1.0 2011-09-21 01:24:54 UTC 2015-07-21 06:59:07 UTC FDB027472 Cortolone 3-glucuronide Cortolone-3-glucuronide is a natural human metabolite of cortolone generated in the liver by UDP glucuonyltransferase. Glucuronidation is used to assist in the excretion of toxic substances, drugs or other substances that cannot be used as an energy source. Glucuronic acid is attached via a glycosidic bond to the substance, and the resulting glucuronide, which has a much higher water solubility than the original substance, is eventually excreted by the kidneys. [HMDB] 20alpha-Cortolone-3-glucuronide 20beta-Cortolone-3-glucuronide Cortolone 3-O-glucuronide Cortolone-3-glucuronide C27H42O11 542.6158 542.272712186 (2S,3S,4S,5R,6R)-6-{[14-(1,2-dihydroxyethyl)-14-hydroxy-2,15-dimethyl-17-oxotetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-4-yl]oxy}-3,4,5-trihydroxyoxane-2-carboxylic acid (2S,3S,4S,5R,6R)-6-{[14-(1,2-dihydroxyethyl)-14-hydroxy-2,15-dimethyl-17-oxotetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-4-yl]oxy}-3,4,5-trihydroxyoxane-2-carboxylic acid 56162-46-0 CC12CC(=O)C3C(CCC4CCC(CC34C)O[C@@H]3O[C@@H]([C@@H](O)[C@H](O)[C@H]3O)C(O)=O)C1CCC2(O)C(O)CO InChI=1S/C27H42O11/c1-25-9-13(37-24-21(33)19(31)20(32)22(38-24)23(34)35)5-3-12(25)4-6-14-15-7-8-27(36,17(30)11-28)26(15,2)10-16(29)18(14)25/h12-15,17-22,24,28,30-33,36H,3-11H2,1-2H3,(H,34,35)/t12?,13?,14?,15?,17?,18?,19-,20-,21+,22-,24+,25?,26?,27?/m0/s1 OKNSFVSKHQJVRN-XAYCFROHSA-N belongs to the class of organic compounds known as steroidal glycosides. These are sterol lipids containing a carbohydrate moiety glycosidically linked to the steroid skeleton. Steroidal glycosides Organic compounds Lipids and lipid-like molecules Steroids and steroid derivatives Steroidal glycosides Aliphatic heteropolycyclic compounds 11-oxosteroids 17-hydroxysteroids 21-hydroxysteroids Acetals Beta hydroxy acids and derivatives Carboxylic acids Cyclic alcohols and derivatives Diterpene glycosides Diterpenoids Hexoses Hydrocarbon derivatives Ketones Monocarboxylic acids and derivatives O-glucuronides O-glycosyl compounds Organic oxides Oxacyclic compounds Oxanes Polyols Pregnane steroids Primary alcohols Pyrans Secondary alcohols Tertiary alcohols 1-o-glucuronide 11-oxosteroid 17-hydroxysteroid 20-hydroxysteroid 21-hydroxysteroid Acetal Alcohol Aliphatic heteropolycyclic compound Beta-hydroxy acid Carbonyl group Carboxylic acid Carboxylic acid derivative Cyclic alcohol Diterpene glycoside Diterpenoid Glucuronic acid or derivatives Glycosyl compound Hexose monosaccharide Hydrocarbon derivative Hydroxy acid Hydroxysteroid Ketone Monocarboxylic acid or derivatives Monosaccharide O-glucuronide O-glycosyl compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Oxane Oxosteroid Polyol Pregnane-skeleton Primary alcohol Pyran Secondary alcohol Steroidal glycoside Terpene glycoside Tertiary alcohol Solid logp -0.01 ALOGPS logs -2.45 ALOGPS solubility 1.90e+00 g/l ALOGPS