1.0 2011-09-21 00:38:46 UTC 2015-07-21 06:57:58 UTC FDB024030 Tri-N-acetylchitotriose Tri-N-acetylchitotriose is an oligosaccharide that may prevent the action of certain prolamins (antinutritional peptides) from some cereals (e. g. wheat, barley, and rye) that adversely affect in vivo the intestinal mucosa of coeliac patients. (PMID: 10399351) [HMDB] (G1cNAC)3 N-acetylchitotriose N,n',n''-triacetyl chitotriose N,n',n''-triacetylchitintriose N,n',n''-triacetylchitotriose Tri(n-acetyl-d-glucosamine) Tris(n-acetylglucosamine) C24H41N3O16 627.5928 627.248682279 N-[(2R,3R,4S,5R)-4-{[(2S,3R,4R,5S,6R)-3-acetamido-5-{[(2S,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-4-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-3,5,6-trihydroxy-1-oxohexan-2-yl]acetamide N-[(2R,3R,4S,5R)-4-{[(2S,3R,4R,5S,6R)-3-acetamido-5-{[(2S,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-4-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-3,5,6-trihydroxy-1-oxohexan-2-yl]acetamide 38864-21-0 CC(=O)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(C)=O)[C@H](O)[C@H]1NC(C)=O)[C@H](O)CO InChI=1S/C24H41N3O16/c1-8(32)25-11(4-28)17(36)21(12(35)5-29)42-24-16(27-10(3)34)20(39)22(14(7-31)41-24)43-23-15(26-9(2)33)19(38)18(37)13(6-30)40-23/h4,11-24,29-31,35-39H,5-7H2,1-3H3,(H,25,32)(H,26,33)(H,27,34)/t11-,12+,13+,14+,15+,16+,17+,18+,19+,20+,21+,22+,23-,24-/m0/s1 LRDDKCYRFNJZBX-WHFMPQCRSA-N belongs to the class of organic compounds known as n-acyl-alpha-hexosamines. These are carbohydrate derivatives containing a hexose moiety in which the oxygen atom is replaced by an n-acyl group. N-acyl-alpha-hexosamines Organic compounds Organic oxygen compounds Organooxygen compounds Carbohydrates and carbohydrate conjugates Aliphatic heteromonocyclic compounds Acetals Acetamides Beta-hydroxy aldehydes Disaccharides Hydrocarbon derivatives O-glycosyl compounds Organic oxides Organonitrogen compounds Organopnictogen compounds Oxacyclic compounds Oxanes Polyols Primary alcohols Secondary alcohols Secondary carboxylic acid amides Acetal Acetamide Alcohol Aldehyde Aliphatic heteromonocyclic compound Beta-hydroxy aldehyde Carbonyl group Carboxamide group Carboxylic acid derivative Disaccharide Glycosyl compound Hydrocarbon derivative N-acyl-alpha-hexosamine O-glycosyl compound Organic nitrogen compound Organic oxide Organoheterocyclic compound Organonitrogen compound Organopnictogen compound Oxacycle Oxane Polyol Primary alcohol Secondary alcohol Secondary carboxylic acid amide Solid logp -2.43 ALOGPS logs -1.04 ALOGPS solubility 5.78e+01 g/l ALOGPS logp -8 ChemAxon pka_strongest_acidic 11.34 ChemAxon pka_strongest_basic -3.5 ChemAxon iupac N-[(2R,3R,4S,5R)-4-{[(2S,3R,4R,5S,6R)-3-acetamido-5-{[(2S,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-4-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-3,5,6-trihydroxy-1-oxohexan-2-yl]acetamide ChemAxon average_mass 627.5928 ChemAxon mono_mass 627.248682279 ChemAxon smiles CC(=O)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(C)=O)[C@H](O)[C@H]1NC(C)=O)[C@H](O)CO ChemAxon formula C24H41N3O16 ChemAxon inchi InChI=1S/C24H41N3O16/c1-8(32)25-11(4-28)17(36)21(12(35)5-29)42-24-16(27-10(3)34)20(39)22(14(7-31)41-24)43-23-15(26-9(2)33)19(38)18(37)13(6-30)40-23/h4,11-24,29-31,35-39H,5-7H2,1-3H3,(H,25,32)(H,26,33)(H,27,34)/t11-,12+,13+,14+,15+,16+,17+,18+,19+,20+,21+,22+,23-,24-/m0/s1 ChemAxon inchikey LRDDKCYRFNJZBX-WHFMPQCRSA-N ChemAxon polar_surface_area 303.13 ChemAxon refractivity 135.48 ChemAxon polarizability 59.67 ChemAxon rotatable_bond_count 14 ChemAxon acceptor_count 16 ChemAxon donor_count 11 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 313117 Specdb::MsMs 313118 Specdb::MsMs 313119 Specdb::MsMs 358543 Specdb::MsMs 358544 Specdb::MsMs 358545 Specdb::MsMs 2291076 Specdb::MsMs 2291077 Specdb::MsMs 2291078 Specdb::MsMs 2644980 Specdb::MsMs 2644981 Specdb::MsMs 2644982 Specdb::NmrOneD 11142 Specdb::NmrOneD 11143 Specdb::NmrOneD 11144 Specdb::NmrOneD 11145 Specdb::NmrOneD 11146 Specdb::NmrOneD 11147 Specdb::NmrOneD 11148 Specdb::NmrOneD 11149 Specdb::NmrOneD 11150 Specdb::NmrOneD 11151 Specdb::NmrOneD 11152 Specdb::NmrOneD 11153 Specdb::NmrOneD 11154 Specdb::NmrOneD 11155 Specdb::NmrOneD 11156 Specdb::NmrOneD 11157 Specdb::NmrOneD 11158 Specdb::NmrOneD 11159 Specdb::NmrOneD 11160 Specdb::NmrOneD 11161 Specdb::CMs 21166 Specdb::CMs 39058 Specdb::CMs 573262 Specdb::CMs 573263 Specdb::CMs 573264 Specdb::CMs 573265 Specdb::CMs 573266 Specdb::CMs 573267 Specdb::CMs 573268 Specdb::CMs 573269 Specdb::CMs 573270 Specdb::CMs 573271 Specdb::CMs 573272 Specdb::CMs 573273 Specdb::CMs 573274 Specdb::CMs 573275 Specdb::CMs 573276 Specdb::CMs 573277 Specdb::CMs 573278 Specdb::CMs 573279 Specdb::CMs 573280 Specdb::CMs 573281 Specdb::CMs 573282 Specdb::CMs 573283 Specdb::CMs 573284 HMDB06698 #<Reference:0x000055ce3223c6d8> #<Reference:0x000055ce3223c520> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823