1.0 2011-09-21 01:31:57 UTC 2025-11-19 02:54:06 UTC FDB027916 Hypusine Hypusine is formed in eIF-5A by post-translational modification of one of the lysyl residues. There are two reactions and two enzymes involved:; Hypusine is an unusual amino acid found in all eukaryotes and in some archaea, but not in bacteria. The only known protein containing hypusine is eukaryotic translation initiation factor 5A (eIF-5A) and a similar protein found in archaebacteria. In human, two isoforms of eIF-5A have been described: eIF-5A-1 and eIF-5A-2. They are coded by two different genes. This protein is involved in protein biosynthesis and promotes the formation of the first peptide bond. The region surrounding the hypusine residue is highly conserved among the eukaryotes and is essential to the function of eIF-5A. Thus, hypusine and eIF-5A appear to be vital for the viability and proliferation of eukaryotic cells. [HMDB] N(6)-(4-Amino-2-hydroxybutyl)-L-lysine C10H23N3O3 233.3079 233.173941617 (2S)-2-amino-6-{[(2S)-4-amino-2-hydroxybutyl]amino}hexanoic acid hypusine 34994-11-1 NCC[C@H](O)CNCCCC[C@H](N)C(O)=O InChI=1S/C10H23N3O3/c11-5-4-8(14)7-13-6-2-1-3-9(12)10(15)16/h8-9,13-14H,1-7,11-12H2,(H,15,16)/t8-,9-/m0/s1 BZUIJMCJNWUGKQ-IUCAKERBSA-N belongs to the class of organic compounds known as l-alpha-amino acids. These are alpha amino acids which have the L-configuration of the alpha-carbon atom. L-alpha-amino acids Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds 1,2-aminoalcohols 1,3-aminoalcohols Amino acids Amino fatty acids Carbonyl compounds Carboxylic acids Dialkylamines Hydrocarbon derivatives Hydroxy fatty acids Medium-chain fatty acids Monoalkylamines Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Secondary alcohols 1,2-aminoalcohol 1,3-aminoalcohol Alcohol Aliphatic acyclic compound Amine Amino acid Amino fatty acid Carbonyl group Carboxylic acid Fatty acid Fatty acyl Hydrocarbon derivative Hydroxy fatty acid L-alpha-amino acid Medium-chain fatty acid Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine Secondary alcohol Secondary aliphatic amine Secondary amine Solid logp -3.23 ALOGPS logs -1.01 ALOGPS solubility 2.27e+01 g/l ALOGPS logp -4.4 ChemAxon pka_strongest_acidic 2.3 ChemAxon pka_strongest_basic 10.39 ChemAxon iupac (2S)-2-amino-6-{[(2S)-4-amino-2-hydroxybutyl]amino}hexanoic acid ChemAxon average_mass 233.3079 ChemAxon mono_mass 233.173941617 ChemAxon smiles NCC[C@H](O)CNCCCC[C@H](N)C(O)=O ChemAxon formula C10H23N3O3 ChemAxon inchi InChI=1S/C10H23N3O3/c11-5-4-8(14)7-13-6-2-1-3-9(12)10(15)16/h8-9,13-14H,1-7,11-12H2,(H,15,16)/t8-,9-/m0/s1 ChemAxon inchikey BZUIJMCJNWUGKQ-IUCAKERBSA-N ChemAxon polar_surface_area 121.6 ChemAxon refractivity 61.36 ChemAxon polarizability 26.12 ChemAxon rotatable_bond_count 10 ChemAxon acceptor_count 6 ChemAxon donor_count 5 ChemAxon physiological_charge 2 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 13016 Specdb::CMs 39560 Specdb::CMs 134862 Specdb::CMs 142596 Specdb::MsMs 294601 Specdb::MsMs 294602 Specdb::MsMs 294603 Specdb::MsMs 335365 Specdb::MsMs 335366 Specdb::MsMs 335367 Specdb::MsMs 2807324 Specdb::MsMs 2807325 Specdb::MsMs 2807326 Specdb::MsMs 2898495 Specdb::MsMs 2898496 Specdb::MsMs 2898497 Specdb::NmrOneD 92832 Specdb::NmrOneD 92833 Specdb::NmrOneD 92834 Specdb::NmrOneD 92835 Specdb::NmrOneD 92836 Specdb::NmrOneD 92837 Specdb::NmrOneD 92838 Specdb::NmrOneD 92839 Specdb::NmrOneD 92840 Specdb::NmrOneD 92841 Specdb::NmrOneD 92842 Specdb::NmrOneD 92843 Specdb::NmrOneD 92844 Specdb::NmrOneD 92845 Specdb::NmrOneD 92846 Specdb::NmrOneD 92847 Specdb::NmrOneD 92848 Specdb::NmrOneD 92849 Specdb::NmrOneD 92850 Specdb::NmrOneD 92851 HMDB11140 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Eukaryotic translation initiation factor 5A-1 P63241 EIF5A