logp -0.57 ChemAxon pka_strongest_acidic 3.56 ChemAxon pka_strongest_basic -3 ChemAxon iupac (2S,3S,4S,5R,6R)-6-{[14-(1,2-dihydroxyethyl)-14-hydroxy-2,15-dimethyl-17-oxotetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-4-yl]oxy}-3,4,5-trihydroxyoxane-2-carboxylic acid ChemAxon average_mass 542.6158 ChemAxon mono_mass 542.272712186 ChemAxon smiles CC12CC(=O)C3C(CCC4CCC(CC34C)O[C@@H]3O[C@@H]([C@@H](O)[C@H](O)[C@H]3O)C(O)=O)C1CCC2(O)C(O)CO ChemAxon formula C27H42O11 ChemAxon inchi InChI=1S/C27H42O11/c1-25-9-13(37-24-21(33)19(31)20(32)22(38-24)23(34)35)5-3-12(25)4-6-14-15-7-8-27(36,17(30)11-28)26(15,2)10-16(29)18(14)25/h12-15,17-22,24,28,30-33,36H,3-11H2,1-2H3,(H,34,35)/t12?,13?,14?,15?,17?,18?,19-,20-,21+,22-,24+,25?,26?,27?/m0/s1 ChemAxon inchikey OKNSFVSKHQJVRN-XAYCFROHSA-N ChemAxon polar_surface_area 194.21 ChemAxon refractivity 129.72 ChemAxon polarizability 56.6 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 11 ChemAxon donor_count 7 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::NmrOneD 92272 Specdb::NmrOneD 92273 Specdb::NmrOneD 92274 Specdb::NmrOneD 92275 Specdb::NmrOneD 92276 Specdb::NmrOneD 92277 Specdb::NmrOneD 92278 Specdb::NmrOneD 92279 Specdb::NmrOneD 92280 Specdb::NmrOneD 92281 Specdb::NmrOneD 92282 Specdb::NmrOneD 92283 Specdb::NmrOneD 92284 Specdb::NmrOneD 92285 Specdb::NmrOneD 92286 Specdb::NmrOneD 92287 Specdb::NmrOneD 92288 Specdb::NmrOneD 92289 Specdb::NmrOneD 92290 Specdb::NmrOneD 92291 Specdb::MsMs 59163 Specdb::MsMs 59164 Specdb::MsMs 59165 Specdb::MsMs 115227 Specdb::MsMs 115228 Specdb::MsMs 115229 Specdb::MsMs 2673233 Specdb::MsMs 2673234 Specdb::MsMs 2673235 Specdb::MsMs 3031511 Specdb::MsMs 3031512 Specdb::MsMs 3031513 Specdb::CMs 11621 Specdb::CMs 270659 Specdb::CMs 270660 Specdb::CMs 270661 Specdb::CMs 270662 Specdb::CMs 270663 Specdb::CMs 270664 Specdb::CMs 270665 Specdb::CMs 270666 Specdb::CMs 270667 Specdb::CMs 270668 Specdb::CMs 270669 Specdb::CMs 270670 Specdb::CMs 270671 Specdb::CMs 270672 Specdb::CMs 270673 Specdb::CMs 270674 Specdb::CMs 270675 Specdb::CMs 270676 Specdb::CMs 270677 Specdb::CMs 270678 Specdb::CMs 270679 Specdb::CMs 270680 Specdb::CMs 270681 Specdb::CMs 270682 HMDB10320 #<Reference:0x000055ce3241fab8> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Beta-glucuronidase P08236 GUSB UDP-glucuronosyltransferase 1-1 P22309 UGT1A1 UDP-glucuronosyltransferase 1-3 P35503 UGT1A3 UDP-glucuronosyltransferase 1-4 P22310 UGT1A4 UDP-glucuronosyltransferase 1-5 P35504 UGT1A5 UDP-glucuronosyltransferase 1-6 P19224 UGT1A6 UDP-glucuronosyltransferase 1-9 O60656 UGT1A9 UDP-glucuronosyltransferase 2A1 Q9Y4X1 UGT2A1 UDP-glucuronosyltransferase 2A3 Q6UWM9 UGT2A3 UDP-glucuronosyltransferase 2B11 O75310 UGT2B11 UDP-glucuronosyltransferase 2B15 P54855 UGT2B15 UDP-glucuronosyltransferase 2B17 O75795 UGT2B17 UDP-glucuronosyltransferase 2B28 Q9BY64 UGT2B28 UDP-glucuronosyltransferase 2B4 P06133 UGT2B4 UDP-glucuronosyltransferase 2B7 P16662 UGT2B7