1.0 2011-09-21 01:25:56 UTC 2025-11-19 02:53:13 UTC FDB027529 5,8,11-Eicosatrienoic acid 5,8,11-Eicosatrienoic acid (Mead acid) is a carboxylic acid with a 20-carbon chain and three methylene-interrupted cis double bonds. The first double bond is located at the ninth carbon from the omega end. In physiological literature, it is given the name 20:3(n-9). In the presence of lipoxygenase, Mead acid can form various hydroxy products (HETE). It is the only polyunsaturated fatty acid that the body can make de novo. Its elevated presence in the blood is an indication of essential fatty acid (EFA)deficiency. During dietary EFA insufficiency, especially arachidonic acid deficiency, the body will make Mead acid by the elongation and desaturation of oleic acid. [HMDB] (5Z,8Z,11Z)-Eicosa-5,8,11-trienoate (5Z,8Z,11Z)-Eicosa-5,8,11-trienoic acid (5Z,8Z,11Z)-Eicosatrienoate (5Z,8Z,11Z)-Eicosatrienoic acid (Z,Z,Z)-5,8,11-Eicosatrienoate (Z,Z,Z)-5,8,11-Eicosatrienoic acid 5,8,11-Eicosatrienoate 5,8,11-Eicosatrienoic acid 5Z,8Z,11Z-Eicosatrienoate 5Z,8Z,11Z-Eicosatrienoic acid 5Z,8Z,11Z-Icosatrienoate 5Z,8Z,11Z-Icosatrienoic acid all-cis-5,8,11-Eicosatrienoate all-cis-5,8,11-Eicosatrienoic acid all-cis-Eicosa-5,8,11-trienoate all-cis-Eicosa-5,8,11-trienoic acid all-cis-Icosa-5,8,11-trienoate all-cis-Icosa-5,8,11-trienoic acid C20:3N-9,12,15 cis-5,8,11-Eicosatrienoate cis-5,8,11-Eicosatrienoic acid ETrE(5Z, 8Z, 11Z) ETrE(5Z,8Z,11Z) Mead acid C20H34O2 306.4828 306.255880332 icosa-5,8,11-trienoic acid mead acid 20590-32-3 CCCCCCCCC=CCC=CCC=CCCCC(O)=O InChI=1S/C20H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h9-10,12-13,15-16H,2-8,11,14,17-19H2,1H3,(H,21,22) UNSRRHDPHVZAHH-UHFFFAOYSA-N belongs to the class of organic compounds known as long-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 13 and 21 carbon atoms. Long-chain fatty acids Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acids and conjugates Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Straight chain fatty acids Unsaturated fatty acids Aliphatic acyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Long-chain fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Straight chain fatty acid Unsaturated fatty acid Solid logp 7.35 ALOGPS logs -6.62 ALOGPS solubility 7.27e-05 g/l ALOGPS logp 6.95 ChemAxon pka_strongest_acidic 4.82 ChemAxon iupac icosa-5,8,11-trienoic acid ChemAxon average_mass 306.4828 ChemAxon mono_mass 306.255880332 ChemAxon smiles CCCCCCCCC=CCC=CCC=CCCCC(O)=O ChemAxon formula C20H34O2 ChemAxon inchi InChI=1S/C20H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h9-10,12-13,15-16H,2-8,11,14,17-19H2,1H3,(H,21,22) ChemAxon inchikey UNSRRHDPHVZAHH-UHFFFAOYSA-N ChemAxon polar_surface_area 37.3 ChemAxon refractivity 98.84 ChemAxon polarizability 39.33 ChemAxon rotatable_bond_count 15 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 3401722 Specdb::MsMs 3401723 Specdb::MsMs 3401724 Specdb::MsMs 3401725 Specdb::MsMs 3401726 Specdb::MsMs 3401727 Specdb::CMs 114170 Specdb::CMs 128159 Specdb::CMs 816198 Specdb::CMs 816199 HMDB10378 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823