1.0 2011-09-21 01:31:23 UTC 2017-04-03 05:02:18 UTC FDB027882 trans-Hexa-dec-2-enoic acid In humans fatty acids are predominantly formed in the liver and adipose tissue, and mammary glands during lactation. Trans-hexa-dec-2-enoic acid is an intermediate in fatty acid biosynthesis. Specifically, trans-hexa-dec-2-enoic acid converted from (R)-3-Hydroxy-hexadecanoic acid via two enzymes; fatty-acid Synthase and 3- Hydroxypalmitoyl- [acyl-carrier-protein] dehydratase (EC: 2.3.1.85 and EC: 4.2.1.61). [HMDB] (2e)-Hexadecenoate (2e)-Hexadecenoic acid (e)-2-Hexadecenoate (e)-2-Hexadecenoic acid 2-Palmitoleate 2-Palmitoleic acid 2-trans-Hexadecenoate 2-trans-Hexadecenoic acid Gaidate Gaidic acid t-16:1D2 t-2-Hexadecenoate t-2-Hexadecenoic acid trans-2-Hexadecenoate trans-2-Hexadecenoic acid trans-delta(2)-Hexadecenoate trans-Delta(2)-Hexadecenoic acid trans-Hexadec-2-enoate trans-Hexadec-2-enoic acid trans-δ(2)-hexadecenoate trans-δ(2)-hexadecenoic acid C16H30O2 254.4082 254.224580204 (2E)-hexadec-2-enoic acid hexadecenoic acid 373-49-9 CCCCCCCCCCCCC\C=C\C(O)=O InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h14-15H,2-13H2,1H3,(H,17,18)/b15-14+ ZVRMGCSSSYZGSM-CCEZHUSRSA-N belongs to the class of organic compounds known as long-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 13 and 21 carbon atoms. Long-chain fatty acids Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acids and conjugates Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Straight chain fatty acids Unsaturated fatty acids Aliphatic acyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Long-chain fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Straight chain fatty acid Unsaturated fatty acid Unsaturated fatty acids alpha,beta-unsaturated monocarboxylic acid hexadecenoic acid Solid logp 6.25 ChemAxon pka_strongest_acidic 5.03 ChemAxon iupac (2E)-hexadec-2-enoic acid ChemAxon average_mass 254.4082 ChemAxon mono_mass 254.224580204 ChemAxon smiles CCCCCCCCCCCCC\C=C\C(O)=O ChemAxon formula C16H30O2 ChemAxon inchi InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h14-15H,2-13H2,1H3,(H,17,18)/b15-14+ ChemAxon inchikey ZVRMGCSSSYZGSM-CCEZHUSRSA-N ChemAxon polar_surface_area 37.3 ChemAxon refractivity 78.18 ChemAxon polarizability 33.74 ChemAxon rotatable_bond_count 13 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Fatty Acid Biosynthesis SMP00456 Specdb::CMs 1734 Specdb::CMs 3203 Specdb::CMs 31549 Specdb::CMs 39542 Specdb::CMs 158840 Specdb::MsMs 97158 Specdb::MsMs 97159 Specdb::MsMs 97160 Specdb::MsMs 161826 Specdb::MsMs 161827 Specdb::MsMs 161828 Specdb::MsMs 2816977 Specdb::MsMs 2816978 Specdb::MsMs 2816979 Specdb::MsMs 2888422 Specdb::MsMs 2888423 Specdb::MsMs 2888424 HMDB10735 Fatty acid synthase P49327 FASN