1.0 2011-09-21 01:31:16 UTC 2015-07-21 06:59:16 UTC FDB027873 (R)-3-Hydroxydecanoic acid In humans fatty acids are predominantly formed in the liver and adipose tissue, and mammary glands during lactation.(R)-3-Hydroxydecanoic acid is an intermediate in fatty acid biosynthesis. Specifically,(R)-3-Hydroxydecanoic acid is converted from 3-Oxodecanoic acid via two enzymes; fatty-acid Synthase and 3-oxoacyl- [acyl-carrier- protein] reductase.( EC:2.3.1.85 and EC:1.1.1.100) [HMDB] C10H20O3 188.264 188.141244506 (3R)-3-hydroxydecanoic acid (R)-3-hydroxydecanoic acid [H][C@@](O)(CCCCCCC)CC(O)=O InChI=1S/C10H20O3/c1-2-3-4-5-6-7-9(11)8-10(12)13/h9,11H,2-8H2,1H3,(H,12,13)/t9-/m1/s1 FYSSBMZUBSBFJL-SECBINFHSA-N belongs to the class of organic compounds known as medium-chain hydroxy acids and derivatives. These are hydroxy acids with a 6 to 12 carbon atoms long side chain. Medium-chain hydroxy acids and derivatives Organic compounds Organic acids and derivatives Hydroxy acids and derivatives Medium-chain hydroxy acids and derivatives Aliphatic acyclic compounds Beta hydroxy acids and derivatives Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Hydroxy fatty acids Medium-chain fatty acids Monocarboxylic acids and derivatives Organic oxides Secondary alcohols Alcohol Aliphatic acyclic compound Beta-hydroxy acid Carbonyl group Carboxylic acid Carboxylic acid derivative Fatty acid Fatty acyl Hydrocarbon derivative Hydroxy fatty acid Medium-chain fatty acid Medium-chain hydroxy acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Secondary alcohol Hydroxy fatty acids Solid logp 2.60 ALOGPS logs -2.03 ALOGPS solubility 1.74e+00 g/l ALOGPS logp 2.36 ChemAxon pka_strongest_acidic 4.67 ChemAxon pka_strongest_basic -2.8 ChemAxon iupac (3R)-3-hydroxydecanoic acid ChemAxon average_mass 188.264 ChemAxon mono_mass 188.141244506 ChemAxon smiles [H][C@@](O)(CCCCCCC)CC(O)=O ChemAxon formula C10H20O3 ChemAxon inchi InChI=1S/C10H20O3/c1-2-3-4-5-6-7-9(11)8-10(12)13/h9,11H,2-8H2,1H3,(H,12,13)/t9-/m1/s1 ChemAxon inchikey FYSSBMZUBSBFJL-SECBINFHSA-N ChemAxon polar_surface_area 57.53 ChemAxon refractivity 50.99 ChemAxon polarizability 22.35 ChemAxon rotatable_bond_count 8 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Fatty Acid Biosynthesis SMP00456 Specdb::CMs 3065 Specdb::CMs 39532 Specdb::CMs 151095 Specdb::MsMs 182811 Specdb::MsMs 182812 Specdb::MsMs 182813 Specdb::MsMs 183159 Specdb::MsMs 183160 Specdb::MsMs 183161 Specdb::MsMs 2302932 Specdb::MsMs 2302933 Specdb::MsMs 2302934 Specdb::MsMs 3065318 Specdb::MsMs 3065319 Specdb::MsMs 3065320 HMDB10725 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Fatty acid synthase P49327 FASN