1.0 2011-09-21 01:25:16 UTC 2015-07-21 06:59:08 UTC FDB027493 Dextrorphan O-glucuronide Dextrorphan O-glucuronide is a natural human metabolite of Dextrorphan generated in the liver by UDP glucuonyltransferase. Glucuronidation is used to assist in the excretion of toxic substances, drugs or other substances that cannot be used as an energy source. Glucuronic acid is attached via a glycosidic bond to the substance, and the resulting glucuronide, which has a much higher water solubility than the original substance, is eventually excreted by the kidneys. [HMDB] 17-methyl-9a,13a,14a-morphinan-3-yl D-glucopyranosiduronic acid 17-methyl-9alpha,13alpha,14alpha-morphinan-3-yl D-glucopyranosiduronic acid dextrorphan O-glucuronoside C23H31NO7 433.4947 433.210052351 (2S,3S,4S,5R)-3,4,5-trihydroxy-6-{[(1S,9S,10S)-17-methyl-17-azatetracyclo[7.5.3.0¹,¹⁰.0²,⁷]heptadeca-2(7),3,5-trien-4-yl]oxy}oxane-2-carboxylic acid dextrorphan O-glucuronide [H][C@]12CC3=C(C=C(OC4O[C@@H]([C@@H](O)[C@H](O)[C@H]4O)C(O)=O)C=C3)[C@@]3(CCCC[C@]13[H])CCN2C InChI=1S/C23H31NO7/c1-24-9-8-23-7-3-2-4-14(23)16(24)10-12-5-6-13(11-15(12)23)30-22-19(27)17(25)18(26)20(31-22)21(28)29/h5-6,11,14,16-20,22,25-27H,2-4,7-10H2,1H3,(H,28,29)/t14-,16-,17+,18+,19-,20+,22?,23-/m1/s1 YQAUTKINOXBFCA-WCUIRXETSA-N belongs to the class of organic compounds known as morphinans. These are polycyclic compounds with a four-ring skeleton with three condensed six-member rings forming a partially hydrogenated phenanthrene moiety, one of which is aromatic while the two others are alicyclic. Morphinans Organic compounds Alkaloids and derivatives Morphinans Aromatic heteropolycyclic compounds Acetals Alkyl glycosides Amino acids Aralkylamines Azacyclic compounds Benzazocines Beta hydroxy acids and derivatives Carbonyl compounds Carboxylic acids Fatty acyl glycosides of mono- and disaccharides Hydrocarbon derivatives Monocarboxylic acids and derivatives Monosaccharides O-glucuronides O-glycosyl compounds Organic oxides Organopnictogen compounds Oxacyclic compounds Oxanes Phenanthrenes and derivatives Phenolic glycosides Piperidines Polyols Pyrans Secondary alcohols Tetralins Trialkylamines 1-o-glucuronide Acetal Alcohol Alkyl glycoside Amine Amino acid Amino acid or derivatives Aralkylamine Aromatic heteropolycyclic compound Azacycle Benzazocine Benzenoid Beta-hydroxy acid Carbonyl group Carboxylic acid Carboxylic acid derivative Fatty acyl Fatty acyl glycoside Fatty acyl glycoside of mono- or disaccharide Glucuronic acid or derivatives Glycosyl compound Hydrocarbon derivative Hydroxy acid Monocarboxylic acid or derivatives Monosaccharide Morphinan O-glucuronide O-glycosyl compound Organic nitrogen compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Oxacycle