1.0 2011-09-21 00:40:40 UTC 2017-04-03 05:02:17 UTC FDB024152 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid is an intermediate in tyrosine metabolism. It is reversibly converted from 4-hydroxyphenylpyruvate via phenylpyruvate tautomerase. 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid is typically a terminal product of tyrosine metabolism. [HMDB] 2-Hydroxy-3-(4-hydroxyphenyl)propenoate 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid 4-Hydroxy-enol-phenylpyruvate 4,a-Dihydroxycinnamate 4,a-Dihydroxycinnamic acid 4,alpha-Dihydroxycinnamate 4,alpha-Dihydroxycinnamic acid 4,α-dihydroxycinnamate 4,α-dihydroxycinnamic acid C9H8O4 180.1574 180.042258744 (2Z)-2-hydroxy-3-(4-hydroxyphenyl)prop-2-enoic acid 4,α-dihydroxycinnamic acid 104594-70-9 OC(=O)C(\O)=C\C1=CC=C(O)C=C1 InChI=1S/C9H8O4/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-5,10-11H,(H,12,13)/b8-5- GQYBCIHRWMPOOF-YVMONPNESA-N belongs to the class of organic compounds known as phenylpyruvic acid derivatives. Phenylpyruvic acid derivatives are compounds containing a phenylpyruvic acid moiety, which consists of a phenyl group substituted at the second position by an pyruvic acid. Phenylpyruvic acid derivatives Organic compounds Benzenoids Benzene and substituted derivatives Phenylpyruvic acid derivatives Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Carbonyl compounds Carboxylic acids Cinnamic acids Coumaric acids Enols Hydrocarbon derivatives Hydroxycinnamic acids Monocarboxylic acids and derivatives Organic oxides 1-hydroxy-2-unsubstituted benzenoid Aromatic homomonocyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Cinnamic acid Cinnamic acid or derivatives Coumaric acid Coumaric acid or derivatives Enol Enol-phenylpyruvate Hydrocarbon derivative Hydroxycinnamic acid Hydroxycinnamic acid or derivatives Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Phenol 2-hydroxy monocarboxylic acid phenols Solid logp 1.28 ALOGPS logs -2.35 ALOGPS solubility 8.14e-01 g/l ALOGPS logp 1.31 ChemAxon pka_strongest_acidic 3.16 ChemAxon pka_strongest_basic -6 ChemAxon iupac (2Z)-2-hydroxy-3-(4-hydroxyphenyl)prop-2-enoic acid ChemAxon average_mass 180.1574 ChemAxon mono_mass 180.042258744 ChemAxon smiles OC(=O)C(\O)=C\C1=CC=C(O)C=C1 ChemAxon formula C9H8O4 ChemAxon inchi InChI=1S/C9H8O4/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-5,10-11H,(H,12,13)/b8-5- ChemAxon inchikey GQYBCIHRWMPOOF-YVMONPNESA-N ChemAxon polar_surface_area 77.76 ChemAxon refractivity 47.01 ChemAxon polarizability 17.25 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 4 ChemAxon donor_count 3 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Tyrosine Metabolism SMP00006 map00350 Specdb::CMs 16828 Specdb::CMs 39139 Specdb::CMs 166292 Specdb::MsIr 2444 Specdb::MsIr 2445 Specdb::MsIr 2446 Specdb::MsMs 303190 Specdb::MsMs 303191 Specdb::MsMs 303192 Specdb::MsMs 346087 Specdb::MsMs 346088 Specdb::MsMs 346089 Specdb::MsMs 2401043 Specdb::MsMs 2401044 Specdb::MsMs 2401045 Specdb::MsMs 2538107 Specdb::MsMs 2538108 Specdb::MsMs 2538109 Specdb::NmrOneD 288235 Specdb::NmrOneD 288236 Specdb::NmrOneD 288237 Specdb::NmrOneD 288238 Specdb::NmrOneD 288239 Specdb::NmrOneD 288240 Specdb::NmrOneD 288241 Specdb::NmrOneD 288242 Specdb::NmrOneD 288243 Specdb::NmrOneD 288244 Specdb::NmrOneD 288245 Specdb::NmrOneD 288246 Specdb::NmrOneD 288247 Specdb::NmrOneD 288248 Specdb::NmrOneD 288249 Specdb::NmrOneD 288250 Specdb::NmrOneD 288251 Specdb::NmrOneD 288252 Specdb::NmrOneD 288253 Specdb::NmrOneD 288254 HMDB06915 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Macrophage migration inhibitory factor P14174 MIF