1.0 2011-09-21 00:39:46 UTC 2018-05-29 01:53:11 UTC FDB024090 Propynoic acid Propynoic acid is involved in propanoate metabolism and is interconverted between 2-propyn1-al and propynoic acid by mitochondrial aldehyde dehydrogenase. Propiolic acid is an unsaturated organic acid and it can be prepared by boiling acetylene dicarboxylic acid. It is chemically obtained by the action of alcoholic potash on dibromosuccinic acid, or its acid potassium salt with water. It forms silky crystals which melt at 6 degree centigrade, and boil at about 144 degree centigrade with decomposition. It is soluble in water and possesses an odor resembling that of acetic acid. Exposure to sunlight converts it into trimesic acid (benzene-1,3,5-tricarboxylic acid). Bromine converts it into dibromoacrylic acid, and it gives with hydrochloric acid O-chloracrylic acid. It forms a characteristic explosive silver salt on the addition of ammoniacal silver nitrate to its aqueous solution, and an amorphous precipitate which explodes on warming with ammoniacal cuprous chloride. Its ethyl ester condenses with hydrazine to form pyrazolone. [HMDB] 2-Propynoate 2-Propynoic acid Acetylenate Acetylenecarboxylate Acetylenecarboxylic acid Acetylenemonocarboxylate Acetylenic acid Carboxyacetylene HC#CCOOH Propargylate Propargylic acid Propinate Propinic acid Propinsaeure Propiolate Propiolic acid Propiolsaeure Propynoate Propynoic acid C3H2O2 70.0468 70.005479308 prop-2-ynoic acid propiolic acid 471-25-0 OC(=O)C#C InChI=1S/C3H2O2/c1-2-3(4)5/h1H,(H,4,5) UORVCLMRJXCDCP-UHFFFAOYSA-N belongs to the class of organic compounds known as carboxylic acids. Carboxylic acids are compounds containing a carboxylic acid group with the formula -C(=O)OH. Carboxylic acids Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Carboxylic acids Aliphatic acyclic compounds Acetylides Carbonyl compounds Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Acetylide Aliphatic acyclic compound Carbonyl group Carboxylic acid Hydrocarbon derivative Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound acetylenic fatty acid monounsaturated fatty acid short-chain fatty acid terminal acetylenic compound Solid logp 0.03 ALOGPS logs -1.72 ALOGPS solubility 1.32e+00 g/l ALOGPS logp 0.18 ChemAxon pka_strongest_acidic 1.99 ChemAxon iupac prop-2-ynoic acid ChemAxon average_mass 70.0468 ChemAxon mono_mass 70.005479308 ChemAxon smiles OC(=O)C#C ChemAxon formula C3H2O2 ChemAxon inchi InChI=1S/C3H2O2/c1-2-3(4)5/h1H,(H,4,5) ChemAxon inchikey UORVCLMRJXCDCP-UHFFFAOYSA-N ChemAxon polar_surface_area 37.3 ChemAxon refractivity 15.78 ChemAxon polarizability 5.8 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsIr 2425 Specdb::MsIr 2426 Specdb::MsIr 2427 Specdb::CMs 17787 Specdb::CMs 39095 Specdb::CMs 133500 Specdb::CMs 141234 Specdb::NmrOneD 91592 Specdb::NmrOneD 91593 Specdb::NmrOneD 91594 Specdb::NmrOneD 91595 Specdb::NmrOneD 91596 Specdb::NmrOneD 91597 Specdb::NmrOneD 91598 Specdb::NmrOneD 91599 Specdb::NmrOneD 91600 Specdb::NmrOneD 91601 Specdb::NmrOneD 91602 Specdb::NmrOneD 91603 Specdb::NmrOneD 91604 Specdb::NmrOneD 91605 Specdb::NmrOneD 91606 Specdb::NmrOneD 91607 Specdb::NmrOneD 91608 Specdb::NmrOneD 91609 Specdb::NmrOneD 91610 Specdb::NmrOneD 91611 Specdb::MsMs 305383 Specdb::MsMs 305384 Specdb::MsMs 305385 Specdb::MsMs 348784 Specdb::MsMs 348785 Specdb::MsMs 348786 Specdb::MsMs 438284 Specdb::MsMs 2358285 Specdb::MsMs 2358286 Specdb::MsMs 2358287 Specdb::MsMs 2604659 Specdb::MsMs 2604660 Specdb::MsMs 2604661 HMDB06804 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823