Oxane Phenanthrene Phenolic glycoside Piperidine Polyol Pyran Secondary alcohol Tertiary aliphatic amine Tertiary amine Tetralin Solid logp 1.38 ALOGPS logs -2.56 ALOGPS solubility 1.20e+00 g/l ALOGPS logp -1.3 ChemAxon pka_strongest_acidic 2.85 ChemAxon pka_strongest_basic 9.82 ChemAxon iupac (2S,3S,4S,5R)-3,4,5-trihydroxy-6-{[(1S,9S,10S)-17-methyl-17-azatetracyclo[7.5.3.0¹,¹⁰.0²,⁷]heptadeca-2(7),3,5-trien-4-yl]oxy}oxane-2-carboxylic acid ChemAxon average_mass 433.4947 ChemAxon mono_mass 433.210052351 ChemAxon smiles [H][C@]12CC3=C(C=C(OC4O[C@@H]([C@@H](O)[C@H](O)[C@H]4O)C(O)=O)C=C3)[C@@]3(CCCC[C@]13[H])CCN2C ChemAxon formula C23H31NO7 ChemAxon inchi InChI=1S/C23H31NO7/c1-24-9-8-23-7-3-2-4-14(23)16(24)10-12-5-6-13(11-15(12)23)30-22-19(27)17(25)18(26)20(31-22)21(28)29/h5-6,11,14,16-20,22,25-27H,2-4,7-10H2,1H3,(H,28,29)/t14-,16-,17+,18+,19-,20+,22?,23-/m1/s1 ChemAxon inchikey YQAUTKINOXBFCA-WCUIRXETSA-N ChemAxon polar_surface_area 119.69 ChemAxon refractivity 110.09 ChemAxon polarizability 44.75 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 8 ChemAxon donor_count 4 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::NmrOneD 150640 Specdb::NmrOneD 150641 Specdb::NmrOneD 150642 Specdb::NmrOneD 150643 Specdb::NmrOneD 150644 Specdb::NmrOneD 150645 Specdb::NmrOneD 150646 Specdb::NmrOneD 150647 Specdb::NmrOneD 150648 Specdb::NmrOneD 150649 Specdb::NmrOneD 150650 Specdb::NmrOneD 150651 Specdb::NmrOneD 150652 Specdb::NmrOneD 150653 Specdb::NmrOneD 150654 Specdb::NmrOneD 150655 Specdb::NmrOneD 150656 Specdb::NmrOneD 150657 Specdb::NmrOneD 150658 Specdb::NmrOneD 150659 Specdb::CMs 23924 Specdb::CMs 39463 Specdb::CMs 154811 Specdb::CMs 154814 Specdb::CMs 154816 Specdb::CMs 154818 Specdb::CMs 166778 Specdb::CMs 280008 Specdb::MsMs 319030 Specdb::MsMs 319031 Specdb::MsMs 319032 Specdb::MsMs 366001 Specdb::MsMs 366002 Specdb::MsMs 366003 Specdb::MsMs 2347532 Specdb::MsMs 2347533 Specdb::MsMs 2347534 Specdb::MsMs 2592076 Specdb::MsMs 2592077 Specdb::MsMs 2592078 HMDB10341 32645 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Beta-glucuronidase P08236 GUSB UDP-glucuronosyltransferase 1-1 P22309 UGT1A1 UDP-glucuronosyltransferase 1-3 P35503 UGT1A3 UDP-glucuronosyltransferase 1-4 P22310 UGT1A4 UDP-glucuronosyltransferase 1-5 P35504 UGT1A5 UDP-glucuronosyltransferase 1-6 P19224 UGT1A6 UDP-glucuronosyltransferase 1-9 O60656 UGT1A9 UDP-glucuronosyltransferase 2A1 Q9Y4X1 UGT2A1 UDP-glucuronosyltransferase 2A3 Q6UWM9 UGT2A3 UDP-glucuronosyltransferase 2B11 O75310 UGT2B11 UDP-glucuronosyltransferase 2B15 P54855 UGT2B15 UDP-glucuronosyltransferase 2B17 O75795 UGT2B17 UDP-glucuronosyltransferase 2B28 Q9BY64 UGT2B28 UDP-glucuronosyltransferase 2B4 P06133 UGT2B4 UDP-glucuronosyltransferase 2B7 P16662 UGT2B7