1.0 2011-09-21 00:40:17 UTC 2015-07-21 06:58:00 UTC FDB024125 S-(2-Methylbutanoyl)-dihydrolipoamide S-(2-Methylbutanoyl)-dihydrolipoamide-E is an intermediate in isoleucine degradation. S-(2-Methylbutanoyl)-dihydrolipoamide is normally conjugated to a lysine residue of the methylpropanoyltransferase enzyme (E stands for enzyme). The structure shown here is the free form. Specifically S-(2-Methylbutanoyl)-dihydrolipoamide-E is the 2-methylbutanoyl thioester of the reduced lipoyllysine residue in dihydrolipoyllysine-residue (2-methylpropanoyl)transferase. [HMDB] S-(2-methylbutanoyl)dihydrolipoyllysine C13H25NO2S2 291.473 291.132670429 8-[(2-methylbutanoyl)sulfanyl]-6-sulfanyloctanamide 8-[(2-methylbutanoyl)sulfanyl]-6-sulfanyloctanamide CCC(C)C(=O)SCCC(S)CCCCC(N)=O InChI=1S/C13H25NO2S2/c1-3-10(2)13(16)18-9-8-11(17)6-4-5-7-12(14)15/h10-11,17H,3-9H2,1-2H3,(H2,14,15) UFNCWFSSEGPJNL-UHFFFAOYSA-N belongs to the class of organic compounds known as fatty acyl thioesters. These are thioester derivatives of a fatty acid with the general formula RC(=O)SR', where R is the fatty acyl chain. Fatty acyl thioesters Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acyl thioesters Aliphatic acyclic compounds Alkylthiols Carbonyl compounds Carbothioic S-esters Fatty amides Hydrocarbon derivatives Organic oxides Organonitrogen compounds Organopnictogen compounds Primary carboxylic acid amides Sulfenyl compounds Thioesters Aliphatic acyclic compound Alkylthiol Carbonyl group Carbothioic s-ester Carboxamide group Carboxylic acid derivative Fatty acyl thioester Fatty amide Hydrocarbon derivative Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Organosulfur compound Primary carboxylic acid amide Sulfenyl compound Thiocarboxylic acid ester Thiocarboxylic acid or derivatives S-(methylbutanoyl)dihydrolipoamide a small molecule Solid logp 3.67 ALOGPS logs -4.44 ALOGPS solubility 1.05e-02 g/l ALOGPS logp 2.92 ChemAxon pka_strongest_acidic 10.06 ChemAxon pka_strongest_basic -0.58 ChemAxon iupac 8-[(2-methylbutanoyl)sulfanyl]-6-sulfanyloctanamide ChemAxon average_mass 291.473 ChemAxon mono_mass 291.132670429 ChemAxon smiles CCC(C)C(=O)SCCC(S)CCCCC(N)=O ChemAxon formula C13H25NO2S2 ChemAxon inchi InChI=1S/C13H25NO2S2/c1-3-10(2)13(16)18-9-8-11(17)6-4-5-7-12(14)15/h10-11,17H,3-9H2,1-2H3,(H2,14,15) ChemAxon inchikey UFNCWFSSEGPJNL-UHFFFAOYSA-N ChemAxon polar_surface_area 60.16 ChemAxon refractivity 81.03 ChemAxon polarizability 33.5 ChemAxon rotatable_bond_count 11 ChemAxon acceptor_count 2 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Valine, Leucine and Isoleucine Degradation SMP00032 map00280 Specdb::CMs 21619 Specdb::CMs 163719 Specdb::MsMs 314089 Specdb::MsMs 314090 Specdb::MsMs 314091 Specdb::MsMs 359752 Specdb::MsMs 359753 Specdb::MsMs 359754 Specdb::MsMs 2458430 Specdb::MsMs 2458431 Specdb::MsMs 2458432 Specdb::MsMs 2481154 Specdb::MsMs 2481155 Specdb::MsMs 2481156 HMDB06869 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 2-oxoisovalerate dehydrogenase subunit beta, mitochondrial P21953 BCKDHB Lipoamide acyltransferase component of branched-chain alpha-keto acid dehydrogenase complex, mitochondrial P11182 DBT