1.0 2011-09-21 01:24:58 UTC 2015-07-21 06:59:07 UTC FDB027475 Phenethylamine glucuronide Phenethylamine glucuronide is a natural human metabolite of Phenethylamine generated in the liver by UDP glucuonyltransferase. Glucuronidation is used to assist in the excretion of toxic substances, drugs or other substances that cannot be used as an energy source. Glucuronic acid is attached via a glycosidic bond to the substance, and the resulting glucuronide, which has a much higher water solubility than the original substance, is eventually excreted by the kidneys. [HMDB] C14H19NO6 297.3038 297.121237345 (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2-phenylethyl)amino]oxane-2-carboxylic acid phenethylamine glucuronide O[C@@H]1[C@@H](O)[C@H](NCCC2=CC=CC=C2)O[C@@H]([C@H]1O)C(O)=O InChI=1S/C14H19NO6/c16-9-10(17)12(14(19)20)21-13(11(9)18)15-7-6-8-4-2-1-3-5-8/h1-5,9-13,15-18H,6-7H2,(H,19,20)/t9-,10-,11+,12-,13+/m0/s1 OYNLGXUYULDVEJ-IEECTRCBSA-N belongs to the class of organic compounds known as n-glucuronides. These are glucuronides in which the aglycone is linked to the carbohydrate unit through a N-glycosidic bond. N-glucuronides Organic compounds Organic oxygen compounds Organooxygen compounds Carbohydrates and carbohydrate conjugates Aromatic heteromonocyclic compounds Amino acids Benzene and substituted derivatives Beta hydroxy acids and derivatives Carbonyl compounds Carboxylic acids Dialkylamines Glycosylamines Hemiaminals Hydrocarbon derivatives Monocarboxylic acids and derivatives Monosaccharides Organic oxides Organopnictogen compounds Oxacyclic compounds Oxanes Polyols Pyrans Secondary alcohols 1-n-glucuronide Alcohol Amine Amino acid Amino acid or derivatives Aromatic heteromonocyclic compound Benzenoid Beta-hydroxy acid Carbonyl group Carboxylic acid Carboxylic acid derivative Glycosyl compound Hemiaminal Hydrocarbon derivative Hydroxy acid Monocarboxylic acid or derivatives Monocyclic benzene moiety Monosaccharide N-glucuronide N-glycosyl compound Organic nitrogen compound Organic oxide Organoheterocyclic compound Organonitrogen compound Organopnictogen compound Oxacycle Oxane Polyol Pyran Secondary alcohol Secondary aliphatic amine Secondary amine Solid logp -1.46 ALOGPS logs -1.16 ALOGPS solubility 2.07e+01 g/l ALOGPS logp -2.7 ChemAxon pka_strongest_acidic 3.3 ChemAxon pka_strongest_basic 7.81 ChemAxon iupac (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2-phenylethyl)amino]oxane-2-carboxylic acid ChemAxon average_mass 297.3038 ChemAxon mono_mass 297.121237345 ChemAxon smiles O[C@@H]1[C@@H](O)[C@H](NCCC2=CC=CC=C2)O[C@@H]([C@H]1O)C(O)=O ChemAxon formula C14H19NO6 ChemAxon inchi InChI=1S/C14H19NO6/c16-9-10(17)12(14(19)20)21-13(11(9)18)15-7-6-8-4-2-1-3-5-8/h1-5,9-13,15-18H,6-7H2,(H,19,20)/t9-,10-,11+,12-,13+/m0/s1 ChemAxon inchikey OYNLGXUYULDVEJ-IEECTRCBSA-N ChemAxon polar_surface_area 119.25 ChemAxon refractivity 71.59 ChemAxon polarizability 29.88 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 7 ChemAxon donor_count 5 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 17830 Specdb::CMs 39447 Specdb::CMs 174696 Specdb::NmrOneD 92292 Specdb::NmrOneD 92293 Specdb::NmrOneD 92294 Specdb::NmrOneD 92295 Specdb::NmrOneD 92296 Specdb::NmrOneD 92297 Specdb::NmrOneD 92298 Specdb::NmrOneD 92299 Specdb::NmrOneD 92300 Specdb::NmrOneD 92301 Specdb::NmrOneD 92302 Specdb::NmrOneD 92303 Specdb::NmrOneD 92304 Specdb::NmrOneD 92305 Specdb::NmrOneD 92306 Specdb::NmrOneD 92307 Specdb::NmrOneD 92308 Specdb::NmrOneD 92309 Specdb::NmrOneD 92310 Specdb::NmrOneD 92311 Specdb::MsMs 305482 Specdb::MsMs 305483 Specdb::MsMs 305484 Specdb::MsMs 348904 Specdb::MsMs 348905 Specdb::MsMs 348906 Specdb::MsMs 2352967 Specdb::MsMs 2352968 Specdb::MsMs 2352969 Specdb::MsMs 2585683 Specdb::MsMs 2585684 Specdb::MsMs 2585685 HMDB10323 Beta-glucuronidase P08236 GUSB UDP-glucuronosyltransferase 1-1 P22309 UGT1A1 UDP-glucuronosyltransferase 1-3 P35503 UGT1A3 UDP-glucuronosyltransferase 1-4 P22310 UGT1A4 UDP-glucuronosyltransferase 1-5 P35504 UGT1A5 UDP-glucuronosyltransferase 1-6 P19224 UGT1A6 UDP-glucuronosyltransferase 1-9 O60656 UGT1A9 UDP-glucuronosyltransferase 2A1 Q9Y4X1 UGT2A1 UDP-glucuronosyltransferase 2A3 Q6UWM9 UGT2A3 UDP-glucuronosyltransferase 2B11 O75310 UGT2B11 UDP-glucuronosyltransferase 2B15 P54855 UGT2B15 UDP-glucuronosyltransferase 2B17 O75795 UGT2B17 UDP-glucuronosyltransferase 2B28 Q9BY64 UGT2B28 UDP-glucuronosyltransferase 2B4 P06133 UGT2B4 UDP-glucuronosyltransferase 2B7 P16662 UGT2B7