1.0 2011-09-21 00:39:06 UTC 2015-07-21 06:57:59 UTC FDB024054 3-Carboxy-1-hydroxypropylthiamine diphosphate 3-Carboxy-1-hydroxypropyl-ThPP is an intermediate in Citrate cycle (TCA cycle). 3-Carboxy-1-hydroxypropyl-ThPP is the second to last step in the synthesis of Succinyl-CoA and is converted from 2-Oxoglutarate via the enzyme 2-oxoglutarate dehydrogenase E1 component (EC.1.2.4.2). It is then converted to S-Succinyldihydrolipoamide-E via the enzyme 2-oxoglutarate dehydrogenase E1 component (EC.1.2.4.2). [HMDB] 2-(3-Carboxy-1-hydroxypropyl)thiamine diate 2-(3-Carboxy-1-hydroxypropyl)thiamine diic acid 2-(3-carboxy-1-hydroxypropyl)thiamine diphosphate 3-[(4-amino-2-Methylpyrimidin-5-yl)methyl]-2-(3-carboxy-1-hydroxypropyl)-5-(2-dioethyl)-4-methyl-1,3-thiazol-3-ium 3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-2-(3-carboxy-1-hydroxypropyl)-5-(2-diphosphoethyl)-4-methyl-1,3-thiazol-3-ium 3-Carboxy-1-hydroxypropyl-ThPP C16H25N4O10P2S 527.403 527.076661754 3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-2-(3-carboxy-1-hydroxypropyl)-5-(2-{[hydroxy(phosphonooxy)phosphoryl]oxy}ethyl)-4-methyl-1,3-thiazol-3-ium 3-carboxy-1-hydroxypropyl-thpp CC1=C(CCOP(O)(=O)OP(O)(O)=O)SC(C(O)CCC(O)=O)=[N+]1CC1=C(N)N=C(C)N=C1 InChI=1S/C16H24N4O10P2S/c1-9-13(5-6-29-32(27,28)30-31(24,25)26)33-16(12(21)3-4-14(22)23)20(9)8-11-7-18-10(2)19-15(11)17/h7,12,21H,3-6,8H2,1-2H3,(H5-,17,18,19,22,23,24,25,26,27,28)/p+1 ZWUKRGPVMMTMAF-UHFFFAOYSA-O belongs to the class of organic compounds known as thiamine phosphates. These are thiamine derivatives in which the hydroxyl group of the ethanol moiety is substituted by a phosphate group. Thiamine phosphates Organic compounds Organoheterocyclic compounds Diazines Pyrimidines and pyrimidine derivatives Aromatic heteromonocyclic compounds 2,4,5-trisubstituted thiazoles Amino acids Aminopyrimidines and derivatives Aromatic alcohols Azacyclic compounds Carbonyl compounds Carboxylic acids Heteroaromatic compounds Hydrocarbon derivatives Imidolactams Monoalkyl phosphates Monocarboxylic acids and derivatives Organic cations Organic oxides Organic pyrophosphates Organopnictogen compounds Primary amines Secondary alcohols 2,4,5-trisubstituted 1,3-thiazole Alcohol Alkyl phosphate Amine Amino acid Amino acid or derivatives Aminopyrimidine Aromatic alcohol Aromatic heteromonocyclic compound Azacycle Azole Carbonyl group Carboxylic acid Carboxylic acid derivative Heteroaromatic compound Hydrocarbon derivative Imidolactam Monoalkyl phosphate Monocarboxylic acid or derivatives Organic cation Organic nitrogen compound Organic oxide Organic oxygen compound Organic phosphoric acid derivative Organic pyrophosphate Organonitrogen compound Organooxygen compound Organopnictogen compound Phosphoric acid ester Primary amine Secondary alcohol Thiamine-phosphate Thiazole 1,3-thiazolium cation Solid logp -0.64 ALOGPS logs -4.02 ALOGPS solubility 5.40e-02 g/l ALOGPS logp -7.3 ChemAxon pka_strongest_acidic 1.77 ChemAxon pka_strongest_basic 5.54 ChemAxon iupac 3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-2-(3-carboxy-1-hydroxypropyl)-5-(2-{[hydroxy(phosphonooxy)phosphoryl]oxy}ethyl)-4-methyl-1,3-thiazol-3-ium ChemAxon average_mass 527.403 ChemAxon mono_mass 527.076661754 ChemAxon smiles CC1=C(CCOP(O)(=O)OP(O)(O)=O)SC(C(O)CCC(O)=O)=[N+]1CC1=C(N)N=C(C)N=C1 ChemAxon formula C16H25N4O10P2S ChemAxon inchi InChI=1S/C16H24N4O10P2S/c1-9-13(5-6-29-32(27,28)30-31(24,25)26)33-16(12(21)3-4-14(22)23)20(9)8-11-7-18-10(2)19-15(11)17/h7,12,21H,3-6,8H2,1-2H3,(H5-,17,18,19,22,23,24,25,26,27,28)/p+1 ChemAxon inchikey ZWUKRGPVMMTMAF-UHFFFAOYSA-O ChemAxon polar_surface_area 226.5 ChemAxon refractivity 127.37 ChemAxon polarizability 47.11 ChemAxon rotatable_bond_count 12 ChemAxon acceptor_count 11 ChemAxon donor_count 6 ChemAxon physiological_charge -2 ChemAxon formal_charge 1 ChemAxon Specdb::CMs 10937 Specdb::CMs 39066 Specdb::MsMs 290068 Specdb::MsMs 290069 Specdb::MsMs 290070 Specdb::MsMs 2651909 Specdb::MsMs 2651910 Specdb::MsMs 2651911 Specdb::NmrOneD 88592 Specdb::NmrOneD 88593 Specdb::NmrOneD 88594 Specdb::NmrOneD 88595 Specdb::NmrOneD 88596 Specdb::NmrOneD 88597 Specdb::NmrOneD 88598 Specdb::NmrOneD 88599 Specdb::NmrOneD 88600 Specdb::NmrOneD 88601 Specdb::NmrOneD 88602 Specdb::NmrOneD 88603 Specdb::NmrOneD 88604 Specdb::NmrOneD 88605 Specdb::NmrOneD 88606 Specdb::NmrOneD 88607 Specdb::NmrOneD 88608 Specdb::NmrOneD 88609 Specdb::NmrOneD 88610 Specdb::NmrOneD 88611 HMDB06744 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 2-oxoglutarate dehydrogenase-like, mitochondrial Q9ULD0 OGDHL 2-oxoglutarate dehydrogenase, mitochondrial Q02218 OGDH