1.0 2011-09-21 00:40:17 UTC 2015-07-21 06:58:00 UTC FDB024124 S-(2-Methylpropionyl)-dihydrolipoamide-E S-(2-Methylpropionyl)-dihydrolipoamide-E is an intermediate in valine, leucine and isoleucine degradation(KEGG ID C15977). It is the second to last step in the synthesis of branched chain fatty acid and is converted from 2-methyl-1-hydroxypropyl-ThPP via the enzyme 2-oxoisovalerate dehydrogenase [EC:1.2.4.4]. It is then converted to isobutyryl-CoA via the enzyme dihydrolipoyllysine-residue (2-methylpropanoyl)transferase [EC:2.3.1.168]. [HMDB] [Dihydrolipoyllysine-residue (2-methylpropanoyl)transferase]S-(2-methylpropanoyl)dihydrolipoyllysine S-(2-Methylpropanoyl)-dihydrolipoamide S-(2-Methylpropanoyl)-dihydrolipoamide-E S-(2-Methylpropionyl)-dihydrolipoamide S-(2-Methylpropionyl)-dihydrolipoamide-E C12H23NO2S2 277.447 277.117020365 8-[(2-methylpropanoyl)sulfanyl]-6-sulfanyloctanamide 8-[(2-methylpropanoyl)sulfanyl]-6-sulfanyloctanamide CC(C)C(=O)SCCC(S)CCCCC(N)=O InChI=1S/C12H23NO2S2/c1-9(2)12(15)17-8-7-10(16)5-3-4-6-11(13)14/h9-10,16H,3-8H2,1-2H3,(H2,13,14) UEFURMXXHJCLJP-UHFFFAOYSA-N belongs to the class of organic compounds known as fatty amides. These are carboxylic acid amide derivatives of fatty acids, that are formed from a fatty acid and an amine. Fatty amides Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty amides Aliphatic acyclic compounds Alkylthiols Carbonyl compounds Carbothioic S-esters Hydrocarbon derivatives Organic oxides Organonitrogen compounds Organopnictogen compounds Primary carboxylic acid amides Sulfenyl compounds Thioesters Aliphatic acyclic compound Alkylthiol Carbonyl group Carbothioic s-ester Carboxamide group Carboxylic acid derivative Fatty amide Hydrocarbon derivative Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Organosulfur compound Primary carboxylic acid amide Sulfenyl compound Thiocarboxylic acid ester Thiocarboxylic acid or derivatives S-substituted dihydrolipoamide Solid logp 3.05 ALOGPS logs -4.25 ALOGPS solubility 1.57e-02 g/l ALOGPS logp 2.48 ChemAxon pka_strongest_acidic 10.06 ChemAxon pka_strongest_basic -0.58 ChemAxon iupac 8-[(2-methylpropanoyl)sulfanyl]-6-sulfanyloctanamide ChemAxon average_mass 277.447 ChemAxon mono_mass 277.117020365 ChemAxon smiles CC(C)C(=O)SCCC(S)CCCCC(N)=O ChemAxon formula C12H23NO2S2 ChemAxon inchi InChI=1S/C12H23NO2S2/c1-9(2)12(15)17-8-7-10(16)5-3-4-6-11(13)14/h9-10,16H,3-8H2,1-2H3,(H2,13,14) ChemAxon inchikey UEFURMXXHJCLJP-UHFFFAOYSA-N ChemAxon polar_surface_area 60.16 ChemAxon refractivity 76.43 ChemAxon polarizability 32.12 ChemAxon rotatable_bond_count 10 ChemAxon acceptor_count 2 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Valine, Leucine and Isoleucine Degradation SMP00032 map00280 Specdb::MsMs 323005 Specdb::MsMs 323006 Specdb::MsMs 323007 Specdb::MsMs 371065 Specdb::MsMs 371066 Specdb::MsMs 371067 Specdb::MsMs 2734604 Specdb::MsMs 2734605 Specdb::MsMs 2734606 Specdb::MsMs 2973942 Specdb::MsMs 2973943 Specdb::MsMs 2973944 Specdb::CMs 25725 Specdb::CMs 148012 HMDB06868 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 2-oxoisovalerate dehydrogenase subunit beta, mitochondrial P21953 BCKDHB Lipoamide acyltransferase component of branched-chain alpha-keto acid dehydrogenase complex, mitochondrial P11182 DBT