1.0 2011-09-21 01:31:11 UTC 2015-07-21 06:59:16 UTC FDB027868 (R)-3-Hydroxyhexanoic acid ==(R)==-3-Hydroxyhexanoic acid is a fatty acid formed by the action of fatty acid synthases from acetyl-CoA and malonyl-CoA precursors. It is involved in the fatty acid biosynthesis. Specifically, it is the product of reaction between 3-Oxohexanoic acid and 2 enzymes; fatty-acid Synthase and 3-oxoacyl- [acyl-carrier-protein] reductase. [HMDB] C6H12O3 132.1577 132.07864425 (3R)-3-hydroxyhexanoic acid 3R-hydroxy-hexanoic acid 77877-35-1 [H][C@@](O)(CCC)CC(O)=O InChI=1S/C6H12O3/c1-2-3-5(7)4-6(8)9/h5,7H,2-4H2,1H3,(H,8,9)/t5-/m1/s1 HPMGFDVTYHWBAG-RXMQYKEDSA-N belongs to the class of organic compounds known as medium-chain hydroxy acids and derivatives. These are hydroxy acids with a 6 to 12 carbon atoms long side chain. Medium-chain hydroxy acids and derivatives Organic compounds Organic acids and derivatives Hydroxy acids and derivatives Medium-chain hydroxy acids and derivatives Aliphatic acyclic compounds Beta hydroxy acids and derivatives Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Hydroxy fatty acids Medium-chain fatty acids Monocarboxylic acids and derivatives Organic oxides Secondary alcohols Alcohol Aliphatic acyclic compound Beta-hydroxy acid Carbonyl group Carboxylic acid Carboxylic acid derivative Fatty acid Fatty acyl Hydrocarbon derivative Hydroxy fatty acid Medium-chain fatty acid Medium-chain hydroxy acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Secondary alcohol Hydroxy fatty acids Solid logp 0.57 ALOGPS logs 0.00 ALOGPS solubility 1.33e+02 g/l ALOGPS melting_point Mp 41 - 41.6 logp 0.58 ChemAxon pka_strongest_acidic 4.67 ChemAxon pka_strongest_basic -2.8 ChemAxon iupac (3R)-3-hydroxyhexanoic acid ChemAxon average_mass 132.1577 ChemAxon mono_mass 132.07864425 ChemAxon smiles [H][C@@](O)(CCC)CC(O)=O ChemAxon formula C6H12O3 ChemAxon inchi InChI=1S/C6H12O3/c1-2-3-5(7)4-6(8)9/h5,7H,2-4H2,1H3,(H,8,9)/t5-/m1/s1 ChemAxon inchikey HPMGFDVTYHWBAG-RXMQYKEDSA-N ChemAxon polar_surface_area 57.53 ChemAxon refractivity 32.59 ChemAxon polarizability 13.87 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Fatty Acid Biosynthesis SMP00456 Specdb::CMs 3370 Specdb::CMs 39526 Specdb::CMs 150584 Specdb::MsIr 2468 Specdb::MsIr 2469 Specdb::MsIr 2470 Specdb::MsMs 182901 Specdb::MsMs 182902 Specdb::MsMs 182903 Specdb::MsMs 183249 Specdb::MsMs 183250 Specdb::MsMs 183251 Specdb::MsMs 2354637 Specdb::MsMs 2354638 Specdb::MsMs 2354639 Specdb::MsMs 2607882 Specdb::MsMs 2607883 Specdb::MsMs 2607884 HMDB10718 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823