(H,71,72)(H,73,74)(H,75,76)(H,77,78)(H,79,80)(H,81,82)(H,92,93)(H3,62,64,66,67,88)/t24-,25-,26-,27-,28-,29-,30-,54?/m0/s1 ChemAxon inchikey KNLHIYYNBQALAI-IMYKNWLQSA-N ChemAxon polar_surface_area 751.93 ChemAxon refractivity 309.73 ChemAxon polarizability 126.39 ChemAxon rotatable_bond_count 44 ChemAxon acceptor_count 38 ChemAxon donor_count 18 ChemAxon physiological_charge -4 ChemAxon formal_charge 0 ChemAxon Specdb::NmrOneD 74832 Specdb::NmrOneD 74833 Specdb::NmrOneD 74834 Specdb::NmrOneD 74835 Specdb::NmrOneD 74836 Specdb::NmrOneD 74837 Specdb::NmrOneD 74838 Specdb::NmrOneD 74839 Specdb::NmrOneD 74840 Specdb::NmrOneD 74841 Specdb::NmrOneD 74842 Specdb::NmrOneD 74843 Specdb::NmrOneD 74844 Specdb::NmrOneD 74845 Specdb::NmrOneD 74846 Specdb::NmrOneD 74847 Specdb::NmrOneD 74848 Specdb::NmrOneD 74849 Specdb::NmrOneD 74850 Specdb::NmrOneD 74851 Specdb::MsMs 287368 Specdb::MsMs 287369 Specdb::MsMs 287370 Specdb::MsMs 326191 Specdb::MsMs 326192 Specdb::MsMs 326193 Specdb::MsMs 2470635 Specdb::MsMs 2470636 Specdb::MsMs 2470637 Specdb::MsMs 2494832 Specdb::MsMs 2494833 Specdb::MsMs 2494834 HMDB06559 #<Reference:0x000055ce32c55ca0> #<Reference:0x000055ce32c55ac0> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823