1.0 2011-09-21 01:23:25 UTC 2015-07-21 06:59:06 UTC FDB027373 9(10)-EpODE 9(10)-EpODE is an epoxy fatty acid where linolenic acid has been epoxidized at the 9-10 positions through the action of cytochrome P450 epoxygenases. Epoxy fatty acids are termed 'leukotoxins' (the term includes a range of diverse compounds), because they produce their primary toxic effects against leukocytes. At high dosages, they have toxic cardiovascular effects, which can even result in death. [HMDB] 9(10)-epoxy-12Z,15Z-octadecadienoate 9(10)-epoxy-12Z,15Z-octadecadienoic acid a-9(10)-EpODE alpha-9(10)-EpODE C18H30O3 294.429 294.219494826 8-[3-(octa-2,5-dien-1-yl)oxiran-2-yl]octanoic acid 8-[3-(octa-2,5-dien-1-yl)oxiran-2-yl]octanoic acid CCC=CCC=CCC1OC1CCCCCCCC(O)=O InChI=1S/C18H30O3/c1-2-3-4-5-7-10-13-16-17(21-16)14-11-8-6-9-12-15-18(19)20/h3-4,7,10,16-17H,2,5-6,8-9,11-15H2,1H3,(H,19,20) JTEGNNHWOIJBJZ-UHFFFAOYSA-N belongs to the class of organic compounds known as medium-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 4 and 12 carbon atoms. Medium-chain fatty acids Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acids and conjugates Aliphatic heteromonocyclic compounds Carbonyl compounds Carboxylic acids Dialkyl ethers Epoxides Epoxy fatty acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Oxacyclic compounds Aliphatic heteromonocyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Dialkyl ether Epoxy fatty acid Ether Heterocyclic fatty acid Hydrocarbon derivative Medium-chain fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Oxirane Solid logp 5.73 ALOGPS logs -5.52 ALOGPS solubility 8.95e-04 g/l ALOGPS logp 5.12 ChemAxon pka_strongest_acidic 4.62 ChemAxon pka_strongest_basic -4.2 ChemAxon iupac 8-[3-(octa-2,5-dien-1-yl)oxiran-2-yl]octanoic acid ChemAxon average_mass 294.429 ChemAxon mono_mass 294.219494826 ChemAxon smiles CCC=CCC=CCC1OC1CCCCCCCC(O)=O ChemAxon formula C18H30O3 ChemAxon inchi InChI=1S/C18H30O3/c1-2-3-4-5-7-10-13-16-17(21-16)14-11-8-6-9-12-15-18(19)20/h3-4,7,10,16-17H,2,5-6,8-9,11-15H2,1H3,(H,19,20) ChemAxon inchikey JTEGNNHWOIJBJZ-UHFFFAOYSA-N ChemAxon polar_surface_area 49.83 ChemAxon refractivity 88.04 ChemAxon polarizability 36.84 ChemAxon rotatable_bond_count 13 ChemAxon acceptor_count 3 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon HMDB10220